Staining Reagents
Filtered Search Results
| Concentration or Composition (by Analyte or Components) | 3, 7-Bis(dimethylamino)phenothiazin-5-ium chloride hydrate: 1.0%; Water: 99% |
|---|---|
| CAS | 7732-18-5 |
| MDL Number | MFCD00012111 |
| Physical Form | Liquid |
| Solubility Information | Miscible with ethanol,chloroform,glacial acetic acid and glycerol. Slightly miscible with pyridine. Immiscible with ethyl ether,xylene,oleic acid,ethanol and acetone. |
| Chemical Name or Material | Methylene Blue |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Molecular Formula | C16H18ClN3S |
| Formula Weight | 319.86 |
| Vapor Pressure | 23 hPa (17mm Hg) at 20°C |
| Assay Percent Range | 1% w/v aqueous solution |
Thermo Scientific™ Gram Stain Kit
Differentiate gram-positive organisms from gram-negative organisms using Gram Stain Kit.
Thermo Scientific Chemicals Methylene Blue, pure, certified, residual water
CAS: 7220-79-3 Molecular Formula: C16H24ClN3O3S Molecular Weight (g/mol): 373.90 MDL Number: MFCD00150008 InChI Key: XQAXGZLFSSPBMK-UHFFFAOYSA-M Synonym: Basic Blue 9 PubChem CID: 6099 ChEBI: CHEBI:6872 IUPAC Name: [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride SMILES: O.O.O.[Cl-].CN(C)C1=CC2=[S+]C3=CC(=CC=C3N=C2C=C1)N(C)C
| PubChem CID | 6099 |
|---|---|
| CAS | 7220-79-3 |
| Molecular Weight (g/mol) | 373.90 |
| ChEBI | CHEBI:6872 |
| MDL Number | MFCD00150008 |
| SMILES | O.O.O.[Cl-].CN(C)C1=CC2=[S+]C3=CC(=CC=C3N=C2C=C1)N(C)C |
| Synonym | Basic Blue 9 |
| IUPAC Name | [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride |
| InChI Key | XQAXGZLFSSPBMK-UHFFFAOYSA-M |
| Molecular Formula | C16H24ClN3O3S |
Thermo Scientific Chemicals Congo Red, indicator grade
CAS: 573-58-0 Molecular Formula: C32H22N6Na2O6S2 Molecular Weight (g/mol): 696.664 MDL Number: MFCD00004028 InChI Key: IQFVPQOLBLOTPF-UHFFFAOYSA-L Synonym: C.I. 22120 PubChem CID: 11313 ChEBI: CHEBI:34653 IUPAC Name: disodium;4-amino-3-[[4-[4-[(1-amino-4-sulfonatonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonate SMILES: C1=CC=C2C(=C1)C(=CC(=C2N)N=NC3=CC=C(C=C3)C4=CC=C(C=C4)N=NC5=C(C6=CC=CC=C6C(=C5)S(=O)(=O)[O-])N)S(=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 11313 |
|---|---|
| CAS | 573-58-0 |
| Molecular Weight (g/mol) | 696.664 |
| ChEBI | CHEBI:34653 |
| MDL Number | MFCD00004028 |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2N)N=NC3=CC=C(C=C3)C4=CC=C(C=C4)N=NC5=C(C6=CC=CC=C6C(=C5)S(=O)(=O)[O-])N)S(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | C.I. 22120 |
| IUPAC Name | disodium;4-amino-3-[[4-[4-[(1-amino-4-sulfonatonaphthalen-2-yl)diazenyl]phenyl]phenyl]diazenyl]naphthalene-1-sulfonate |
| InChI Key | IQFVPQOLBLOTPF-UHFFFAOYSA-L |
| Molecular Formula | C32H22N6Na2O6S2 |
Thermo Scientific Chemicals Methylene Blue hydrate, 96+%, high purity biological stain
