Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Polyethylene Glycol 8000 (PEG), Fisher BioReagents™
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEG 8000,Polyethylene Oxide,Carbowax™ IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEG 8000,Polyethylene Oxide,Carbowax™ |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Sodium Citrate Dihydrate (Small, Colorless Granules), Fisher BioReagents™
CAS: 6132-04-3 Molecular Formula: C6H9Na3O9 Molecular Weight (g/mol): 294.10 InChI Key: NLJMYIDDQXHKNR-UHFFFAOYSA-K Synonym: trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate PubChem CID: 71474 ChEBI: CHEBI:32142 IUPAC Name: trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+]
| PubChem CID | 71474 |
|---|---|
| CAS | 6132-04-3 |
| Molecular Weight (g/mol) | 294.10 |
| ChEBI | CHEBI:32142 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+] |
| Synonym | trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate |
| IUPAC Name | trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate |
| InChI Key | NLJMYIDDQXHKNR-UHFFFAOYSA-K |
| Molecular Formula | C6H9Na3O9 |
Mitomycin C, Fisher BioReagents™
CAS: 50-07-7 Molecular Formula: C15H18N4O5 Molecular Weight (g/mol): 334.332 InChI Key: NWIBSHFKIJFRCO-WUDYKRTCSA-N Synonym: mitomycin c,mitomycin,ametycine,mutamycin,ametycin,mitocin-c,mitomycinum,mytomycin,mytozytrex,mitomycin-c PubChem CID: 5746 ChEBI: CHEBI:27504 SMILES: CC1=C(C(=O)C2=C(C1=O)N3CC4C(C3(C2COC(=O)N)OC)N4)N
| PubChem CID | 5746 |
|---|---|
| CAS | 50-07-7 |
| Molecular Weight (g/mol) | 334.332 |
| ChEBI | CHEBI:27504 |
| SMILES | CC1=C(C(=O)C2=C(C1=O)N3CC4C(C3(C2COC(=O)N)OC)N4)N |
| Synonym | mitomycin c,mitomycin,ametycine,mutamycin,ametycin,mitocin-c,mitomycinum,mytomycin,mytozytrex,mitomycin-c |
| InChI Key | NWIBSHFKIJFRCO-WUDYKRTCSA-N |
| Molecular Formula | C15H18N4O5 |
Guanidine Thiocyanate (White Crystalline Powder), Fisher BioReagents™
CAS: 593-84-0 Molecular Formula: C2H6N4S Synonym: Guanidinium Isothiocyanate
| CAS | 593-84-0 |
|---|---|
| Synonym | Guanidinium Isothiocyanate |
| Molecular Formula | C2H6N4S |
Ethylenediaminetetraacetic Acid, Di Na Salt Dihydr. (Crystalline Powd./Electrophor.), Fisher BioReagents™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Formaldehyde (37% by Weight/Molecular Biology), Fisher BioReagents
CAS: 50-00-0 Molecular Formula: CH2O Molecular Weight (g/mol): 30.03 MDL Number: MFCD00003274 InChI Key: WSFSSNUMVMOOMR-UHFFFAOYSA-N Synonym: formalin,methanal,formol,methylene oxide,paraformaldehyde,oxomethane,paraform,formic aldehyde,oxymethylene,methyl aldehyde PubChem CID: 712 ChEBI: CHEBI:16842 IUPAC Name: formaldehyde SMILES: C=O
| PubChem CID | 712 |
|---|---|
| CAS | 50-00-0 |
| Molecular Weight (g/mol) | 30.03 |
| ChEBI | CHEBI:16842 |
| MDL Number | MFCD00003274 |
| SMILES | C=O |
| Synonym | formalin,methanal,formol,methylene oxide,paraformaldehyde,oxomethane,paraform,formic aldehyde,oxymethylene,methyl aldehyde |
| IUPAC Name | formaldehyde |
| InChI Key | WSFSSNUMVMOOMR-UHFFFAOYSA-N |
| Molecular Formula | CH2O |
Dextran Sulfate Sodium Salt (White to Off-white Powder), Fisher BioReagents
CAS: 9011-18-1 Molecular Formula: (C6H7O5)m(C6H7O5)n Molecular Weight (g/mol): 500,000 MDL Number: MFCD00081551 InChI Key: BLFLLBZGZJTVJG-UHFFFAOYSA-N Synonym: benzocaine,ethyl aminobenzoate,ethyl p-aminobenzoate,americaine,anesthesin,anaesthesin,ethoform,norcaine,orthesin,parathesin PubChem CID: 2337 ChEBI: CHEBI:116735 IUPAC Name: ethyl 4-aminobenzoate SMILES: *-OC[C@H]1O[C@H](OC[C@H]2O[C@H](-*)[C@H](O[*])[C@@H](O[*])[C@@H]2O[*])[C@H](O[*])[C@@H](O-*)[C@@H]1O[*]
