Chemicals
Filtered Search Results
Ammonium carbamate, 98%
CAS: 1111-78-0 Molecular Formula: CH6N2O2 Molecular Weight (g/mol): 78.071 MDL Number: MFCD00013010 InChI Key: BVCZEBOGSOYJJT-UHFFFAOYSA-N Synonym: ammonium carbamate,ammonium aminoformate,carbamic acid, monoammonium salt,carbamic acid ammonium salt,carbamic acid ammoniate,unii-i2w9615swp,carbamic acid, ammonium salt 1:1,ammoniumcarbamate,anhydride of ammonium carbonate,azanium carbamate PubChem CID: 517232 IUPAC Name: azanium;carbamate SMILES: C(=O)(N)[O-].[NH4+]
| PubChem CID | 517232 |
|---|---|
| CAS | 1111-78-0 |
| Molecular Weight (g/mol) | 78.071 |
| MDL Number | MFCD00013010 |
| SMILES | C(=O)(N)[O-].[NH4+] |
| Synonym | ammonium carbamate,ammonium aminoformate,carbamic acid, monoammonium salt,carbamic acid ammonium salt,carbamic acid ammoniate,unii-i2w9615swp,carbamic acid, ammonium salt 1:1,ammoniumcarbamate,anhydride of ammonium carbonate,azanium carbamate |
| IUPAC Name | azanium;carbamate |
| InChI Key | BVCZEBOGSOYJJT-UHFFFAOYSA-N |
| Molecular Formula | CH6N2O2 |
Ethyl carbamate, 98%
CAS: 51-79-6 Molecular Formula: C3H7NO2 Molecular Weight (g/mol): 89.094 MDL Number: MFCD00007966 InChI Key: JOYRKODLDBILNP-UHFFFAOYSA-N Synonym: urethane,urethan,ethylurethane,carbamic acid ethyl ester,ethyl urethane,carbamic acid, ethyl ester,ethylcarbamate,pracarbamine,leucethane,pracarbamin PubChem CID: 5641 ChEBI: CHEBI:17967 IUPAC Name: ethyl carbamate SMILES: CCOC(=O)N
| PubChem CID | 5641 |
|---|---|
| CAS | 51-79-6 |
| Molecular Weight (g/mol) | 89.094 |
| ChEBI | CHEBI:17967 |
| MDL Number | MFCD00007966 |
| SMILES | CCOC(=O)N |
| Synonym | urethane,urethan,ethylurethane,carbamic acid ethyl ester,ethyl urethane,carbamic acid, ethyl ester,ethylcarbamate,pracarbamine,leucethane,pracarbamin |
| IUPAC Name | ethyl carbamate |
| InChI Key | JOYRKODLDBILNP-UHFFFAOYSA-N |
| Molecular Formula | C3H7NO2 |
Phenyl carbamate, 98+%
CAS: 622-46-8 Molecular Formula: C7H7NO2 Molecular Weight (g/mol): 137.138 MDL Number: MFCD00007961 InChI Key: BSCCSDNZEIHXOK-UHFFFAOYSA-N Synonym: carbamic acid, phenyl ester,phenol carbamate,carbamic acid phenyl ester,unii-jkb257u27v,o-phenyl carbamate,ccris 5071,phenyl aminooate,mono-phenylcarbamate,mono-phenol carbamate,phenyl carbamate PubChem CID: 69322 IUPAC Name: phenyl carbamate SMILES: C1=CC=C(C=C1)OC(=O)N
| PubChem CID | 69322 |
|---|---|
| CAS | 622-46-8 |
| Molecular Weight (g/mol) | 137.138 |
| MDL Number | MFCD00007961 |
| SMILES | C1=CC=C(C=C1)OC(=O)N |
| Synonym | carbamic acid, phenyl ester,phenol carbamate,carbamic acid phenyl ester,unii-jkb257u27v,o-phenyl carbamate,ccris 5071,phenyl aminooate,mono-phenylcarbamate,mono-phenol carbamate,phenyl carbamate |
| IUPAC Name | phenyl carbamate |
| InChI Key | BSCCSDNZEIHXOK-UHFFFAOYSA-N |
| Molecular Formula | C7H7NO2 |
9-Fluorenylmethyl carbamate, 99%