CAS: 122965-43-9 Molecular Formula: C16H18ClN3S Molecular Weight (g/mol): 319.85 MDL Number: MFCD00150006 InChI Key: CXKWCBBOMKCUKX-UHFFFAOYSA-M Synonym: Basic Blue 9 hydrate,C.I. 52015 hydrate PubChem CID: 16211647 IUPAC Name: [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;hydrate SMILES: [Cl-].CN(C)C1=CC=C2N=C3C=CC(C=C3SC2=C1)=[N+](C)C
| PubChem CID | 16211647 |
|---|---|
| CAS | 122965-43-9 |
| Molecular Weight (g/mol) | 319.85 |
| MDL Number | MFCD00150006 |
| SMILES | [Cl-].CN(C)C1=CC=C2N=C3C=CC(C=C3SC2=C1)=[N+](C)C |
| Synonym | Basic Blue 9 hydrate,C.I. 52015 hydrate |
| IUPAC Name | [7-(dimethylamino)phenothiazin-3-ylidene]-dimethylazanium;chloride;hydrate |
| InChI Key | CXKWCBBOMKCUKX-UHFFFAOYSA-M |
| Molecular Formula | C16H18ClN3S |
Thermo Scientific Chemicals Safranin O, 85%, pure, certified
CAS: 477-73-6 Molecular Formula: C20H19ClN4 Molecular Weight (g/mol): 350.85 MDL Number: MFCD00011759 InChI Key: QRYAEWIQIBAZOJ-UHFFFAOYSA-N Synonym: Basic Red 2,C.I. 50240,3, 7-Diamino-2, 8-dimethyl-5-phenylphenazinium chloride PubChem CID: 2723800 IUPAC Name: 3,7-dimethyl-10-phenylphenazin-10-ium-2,8-diamine;chloride SMILES: [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1
| PubChem CID | 2723800 |
|---|---|
| CAS | 477-73-6 |
| Molecular Weight (g/mol) | 350.85 |
| MDL Number | MFCD00011759 |
| SMILES | [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1 |
| Synonym | Basic Red 2,C.I. 50240,3, 7-Diamino-2, 8-dimethyl-5-phenylphenazinium chloride |
| IUPAC Name | 3,7-dimethyl-10-phenylphenazin-10-ium-2,8-diamine;chloride |
| InChI Key | QRYAEWIQIBAZOJ-UHFFFAOYSA-N |
| Molecular Formula | C20H19ClN4 |
Crystal Violet, Fisher Chemical™
SureTRACE
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
Supports traceability with guaranteed access to certificates and proactive change notifications.
Learn More
Ninhydrin Monohydrate, Extra Pure, Fisher Chemical™
CAS: 485-47-2 Molecular Formula: C9H6O4 Molecular Weight (g/mol): 178.143 MDL Number: 3791 InChI Key: FEMOMIGRRWSMCU-UHFFFAOYSA-N PubChem CID: 10236 ChEBI: CHEBI:86374 IUPAC Name: 2,2-dihydroxyindene-1,3-dione SMILES: C1=CC=C2C(=C1)C(=O)C(C2=O)(O)O
| PubChem CID | 10236 |
|---|---|
| CAS | 485-47-2 |
| Molecular Weight (g/mol) | 178.143 |
| ChEBI | CHEBI:86374 |
| MDL Number | 3791 |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2=O)(O)O |
| IUPAC Name | 2,2-dihydroxyindene-1,3-dione |
| InChI Key | FEMOMIGRRWSMCU-UHFFFAOYSA-N |
| Molecular Formula | C9H6O4 |
Thermo Scientific Chemicals Methyl blue
CAS: 28983-56-4 Molecular Formula: C37H26N3Na2O9S3 Molecular Weight (g/mol): 798.79 MDL Number: MFCD00058509 InChI Key: TUHAIJABPUJAEY-UHFFFAOYSA-K Synonym: Acid blue 93; C.I. 42780 PubChem CID: 76956083 SMILES: [Na+].[Na+].[O-]S(=O)(=O)C1=CC=CC=C1NC1=CC=C(C=C1)C(C1=CC=C(NC2=CC=CC=C2S([O-])(=O)=O)C=C1)=C1C=CC(C=C1)=NC1=CC=CC=C1S([O-])(=O)=O
| PubChem CID | 76956083 |
|---|---|
| CAS | 28983-56-4 |
| Molecular Weight (g/mol) | 798.79 |
| MDL Number | MFCD00058509 |
| SMILES | [Na+].[Na+].[O-]S(=O)(=O)C1=CC=CC=C1NC1=CC=C(C=C1)C(C1=CC=C(NC2=CC=CC=C2S([O-])(=O)=O)C=C1)=C1C=CC(C=C1)=NC1=CC=CC=C1S([O-])(=O)=O |