| PubChem CID | 2337 |
|---|---|
| CAS | 9011-18-1 |
| Molecular Weight (g/mol) | 500,000 |
| ChEBI | CHEBI:116735 |
| MDL Number | MFCD00081551 |
| SMILES | *-OC[C@H]1O[C@H](OC[C@H]2O[C@H](-*)[C@H](O[*])[C@@H](O[*])[C@@H]2O[*])[C@H](O[*])[C@@H](O-*)[C@@H]1O[*] |
| Synonym | benzocaine,ethyl aminobenzoate,ethyl p-aminobenzoate,americaine,anesthesin,anaesthesin,ethoform,norcaine,orthesin,parathesin |
| IUPAC Name | ethyl 4-aminobenzoate |
| InChI Key | BLFLLBZGZJTVJG-UHFFFAOYSA-N |
| Molecular Formula | (C6H7O5)m(C6H7O5)n |
Tetrabutylammonium hydrogen sulfate, 99%, for HPLC
CAS: 32503-27-8 Molecular Formula: C16H37NO4S Molecular Weight (g/mol): 339.54 MDL Number: MFCD00011637 InChI Key: SHFJWMWCIHQNCP-UHFFFAOYSA-M Synonym: tetrabutylammonium hydrogen sulfate,tetrabutylammonium hydrogensulfate,tetrabutylammonium bisulfate,tetra-n-butylammonium hydrogen sulfate,tbahs,tetrabutylammonium sulfate 1:1,1-butanaminium, n,n,n-tributyl-, sulfate 1:1,tetrabutylammonium hydrogen sulphate,tetrabutylazanium hydrogen sulfate,ipc-tba-hs PubChem CID: 94433 IUPAC Name: hydrogen sulfate;tetrabutylazanium SMILES: OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC
| PubChem CID | 94433 |
|---|---|
| CAS | 32503-27-8 |
| Molecular Weight (g/mol) | 339.54 |
| MDL Number | MFCD00011637 |
| SMILES | OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC |
| Synonym | tetrabutylammonium hydrogen sulfate,tetrabutylammonium hydrogensulfate,tetrabutylammonium bisulfate,tetra-n-butylammonium hydrogen sulfate,tbahs,tetrabutylammonium sulfate 1:1,1-butanaminium, n,n,n-tributyl-, sulfate 1:1,tetrabutylammonium hydrogen sulphate,tetrabutylazanium hydrogen sulfate,ipc-tba-hs |
| IUPAC Name | hydrogen sulfate;tetrabutylazanium |
| InChI Key | SHFJWMWCIHQNCP-UHFFFAOYSA-M |
| Molecular Formula | C16H37NO4S |
Staurosporine, Fisher BioReagents
CAS: 62996-74-1 Molecular Formula: C28H26N4O3 Molecular Weight (g/mol): 466.541 InChI Key: HKSZLNNOFSGOKW-ZYSRIHRCSA-N Synonym: staurosporine,kinome_3629 PubChem CID: 49831000 SMILES: CC12C(C(CC(O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)NC)OC
| PubChem CID | 49831000 |
|---|---|
| CAS | 62996-74-1 |
| Molecular Weight (g/mol) | 466.541 |
| SMILES | CC12C(C(CC(O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)NC)OC |
| Synonym | staurosporine,kinome_3629 |
| InChI Key | HKSZLNNOFSGOKW-ZYSRIHRCSA-N |
| Molecular Formula | C28H26N4O3 |
Ketoconazole, Fisher BioReagents
CAS: 65277-42-1 Molecular Formula: C26H28Cl2N4O4 Molecular Weight (g/mol): 534.452 InChI Key: XMAYWYJOQHXEEK-SIULDFEJSA-N Synonym: ketoconazole PubChem CID: 76973198 IUPAC Name: 2,2,2-trideuterio-1-[4-[4-[[(2R,4S)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone SMILES: CC(=O)N1CCN(CC1)C2=CC=C(C=C2)OCC3COC(O3)(CN4C=CN=C4)C5=C(C=C(C=C5)Cl)Cl
| PubChem CID | 76973198 |
|---|---|
| CAS | 65277-42-1 |
| Molecular Weight (g/mol) | 534.452 |
| SMILES | CC(=O)N1CCN(CC1)C2=CC=C(C=C2)OCC3COC(O3)(CN4C=CN=C4)C5=C(C=C(C=C5)Cl)Cl |
| Synonym | ketoconazole |
| IUPAC Name | 2,2,2-trideuterio-1-[4-[4-[[(2R,4S)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone |
| InChI Key | XMAYWYJOQHXEEK-SIULDFEJSA-N |
| Molecular Formula | C26H28Cl2N4O4 |
Methotrexate, Fisher BioReagents
CAS: 59-05-2 Molecular Formula: C20H22N8O5 Molecular Weight (g/mol): 454.447 InChI Key: FBOZXECLQNJBKD-ZDUSSCGKSA-N Synonym: methotrexate,abitrexate,rheumatrex,amethopterin,mexate,metatrexan,hdmtx,trexall,methylaminopterinum,antifolan PubChem CID: 126941 ChEBI: CHEBI:44185 IUPAC Name: (2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioic acid SMILES: CN(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)NC(CCC(=O)O)C(=O)O
| PubChem CID | 126941 |
|---|---|
| CAS | 59-05-2 |
| Molecular Weight (g/mol) | 454.447 |
| ChEBI | CHEBI:44185 |
| SMILES | CN(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)NC(CCC(=O)O)C(=O)O |
| Synonym | methotrexate,abitrexate,rheumatrex,amethopterin,mexate,metatrexan,hdmtx,trexall,methylaminopterinum,antifolan |
| IUPAC Name | (2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioic acid |
| InChI Key | FBOZXECLQNJBKD-ZDUSSCGKSA-N |
| Molecular Formula | C20H22N8O5 |
Doxorubicin Hydrochloride, Fisher BioReagents
CAS: 25316-40-9 Molecular Formula: C27H30ClNO11 Molecular Weight (g/mol): 579.98 MDL Number: MFCD00077757,MFCD00077757,MFCD00941448 InChI Key: MWWSFMDVAYGXBV-FGBJBKNOSA-N Synonym: doxorubicin hydrochloride,adriamycin,doxorubicin hcl,adriacin,adriblastina,rubex,adriamycin hydrochloride,adriblastin,adriamycin pfs PubChem CID: 129626538 IUPAC Name: (7R,9R)-7-[(2S,4R,5R,6R)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione;hydrochloride SMILES: [H+].[Cl-].COC1=CC=CC2=C1C(=O)C1=C(O)C3=C(C[C@](O)(C[C@@H]3OC3CC(N)C(O)C(C)O3)C(=O)CO)C(O)=C1C2=O
| PubChem CID | 129626538 |
|---|---|
| CAS | 25316-40-9 |
| Molecular Weight (g/mol) | 579.98 |
| MDL Number | MFCD00077757,MFCD00077757,MFCD00941448 |
| SMILES | [H+].[Cl-].COC1=CC=CC2=C1C(=O)C1=C(O)C3=C(C[C@](O)(C[C@@H]3OC3CC(N)C(O)C(C)O3)C(=O)CO)C(O)=C1C2=O |
| Synonym | doxorubicin hydrochloride,adriamycin,doxorubicin hcl,adriacin,adriblastina,rubex,adriamycin hydrochloride,adriblastin,adriamycin pfs |
| IUPAC Name | (7R,9R)-7-[(2S,4R,5R,6R)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione;hydrochloride |
| InChI Key | MWWSFMDVAYGXBV-FGBJBKNOSA-N |
| Molecular Formula | C27H30ClNO11 |
Spermidine Trihydrochloride, Fisher BioReagents
CAS: 334-50-9 Molecular Formula: C7H22Cl3N3 Molecular Weight (g/mol): 254.62 MDL Number: MFCD00012918 InChI Key: LCNBIHVSOPXFMR-UHFFFAOYSA-N Synonym: spermidine trihydrochloride,n-3-aminopropyl-1,4-butanediamine trihydrochloride,spermidine hydrochloride,n1-3-aminopropyl butane-1,4-diamine trihydrochloride,unii-1o14bed398,1,4-butanediamine, n-3-aminopropyl-, trihydrochloride,spermidine, trihydrochloride,1,4-butanediamine, n-3-aminopropyl , hydrochloride,n-3-aminopropyl butane-1,4-diamine trihydrochloride,4-azoniaoctamethylenediammonium trichloride PubChem CID: 9539 IUPAC Name: N'-(3-aminopropyl)butane-1,4-diamine;trihydrochloride SMILES: [H+].[H+].[H+].[Cl-].[Cl-].[Cl-].NCCCCNCCCN
| PubChem CID | 9539 |
|---|---|
| CAS | 334-50-9 |
| Molecular Weight (g/mol) | 254.62 |
| MDL Number | MFCD00012918 |
| SMILES | [H+].[H+].[H+].[Cl-].[Cl-].[Cl-].NCCCCNCCCN |
| Synonym | spermidine trihydrochloride,n-3-aminopropyl-1,4-butanediamine trihydrochloride,spermidine hydrochloride,n1-3-aminopropyl butane-1,4-diamine trihydrochloride,unii-1o14bed398,1,4-butanediamine, n-3-aminopropyl-, trihydrochloride,spermidine, trihydrochloride,1,4-butanediamine, n-3-aminopropyl , hydrochloride,n-3-aminopropyl butane-1,4-diamine trihydrochloride,4-azoniaoctamethylenediammonium trichloride |
| IUPAC Name | N'-(3-aminopropyl)butane-1,4-diamine;trihydrochloride |
| InChI Key | LCNBIHVSOPXFMR-UHFFFAOYSA-N |
| Molecular Formula | C7H22Cl3N3 |