CAS: 84418-43-9 Molecular Formula: C15H13NO2 Molecular Weight (g/mol): 239.28 MDL Number: MFCD00237376 InChI Key: ZZOKVYOCRSMTSS-UHFFFAOYSA-N Synonym: 9-fluorenylmethyl carbamate,fmoc-nh2,fmoc-amide,9-fluorenylmethylcarbamate,n-9-fluorenylmethoxycarbonyl amide,fmoc amine,fmoc-amine,9-fluorenylcarbamate,9-fluorenemethane resin,pubchem12066 PubChem CID: 736301 IUPAC Name: 9H-fluoren-9-ylmethyl carbamate SMILES: C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N
| PubChem CID | 736301 |
|---|---|
| CAS | 84418-43-9 |
| Molecular Weight (g/mol) | 239.28 |
| MDL Number | MFCD00237376 |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N |
| Synonym | 9-fluorenylmethyl carbamate,fmoc-nh2,fmoc-amide,9-fluorenylmethylcarbamate,n-9-fluorenylmethoxycarbonyl amide,fmoc amine,fmoc-amine,9-fluorenylcarbamate,9-fluorenemethane resin,pubchem12066 |
| IUPAC Name | 9H-fluoren-9-ylmethyl carbamate |
| InChI Key | ZZOKVYOCRSMTSS-UHFFFAOYSA-N |
| Molecular Formula | C15H13NO2 |
methyl N-(3,5-dichlorophenyl)carbamate, Thermo Scientific™
CAS: 25217-43-0 Molecular Formula: C8H7Cl2NO2 Molecular Weight (g/mol): 220.05 MDL Number: MFCD00126402 InChI Key: FRSRGACXHCLBTC-UHFFFAOYSA-N Synonym: methyl 3,5-dichlorophenyl carbamate,methyl n-3,5-dichlorophenyl carbamate,mdpc,methyl 3,5-dichlorocarbanilate,3,5-dichlorocarbanilic acid methyl ester,carbamic acid, 3,5-dichlorophenyl-, methyl ester 9ci,carbanilic acid, 3,5-dichloro-, methyl ester,n-3,5-dichlorophenyl methoxycarboxamide,maybridge1_000169 PubChem CID: 32842 IUPAC Name: methyl N-(3,5-dichlorophenyl)carbamate SMILES: COC(=O)NC1=CC(Cl)=CC(Cl)=C1
| PubChem CID | 32842 |
|---|---|
| CAS | 25217-43-0 |
| Molecular Weight (g/mol) | 220.05 |
| MDL Number | MFCD00126402 |
| SMILES | COC(=O)NC1=CC(Cl)=CC(Cl)=C1 |
| Synonym | methyl 3,5-dichlorophenyl carbamate,methyl n-3,5-dichlorophenyl carbamate,mdpc,methyl 3,5-dichlorocarbanilate,3,5-dichlorocarbanilic acid methyl ester,carbamic acid, 3,5-dichlorophenyl-, methyl ester 9ci,carbanilic acid, 3,5-dichloro-, methyl ester,n-3,5-dichlorophenyl methoxycarboxamide,maybridge1_000169 |
| IUPAC Name | methyl N-(3,5-dichlorophenyl)carbamate |
| InChI Key | FRSRGACXHCLBTC-UHFFFAOYSA-N |
| Molecular Formula | C8H7Cl2NO2 |
tert-Butyl N-(4-formylbenzyl)carbamate, 97%, Thermo Scientific™
CAS: 156866-52-3 Molecular Formula: C13H17NO3 Molecular Weight (g/mol): 235.283 InChI Key: HRJJBEIFHFVBRT-UHFFFAOYSA-N Synonym: tert-butyl 4-formylbenzylcarbamate,tert-butyl n-4-formylbenzyl carbamate,tert-butyl n-4-formylphenyl methyl carbamate,tert-butyln-4-formylbenzyl carbamate,tert-butyl 4-formylbenzyl carbamate,tert-butyln-4-formylphenyl methyl carbamate,n-boc-4-aminomethylbenzaldehyde,tert-butyl n-4 formylbenzyl carbamate,4-aminomethyl benzaldehyde,n-boc protected,4-formyl-benzyl-carbamic acid t-butyl ester PubChem CID: 2794832 IUPAC Name: tert-butyl N-[(4-formylphenyl)methyl]carbamate SMILES: CC(C)(C)OC(=O)NCC1=CC=C(C=C1)C=O
| PubChem CID | 2794832 |
|---|---|
| CAS | 156866-52-3 |
| Molecular Weight (g/mol) | 235.283 |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=C(C=C1)C=O |