| Synonym | Acid blue 93; C.I. 42780 |
| InChI Key | TUHAIJABPUJAEY-UHFFFAOYSA-K |
| Molecular Formula | C37H26N3Na2O9S3 |
| CAS | 1393-92-6 |
|---|---|
| MDL Number | MFCD00131528 |
Thioflavin T
CAS: 2390-54-7 Molecular Formula: C17H19ClN2S Molecular Weight (g/mol): 318.86 MDL Number: MFCD00011944 InChI Key: JADVWWSKYZXRGX-UHFFFAOYSA-M Synonym: Basic Yellow 1,C.I. 49005 PubChem CID: 16953 ChEBI: CHEBI:76023 IUPAC Name: 2-[4-(dimethylamino)phenyl]-3,6-dimethyl-1,3-benzothiazol-3-ium chloride SMILES: [Cl-].CN(C)C1=CC=C(C=C1)C1=[N+](C)C2=CC=C(C)C=C2S1
| PubChem CID | 16953 |
|---|---|
| CAS | 2390-54-7 |
| Molecular Weight (g/mol) | 318.86 |
| ChEBI | CHEBI:76023 |
| MDL Number | MFCD00011944 |
| SMILES | [Cl-].CN(C)C1=CC=C(C=C1)C1=[N+](C)C2=CC=C(C)C=C2S1 |
| Synonym | Basic Yellow 1,C.I. 49005 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-3,6-dimethyl-1,3-benzothiazol-3-ium chloride |
| InChI Key | JADVWWSKYZXRGX-UHFFFAOYSA-M |
| Molecular Formula | C17H19ClN2S |
Thermo Scientific Chemicals Hydroxy Naphthol Blue, disodium salt, ACS reagent
CAS: 165660-27-5 Molecular Formula: C20H12N2Na2O11S3 Molecular Weight (g/mol): 600.495 MDL Number: MFCD00004075 InChI Key: LXJHFXHZWYBBKJ-LUUCHEBKSA-N Synonym: 2,2'-Dihydroxy-1,1'-azonaphthalene-3',4,6'-trisulfonic acid disodium salt PubChem CID: 131849366 IUPAC Name: 3-hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1-ylidene)hydrazinyl]naphthalene-2,7-disulfonic acid;sodium SMILES: C1=CC=C2C(=C1)C(=CC(=O)C2=NNC3=C4C=CC(=CC4=CC(=C3O)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O.[Na].[Na]
| PubChem CID | 131849366 |
|---|---|
| CAS | 165660-27-5 |
| Molecular Weight (g/mol) | 600.495 |
| MDL Number | MFCD00004075 |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)C2=NNC3=C4C=CC(=CC4=CC(=C3O)S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O.[Na].[Na] |
| Synonym | 2,2'-Dihydroxy-1,1'-azonaphthalene-3',4,6'-trisulfonic acid disodium salt |
| IUPAC Name | 3-hydroxy-4-[(2Z)-2-(2-oxo-4-sulfonaphthalen-1-ylidene)hydrazinyl]naphthalene-2,7-disulfonic acid;sodium |
| InChI Key | LXJHFXHZWYBBKJ-LUUCHEBKSA-N |
| Molecular Formula | C20H12N2Na2O11S3 |
Thermo Scientific Chemicals Sudan III
CAS: 85-86-9 Molecular Formula: C22H16N4O Molecular Weight (g/mol): 352.397 MDL Number: MFCD00003905 InChI Key: HTPQPMPFXUWUOT-UHFFFAOYSA-N Synonym: C.I. 26100; Solvent Red 23 PubChem CID: 6789251 IUPAC Name: 1-[(4-phenyldiazenylphenyl)hydrazinylidene]naphthalen-2-one SMILES: C1=CC=C(C=C1)N=NC2=CC=C(C=C2)NN=C3C(=O)C=CC4=CC=CC=C43
| PubChem CID | 6789251 |
|---|---|
| CAS | 85-86-9 |
| Molecular Weight (g/mol) | 352.397 |
| MDL Number | MFCD00003905 |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)NN=C3C(=O)C=CC4=CC=CC=C43 |
| Synonym | C.I. 26100; Solvent Red 23 |
| IUPAC Name | 1-[(4-phenyldiazenylphenyl)hydrazinylidene]naphthalen-2-one |
| InChI Key | HTPQPMPFXUWUOT-UHFFFAOYSA-N |
| Molecular Formula | C22H16N4O |