Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Choline Chloride, 99%
CAS: 67-48-1 Molecular Formula: C5H14ClNO Molecular Weight (g/mol): 139.62 MDL Number: MFCD00011721 InChI Key: SGMZJAMFUVOLNK-UHFFFAOYSA-M Synonym: choline chloride,hepacholine,biocolina,biocoline,lipotril,paresan,luridin chloride,choline hydrochloride,cholinium chloride,bilineurin chloride PubChem CID: 6209 ChEBI: CHEBI:133341 IUPAC Name: 2-hydroxyethyl(trimethyl)azanium;chloride SMILES: [Cl-].C[N+](C)(C)CCO
| PubChem CID | 6209 |
|---|---|
| CAS | 67-48-1 |
| Molecular Weight (g/mol) | 139.62 |
| ChEBI | CHEBI:133341 |
| MDL Number | MFCD00011721 |
| SMILES | [Cl-].C[N+](C)(C)CCO |
| Synonym | choline chloride,hepacholine,biocolina,biocoline,lipotril,paresan,luridin chloride,choline hydrochloride,cholinium chloride,bilineurin chloride |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;chloride |
| InChI Key | SGMZJAMFUVOLNK-UHFFFAOYSA-M |
| Molecular Formula | C5H14ClNO |
Benzophenone, 99%, pure
CAS: 119-61-9 Molecular Formula: C13H10O Molecular Weight (g/mol): 182.22 InChI Key: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC Name: diphenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| PubChem CID | 3102 |
|---|---|
| CAS | 119-61-9 |
| Molecular Weight (g/mol) | 182.22 |
| ChEBI | CHEBI:41308 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| IUPAC Name | diphenylmethanone |
| InChI Key | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| Molecular Formula | C13H10O |
Diethylenetriaminepentaacetic acid, 98+%
CAS: 67-43-6 Molecular Formula: C14H23N3O10 Molecular Weight (g/mol): 393.34 InChI Key: QPCDCPDFJACHGM-UHFFFAOYSA-N Synonym: pentetic acid,diethylenetriaminepentaacetic acid,dtpa,detapac,complexon v,detarex,perma kleer,titriplex v,monaquest cai,hamp-ex acid PubChem CID: 3053 ChEBI: CHEBI:35739 IUPAC Name: 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid SMILES: C(CN(CC(=O)O)CC(=O)O)N(CCN(CC(=O)O)CC(=O)O)CC(=O)O
| PubChem CID | 3053 |
|---|---|
| CAS | 67-43-6 |
| Molecular Weight (g/mol) | 393.34 |
| ChEBI | CHEBI:35739 |
| SMILES | C(CN(CC(=O)O)CC(=O)O)N(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| Synonym | pentetic acid,diethylenetriaminepentaacetic acid,dtpa,detapac,complexon v,detarex,perma kleer,titriplex v,monaquest cai,hamp-ex acid |
| IUPAC Name | 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid |
| InChI Key | QPCDCPDFJACHGM-UHFFFAOYSA-N |
| Molecular Formula | C14H23N3O10 |
Thermo Scientific Chemicals D(+)-Xylose, 99+%
CAS: 58-86-6 Molecular Formula: C5H10O5 Molecular Weight (g/mol): 150.13
| CAS | 58-86-6 |
|---|---|
| Molecular Weight (g/mol) | 150.13 |
| Molecular Formula | C5H10O5 |
1-Heptanesulfonic Acid, Sodium Salt, 98%
CAS: 22767-50-6 InChI Key: REFMEZARFCPESH-UHFFFAOYSA-M Synonym: sodium 1-heptanesulfonate,sodium heptane-1-sulfonate,1-heptanesulfonic acid sodium salt,1-heptanesulfonic acid, sodium salt,sodium heptane-1-sulphonate,1-heptanesulfonic acid, sodium salt 1:1,1-heptanesulfonic acid sodium,sodium heptanesulfonate,1-heptylsodiumsulfonate,sodium heptane sulfonate PubChem CID: 23672332 IUPAC Name: sodium;heptane-1-sulfonate SMILES: CCCCCCCS(=O)(=O)[O-].[Na+]
| PubChem CID | 23672332 |
|---|---|
| CAS | 22767-50-6 |
| SMILES | CCCCCCCS(=O)(=O)[O-].[Na+] |
| Synonym | sodium 1-heptanesulfonate,sodium heptane-1-sulfonate,1-heptanesulfonic acid sodium salt,1-heptanesulfonic acid, sodium salt,sodium heptane-1-sulphonate,1-heptanesulfonic acid, sodium salt 1:1,1-heptanesulfonic acid sodium,sodium heptanesulfonate,1-heptylsodiumsulfonate,sodium heptane sulfonate |