| Synonym | tert-butyl 4-formylbenzylcarbamate,tert-butyl n-4-formylbenzyl carbamate,tert-butyl n-4-formylphenyl methyl carbamate,tert-butyln-4-formylbenzyl carbamate,tert-butyl 4-formylbenzyl carbamate,tert-butyln-4-formylphenyl methyl carbamate,n-boc-4-aminomethylbenzaldehyde,tert-butyl n-4 formylbenzyl carbamate,4-aminomethyl benzaldehyde,n-boc protected,4-formyl-benzyl-carbamic acid t-butyl ester |
| IUPAC Name | tert-butyl N-[(4-formylphenyl)methyl]carbamate |
| InChI Key | HRJJBEIFHFVBRT-UHFFFAOYSA-N |
| Molecular Formula | C13H17NO3 |
tert-Butyl N-(3-thienyl)carbamate, 97%, Thermo Scientific™
CAS: 19228-91-2 Molecular Formula: C9H13NO2S Molecular Weight (g/mol): 199.268 MDL Number: MFCD01928808 InChI Key: PRWYQCYSADTIBZ-UHFFFAOYSA-N Synonym: tert-butyl thiophen-3-ylcarbamate,tert-butyl n-3-thienyl carbamate,tert-butyl 3-thienylcarbamate,tert-butyl n-thiophen-3-yl carbamate,tert-butoxy-n-3-thienyl carboxamide,carbamic acid,n-3-thienyl-, 1,1-dimethylethyl ester,n-boc-3-aminothiophene,tert-butyl thien-3-ylcarbamate,3-aminothiophene, n-boc protected PubChem CID: 736476 IUPAC Name: tert-butyl N-thiophen-3-ylcarbamate SMILES: CC(C)(C)OC(=O)NC1=CSC=C1
| PubChem CID | 736476 |
|---|---|
| CAS | 19228-91-2 |
| Molecular Weight (g/mol) | 199.268 |
| MDL Number | MFCD01928808 |
| SMILES | CC(C)(C)OC(=O)NC1=CSC=C1 |
| Synonym | tert-butyl thiophen-3-ylcarbamate,tert-butyl n-3-thienyl carbamate,tert-butyl 3-thienylcarbamate,tert-butyl n-thiophen-3-yl carbamate,tert-butoxy-n-3-thienyl carboxamide,carbamic acid,n-3-thienyl-, 1,1-dimethylethyl ester,n-boc-3-aminothiophene,tert-butyl thien-3-ylcarbamate,3-aminothiophene, n-boc protected |
| IUPAC Name | tert-butyl N-thiophen-3-ylcarbamate |
| InChI Key | PRWYQCYSADTIBZ-UHFFFAOYSA-N |
| Molecular Formula | C9H13NO2S |
tert-Butyl N-(3-formylbenzyl)carbamate, 90%, Thermo Scientific™
CAS: 170853-04-0 Molecular Formula: C13H17NO3 Molecular Weight (g/mol): 235.283 InChI Key: JORXNWZTJLYRQA-UHFFFAOYSA-N PubChem CID: 2794834 IUPAC Name: tert-butyl N-[(3-formylphenyl)methyl]carbamate SMILES: CC(C)(C)OC(=O)NCC1=CC=CC(=C1)C=O
| PubChem CID | 2794834 |
|---|---|
| CAS | 170853-04-0 |
| Molecular Weight (g/mol) | 235.283 |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=CC(=C1)C=O |
| IUPAC Name | tert-butyl N-[(3-formylphenyl)methyl]carbamate |
| InChI Key | JORXNWZTJLYRQA-UHFFFAOYSA-N |
| Molecular Formula | C13H17NO3 |
tert-Butyl N-[4-(aminomethyl)phenyl]carbamate, 97%, Thermo Scientific™
CAS: 220298-96-4 Molecular Formula: C12H18N2O2 Molecular Weight (g/mol): 222.29 MDL Number: MFCD02183573 InChI Key: URXUHALBOWYXJZ-UHFFFAOYSA-N Synonym: tert-butyl n-4-aminomethyl phenyl carbamate,4-aminomethyl-1-n-boc-aniline,tert-butyl 4-aminomethyl phenyl carbamate,4-boc-amino benzylamine,4-aminomethy-1-n-boc-aniline,4-n-boc-amino benzylamine,4-tert-butoxycarbonylamino benzylamine,4-aminomethyl-n-boc-aniline,tert-butyl-n-4-aminomethyl phenyl carbamate PubChem CID: 2794659 IUPAC Name: tert-butyl N-[4-(aminomethyl)phenyl]carbamate SMILES: CC(C)(C)OC(=O)NC1=CC=C(CN)C=C1
| PubChem CID | 2794659 |
|---|---|
| CAS | 220298-96-4 |
| Molecular Weight (g/mol) | 222.29 |
| MDL Number | MFCD02183573 |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(CN)C=C1 |
| Synonym | tert-butyl n-4-aminomethyl phenyl carbamate,4-aminomethyl-1-n-boc-aniline,tert-butyl 4-aminomethyl phenyl carbamate,4-boc-amino benzylamine,4-aminomethy-1-n-boc-aniline,4-n-boc-amino benzylamine,4-tert-butoxycarbonylamino benzylamine,4-aminomethyl-n-boc-aniline,tert-butyl-n-4-aminomethyl phenyl carbamate |
| IUPAC Name | tert-butyl N-[4-(aminomethyl)phenyl]carbamate |
| InChI Key | URXUHALBOWYXJZ-UHFFFAOYSA-N |
| Molecular Formula | C12H18N2O2 |
tert-Butyl N-(3-amino-3-thioxopropyl)carbamate, 97%, Thermo Scientific™
CAS: 77152-97-7 Molecular Formula: C8H16N2O2S Molecular Weight (g/mol): 204.288 MDL Number: MFCD02180883 InChI Key: OBDMXQCRRWGEQM-UHFFFAOYSA-N Synonym: tert-butyl n-3-amino-3-thioxopropyl carbamate,tert-butyl 3-amino-3-thioxopropylcarbamate,tert-butyl n-2-carbamothioylethyl carbamate,tert-butyl 3-amino-3-thioxopropyl carbamate,3-tert-butoxycarbonyl amino propanethioamide,tert-butyl 3-amino-3-thioxoprop-1-yl carbamate,2-thiocarbamoylethyl carbamic acid tert-butyl ester,carbamic acid,n-3-amino-3-thioxopropyl-, 1,1-dimethylethyl ester,tert-butyl 2-thiocarbamoylethylcarbamate,3-tert-butoxycarbonylamino propanethioamide PubChem CID: 2735653 IUPAC Name: tert-butyl N-(3-amino-3-sulfanylidenepropyl)carbamate SMILES: CC(C)(C)OC(=O)NCCC(=S)N
| PubChem CID | 2735653 |
|---|---|
| CAS | 77152-97-7 |
| Molecular Weight (g/mol) | 204.288 |
| MDL Number | MFCD02180883 |
| SMILES | CC(C)(C)OC(=O)NCCC(=S)N |
| Synonym | tert-butyl n-3-amino-3-thioxopropyl carbamate,tert-butyl 3-amino-3-thioxopropylcarbamate,tert-butyl n-2-carbamothioylethyl carbamate,tert-butyl 3-amino-3-thioxopropyl carbamate,3-tert-butoxycarbonyl amino propanethioamide,tert-butyl 3-amino-3-thioxoprop-1-yl carbamate,2-thiocarbamoylethyl carbamic acid tert-butyl ester,carbamic acid,n-3-amino-3-thioxopropyl-, 1,1-dimethylethyl ester,tert-butyl 2-thiocarbamoylethylcarbamate,3-tert-butoxycarbonylamino propanethioamide |
| IUPAC Name | tert-butyl N-(3-amino-3-sulfanylidenepropyl)carbamate |
| InChI Key | OBDMXQCRRWGEQM-UHFFFAOYSA-N |
| Molecular Formula | C8H16N2O2S |
tert-Butyl N-[(5-bromo-2-thienyl)methyl]carbamate, 97%, Thermo Scientific™
CAS: 215183-27-0 Molecular Formula: C10H14BrNO2S Molecular Weight (g/mol): 292.191 MDL Number: MFCD03659715 InChI Key: CVNITIPQHIGCKI-UHFFFAOYSA-N Synonym: tert-butyl 5-bromothiophen-2-yl methyl carbamate,tert-butyl n-5-bromo-2-thienyl methyl carbamate,5-bromo-thiophen-2-ylmethyl-carbamic acid tert-butyl ester,tert-butyl 5-bromothiophen-2-yl methylcarbamate,tert-butyl n-5-bromothiophen-2-yl methyl carbamate,n-boc-5-bromothiophen-2-methanamine,2-boc-amino methyl-5-bromothiophene,2-bromo-5-tert-butoxycarbonylaminomethylthiophene PubChem CID: 2779810 IUPAC Name: tert-butyl N-[(5-bromothiophen-2-yl)methyl]carbamate SMILES: CC(C)(C)OC(=O)NCC1=CC=C(S1)Br
| PubChem CID | 2779810 |
|---|---|
| CAS | 215183-27-0 |
| Molecular Weight (g/mol) | 292.191 |