| IUPAC Name | sodium;heptane-1-sulfonate |
| InChI Key | REFMEZARFCPESH-UHFFFAOYSA-M |
Diethanolamine, 99%
CAS: 111-42-2 Molecular Formula: C4H11NO2 Molecular Weight (g/mol): 105.14 MDL Number: MFCD00002843 InChI Key: ZBCBWPMODOFKDW-UHFFFAOYSA-N Synonym: diethanolamine,2,2'-iminodiethanol,diolamine,iminodiethanol,bis 2-hydroxyethyl amine,diethylolamine,n,n-diethanolamine,diethanolamin,2,2'-dihydroxydiethylamine,ethanol, 2,2'-iminobis PubChem CID: 8113 ChEBI: CHEBI:28123 IUPAC Name: 2-(2-hydroxyethylamino)ethanol SMILES: OCCNCCO
| PubChem CID | 8113 |
|---|---|
| CAS | 111-42-2 |
| Molecular Weight (g/mol) | 105.14 |
| ChEBI | CHEBI:28123 |
| MDL Number | MFCD00002843 |
| SMILES | OCCNCCO |
| Synonym | diethanolamine,2,2'-iminodiethanol,diolamine,iminodiethanol,bis 2-hydroxyethyl amine,diethylolamine,n,n-diethanolamine,diethanolamin,2,2'-dihydroxydiethylamine,ethanol, 2,2'-iminobis |
| IUPAC Name | 2-(2-hydroxyethylamino)ethanol |
| InChI Key | ZBCBWPMODOFKDW-UHFFFAOYSA-N |
| Molecular Formula | C4H11NO2 |
Thermo Scientific Chemicals 1-Nitroso-2-naphthol-3,6-disulfonic acid, disodium salt hydrate, pure, indicator grade
CAS: 525-05-3 Molecular Formula: C10H5NNa2O8S2 Molecular Weight (g/mol): 377.25 MDL Number: MFCD00149246 InChI Key: DMKMTGULLYISBH-UHFFFAOYSA-L Synonym: nitroso-r salt,nitroso r,sodium 3-hydroxy-4-nitrosonaphthalene-2,7-disulfonate,disodium 1-nitroso-2-naphthol-3,6-disulfonate,nitroso r salt,1-nitroso-3,6-disulfonate,2,7-naphthalenedisulfonic acid, 3-hydroxy-4-nitroso-, disodium salt,3-hydroxy-4-nitroso-2,7-naphthalenedisulfonic acid disodium salt,1-nitroso-2-naphthol-3,6-disulfonic acid disodium salt,disodium 3-hydroxy-4-nitrosonaphthalene-2,7-disulphonate PubChem CID: 10672 IUPAC Name: disodium;3-hydroxy-4-nitrosonaphthalene-2,7-disulfonate SMILES: [Na+].[Na+].OC1=C(N=O)C2=CC=C(C=C2C=C1S([O-])(=O)=O)S([O-])(=O)=O
| PubChem CID | 10672 |
|---|---|
| CAS | 525-05-3 |
| Molecular Weight (g/mol) | 377.25 |
| MDL Number | MFCD00149246 |
| SMILES | [Na+].[Na+].OC1=C(N=O)C2=CC=C(C=C2C=C1S([O-])(=O)=O)S([O-])(=O)=O |
| Synonym | nitroso-r salt,nitroso r,sodium 3-hydroxy-4-nitrosonaphthalene-2,7-disulfonate,disodium 1-nitroso-2-naphthol-3,6-disulfonate,nitroso r salt,1-nitroso-3,6-disulfonate,2,7-naphthalenedisulfonic acid, 3-hydroxy-4-nitroso-, disodium salt,3-hydroxy-4-nitroso-2,7-naphthalenedisulfonic acid disodium salt,1-nitroso-2-naphthol-3,6-disulfonic acid disodium salt,disodium 3-hydroxy-4-nitrosonaphthalene-2,7-disulphonate |
| IUPAC Name | disodium;3-hydroxy-4-nitrosonaphthalene-2,7-disulfonate |
| InChI Key | DMKMTGULLYISBH-UHFFFAOYSA-L |
| Molecular Formula | C10H5NNa2O8S2 |
D(+)-Glucose monohydrate, 99+%, extra pure
CAS: 14431-43-7 Molecular Formula: C6H12O6·H2O Molecular Weight (g/mol): 198.17
| CAS | 14431-43-7 |
|---|---|
| Molecular Weight (g/mol) | 198.17 |
| Molecular Formula | C6H12O6·H2O |
4-Nitrophenyl phosphate, disodium salt, hexahydrate, 98+%
CAS: 333338-18-4 Molecular Formula: C6H4NNa2O6P Molecular Weight (g/mol): 263.05 MDL Number: MFCD00007319 InChI Key: VIYFPAMJCJLZKD-UHFFFAOYSA-L Synonym: pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system PubChem CID: 77949 IUPAC Name: disodium;(4-nitrophenyl) phosphate SMILES: [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1
| PubChem CID | 77949 |
|---|---|
| CAS | 333338-18-4 |
| Molecular Weight (g/mol) | 263.05 |
| MDL Number | MFCD00007319 |
| SMILES | [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 |
| Synonym | pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system |