| MDL Number | MFCD03659715 |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=C(S1)Br |
| Synonym | tert-butyl 5-bromothiophen-2-yl methyl carbamate,tert-butyl n-5-bromo-2-thienyl methyl carbamate,5-bromo-thiophen-2-ylmethyl-carbamic acid tert-butyl ester,tert-butyl 5-bromothiophen-2-yl methylcarbamate,tert-butyl n-5-bromothiophen-2-yl methyl carbamate,n-boc-5-bromothiophen-2-methanamine,2-boc-amino methyl-5-bromothiophene,2-bromo-5-tert-butoxycarbonylaminomethylthiophene |
| IUPAC Name | tert-butyl N-[(5-bromothiophen-2-yl)methyl]carbamate |
| InChI Key | CVNITIPQHIGCKI-UHFFFAOYSA-N |
| Molecular Formula | C10H14BrNO2S |
tert-Butyl N-[(1-benzyl-4-piperidinyl)methyl]carbamate, ≥95%, Thermo Scientific™
CAS: 173340-23-3 Molecular Formula: C18H28N2O2 Molecular Weight (g/mol): 304.434 MDL Number: MFCD04123925 InChI Key: SOXSDIKJHXTJEP-UHFFFAOYSA-N Synonym: tert-butyl 1-benzylpiperidin-4-yl methyl carbamate,tert-butyl 1-benzylpiperidin-4-yl methylcarbamate,tert-butyl n-1-benzyl-4-piperidinyl methyl carbamate,tert-butyl n-1-benzylpiperidin-4-yl methyl carbamate,maybridge3_004457,1-benzyl-4-tertbutyloxycarbonylaminomethylpiperidine,1-benzyl-4-piperidinylmethyl carbamic acid tert-butyl ester,1-benzylpiperidin-4-yl methylcarbamic acid tert-butyl ester,carbamic acid,n-1-phenylmethyl-4-piperidinyl methyl-, 1,1-dimethylethyl ester PubChem CID: 2824066 IUPAC Name: tert-butyl N-[(1-benzylpiperidin-4-yl)methyl]carbamate SMILES: CC(C)(C)OC(=O)NCC1CCN(CC1)CC2=CC=CC=C2
| PubChem CID | 2824066 |
|---|---|
| CAS | 173340-23-3 |
| Molecular Weight (g/mol) | 304.434 |
| MDL Number | MFCD04123925 |
| SMILES | CC(C)(C)OC(=O)NCC1CCN(CC1)CC2=CC=CC=C2 |
| Synonym | tert-butyl 1-benzylpiperidin-4-yl methyl carbamate,tert-butyl 1-benzylpiperidin-4-yl methylcarbamate,tert-butyl n-1-benzyl-4-piperidinyl methyl carbamate,tert-butyl n-1-benzylpiperidin-4-yl methyl carbamate,maybridge3_004457,1-benzyl-4-tertbutyloxycarbonylaminomethylpiperidine,1-benzyl-4-piperidinylmethyl carbamic acid tert-butyl ester,1-benzylpiperidin-4-yl methylcarbamic acid tert-butyl ester,carbamic acid,n-1-phenylmethyl-4-piperidinyl methyl-, 1,1-dimethylethyl ester |
| IUPAC Name | tert-butyl N-[(1-benzylpiperidin-4-yl)methyl]carbamate |
| InChI Key | SOXSDIKJHXTJEP-UHFFFAOYSA-N |
| Molecular Formula | C18H28N2O2 |
tert-Butyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate, 97+%, Thermo Scientific Chemicals
CAS: 330793-01-6 Molecular Formula: C17H26BNO4 Molecular Weight (g/mol): 319.21 MDL Number: MFCD02179439 InChI Key: HSJNIOYPTSKQBD-UHFFFAOYSA-N Synonym: 4-n-boc-amino phenylboronic acid pinacol ester,tert-butyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl carbamate,4-boc-amino benzeneboronic acid pinacol ester,tert-butyl n-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl carbamate,4-boc-amino phenylboronic acid pinacol cyclic ester,4-boc-aminophenylboronic acid, pinacol ester,4-tert-butoxycarbonyl aminophenylboronic acid, pinacol ester,tert-butyl n-4-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl carbamate,tert-butyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenylcarbamate PubChem CID: 2734617 IUPAC Name: tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate SMILES: CC(C)(C)OC(=O)NC1=CC=C(C=C1)B1OC(C)(C)C(C)(C)O1
| PubChem CID | 2734617 |
|---|---|
| CAS | 330793-01-6 |
| Molecular Weight (g/mol) | 319.21 |
| MDL Number | MFCD02179439 |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)B1OC(C)(C)C(C)(C)O1 |
| Synonym | 4-n-boc-amino phenylboronic acid pinacol ester,tert-butyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl carbamate,4-boc-amino benzeneboronic acid pinacol ester,tert-butyl n-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl carbamate,4-boc-amino phenylboronic acid pinacol cyclic ester,4-boc-aminophenylboronic acid, pinacol ester,4-tert-butoxycarbonyl aminophenylboronic acid, pinacol ester,tert-butyl n-4-tetramethyl-1,3,2-dioxaborolan-2-yl phenyl carbamate,tert-butyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl phenylcarbamate |
| IUPAC Name | tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChI Key | HSJNIOYPTSKQBD-UHFFFAOYSA-N |
| Molecular Formula | C17H26BNO4 |
Ethyl-d5 Carbamate, CDN
Discover 4000+ high-quality deuterated compounds, shipping directly from stock for speed. We offer many unique API’s, including active pharmaceutical ingredients, nitrosoamines, amino acids, steroids, gases, pesticides, and fatty acids.
| Percent Purity | 99 atom % D, min 98% Chemical Purity |
|---|---|
| CAS | 73962-07-9 |
| Molecular Weight (g/mol) | 94.12 |
| InChI Formula | InChI=1 S/C3H7NO2/c1-2-6-3(4)5/h2H2,1H3,(H2,4,5)/i1D3,2D2 |
| Chemical Name or Material | Urethane-d5 |
| SMILES | [2 H]C([2 H])([2 H])C([2 H])([2 H])OC(=O)N |
| Recommended Storage | Room Temperature |
| IUPAC Name | 1,1,2,2,2-pentadeuterioethyl carbamate |
| Molecular Formula | C3 2H5 H2 N O2 |
| Formula Weight | 94.0791 g/mol |
Phenyl N-iso-Propyl-d7-carbamate, CDN
Discover 4000+ high-quality deuterated compounds, shipping directly from stock for speed. We offer many unique API’s, including active pharmaceutical ingredients, nitrosoamines, amino acids, steroids, gases, pesticides, and fatty acids.
| Percent Purity | 99 atom % D, min 98% Chemical Purity |
|---|---|
| CAS | 1329835-22-4 |
| Molecular Weight (g/mol) | 186.259 |
| InChI Formula | InChI=1 S/C10H13NO2/c1-8(2)11-10(12)13-9-6-4-3-5-7-9/h3-8 H,1-2H3,(H,11,12)/i1D3,2D3,8 D |
| Chemical Name or Material | (1-Methylethyl)carbamic Acid-d7 Phenyl Ester |
| SMILES | [2 H]C([2 H])([2 H])C([2 H])(NC(=O)Oc1ccccc1)C([2 H])([2 H])[2 H] |
| Synonym | Phenyl N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)carbamate,Isopropyl-d7-carbamic acid phenyl ester,Phenyl N-[1-(methyl-d3)ethyl-1,2,2,2-d4]carbamate,Phenyl N-(isopropyl-d7)carbamate,[1-(Methyl-d3)ethyl-1,2,2,2-d4]carbamic acid phenyl ester,Phenyl isopropylcarbamate-D7 (isopropyl-D7) |
| Recommended Storage | Room Temperature |
| IUPAC Name | phenyl N-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)carbamate |
| Molecular Formula | C10 D7 H6 N O2 |
| Formula Weight | 186.139 g/mol |