| IUPAC Name | disodium;(4-nitrophenyl) phosphate |
| InChI Key | VIYFPAMJCJLZKD-UHFFFAOYSA-L |
| Molecular Formula | C6H4NNa2O6P |
Thermo Scientific Chemicals Glyoxal, pure, 40 wt.% solution in water
CAS: 107-22-2 | C2H2O2 | 58.04 g/mol
| Viscosity | 8 mPa.s (20°C) |
|---|---|
| Linear Formula | HCOCHO |
| Molecular Weight (g/mol) | 58.04 |
| ChEBI | CHEBI:34779 |
| InChI Key | LEQAOMBKQFMDFZ-UHFFFAOYSA-N |
| Density | 1.2650g/mL |
| PubChem CID | 7860 |
| Name Note | 40 wt.% Solution in Water |
| Percent Purity | 39 to 41% (Titrimetry other) |
| Fieser | 01,413 |
| Formula Weight | 58.04 |
| Melting Point | -14.0°C |
| Boiling Point | 104.0°C |
| Color | Colorless to Yellow |
| Physical Form | Liquid |
| Chemical Name or Material | Glyoxal |
| Grade | Pure |
| SMILES | C(=O)C=O |
| Merck Index | 15, 4544 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. Call a POISON CENTER or doctor/physician if you feel unwell. IF ON SKIN: Wash with plenty of soap and water. If skin irritatio |
| MDL Number | MFCD00006957 |
| Health Hazard 2 | GHS H Statement Suspected of causing genetic defects if inhaled. Harmful if inhaled. Causes serious eye irritation. Causes skin irritation. May cause an allergic skin reaction. May cause respiratory irritation. |
| Solubility Information | Solubility in water: miscible. |
| Flash Point | >104°C |
| Health Hazard 1 | GHS Signal Word: Warning |
| Synonym | glyoxal,ethanedial,oxalaldehyde,1,2-ethanedione,glyoxylaldehyde,biformal,biformyl,diformal,diformyl,aerotex glyoxal 40 |
| Recommended Storage | May darken during storage |
| IUPAC Name | oxaldehyde |
| Beilstein | 01, 759 |
| Molecular Formula | C2H2O2 |
| EINECS Number | 203-474-9 |
| Specific Gravity | 1.265 |
Methylamine hydrochloride, 99%
CAS: 593-51-1 Molecular Formula: CH6ClN Molecular Weight (g/mol): 67.52 InChI Key: NQMRYBIKMRVZLB-UHFFFAOYSA-N IUPAC Name: methanaminium chloride SMILES: [Cl-].C[NH3+]
| CAS | 593-51-1 |
|---|---|
| Molecular Weight (g/mol) | 67.52 |
| SMILES | [Cl-].C[NH3+] |
| IUPAC Name | methanaminium chloride |
| InChI Key | NQMRYBIKMRVZLB-UHFFFAOYSA-N |
| Molecular Formula | CH6ClN |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, disodium salt dihydrate, 99+%, ACS reagent
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, disodium salt dihydrate, 99+%, for molecular biology, DNAse, RNAse and Protease free
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Thermo Scientific Chemicals D(+)-Raffinose pentahydrate, 99+%
CAS: 17629-30-0 Molecular Formula: C18H32O16·5H2O Molecular Weight (g/mol): 594.52 MDL Number: MFCD00071590 InChI Key: BITMAWRCWSHCRW-ORBWWOJFSA-N Synonym: d-+-raffinosepentahydrate PubChem CID: 134129414 IUPAC Name: (3S,4S,5R,6R)-2-[[(2R,3S,4S,5S)-6-[(2S,3S,4R,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol;pentahydrate SMILES: C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3(C(C(C(O3)CO)O)O)CO)O)O)O)O)O)O)O.O.O.O.O.O
| PubChem CID | 134129414 |
|---|---|
| CAS | 17629-30-0 |
| Molecular Weight (g/mol) | 594.52 |
| MDL Number | MFCD00071590 |
| SMILES | C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3(C(C(C(O3)CO)O)O)CO)O)O)O)O)O)O)O.O.O.O.O.O |
| Synonym | d-+-raffinosepentahydrate |
| IUPAC Name | (3S,4S,5R,6R)-2-[[(2R,3S,4S,5S)-6-[(2S,3S,4R,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol;pentahydrate |
| InChI Key | BITMAWRCWSHCRW-ORBWWOJFSA-N |
| Molecular Formula | C18H32O16·5H2O |
Poly(ethylene glycol), average M.W. 400
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |