Organooxygen compounds
Filtered Search Results
Thermo Scientific Chemicals Glyoxal, pure, 40 wt.% solution in water
CAS: 107-22-2 | C2H2O2 | 58.04 g/mol
| Viscosity | 8 mPa.s (20°C) |
|---|---|
| Linear Formula | HCOCHO |
| Molecular Weight (g/mol) | 58.04 |
| ChEBI | CHEBI:34779 |
| InChI Key | LEQAOMBKQFMDFZ-UHFFFAOYSA-N |
| Density | 1.2650g/mL |
| PubChem CID | 7860 |
| Name Note | 40 wt.% Solution in Water |
| Percent Purity | 39 to 41% (Titrimetry other) |
| Fieser | 01,413 |
| Formula Weight | 58.04 |
| Melting Point | -14.0°C |
| Boiling Point | 104.0°C |
| Color | Colorless to Yellow |
| Physical Form | Liquid |
| Chemical Name or Material | Glyoxal |
| Grade | Pure |
| SMILES | C(=O)C=O |
| Merck Index | 15, 4544 |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing. Call a POISON CENTER or doctor/physician if you feel unwell. IF ON SKIN: Wash with plenty of soap and water. If skin irritatio |
| MDL Number | MFCD00006957 |
| Health Hazard 2 | GHS H Statement Suspected of causing genetic defects if inhaled. Harmful if inhaled. Causes serious eye irritation. Causes skin irritation. May cause an allergic skin reaction. May cause respiratory irritation. |
| Solubility Information | Solubility in water: miscible. |
| Flash Point | >104°C |
| Health Hazard 1 | GHS Signal Word: Warning |
| Synonym | glyoxal,ethanedial,oxalaldehyde,1,2-ethanedione,glyoxylaldehyde,biformal,biformyl,diformal,diformyl,aerotex glyoxal 40 |
| Recommended Storage | May darken during storage |
| IUPAC Name | oxaldehyde |
| Beilstein | 01, 759 |
| Molecular Formula | C2H2O2 |
| EINECS Number | 203-474-9 |
| Specific Gravity | 1.265 |
18-Crown-6, 99%
CAS: 17455-13-9 Molecular Formula: C12H24O6 Molecular Weight (g/mol): 264.32 MDL Number: MFCD00005113 InChI Key: XEZNGIUYQVAUSS-UHFFFAOYSA-N Synonym: 18-crown-6,18-crown-6 ether,ethylene oxide cyclic hexamer,18-crown-6-ether,unii-63j177nc5b,ccris 3587,18-crown 6-ether,1,4,7,10,13,16-hexanoxacyclooctadecane,18-crown-6/1,4,7,10,13,16-hexaoxacyclooctadecane PubChem CID: 28557 ChEBI: CHEBI:32397 IUPAC Name: 1,4,7,10,13,16-hexaoxacyclooctadecane SMILES: C1COCCOCCOCCOCCOCCO1
| PubChem CID | 28557 |
|---|---|
| CAS | 17455-13-9 |
| Molecular Weight (g/mol) | 264.32 |
| ChEBI | CHEBI:32397 |
| MDL Number | MFCD00005113 |
| SMILES | C1COCCOCCOCCOCCOCCO1 |
| Synonym | 18-crown-6,18-crown-6 ether,ethylene oxide cyclic hexamer,18-crown-6-ether,unii-63j177nc5b,ccris 3587,18-crown 6-ether,1,4,7,10,13,16-hexanoxacyclooctadecane,18-crown-6/1,4,7,10,13,16-hexaoxacyclooctadecane |
| IUPAC Name | 1,4,7,10,13,16-hexaoxacyclooctadecane |
| InChI Key | XEZNGIUYQVAUSS-UHFFFAOYSA-N |
| Molecular Formula | C12H24O6 |
Benzil, 99+%
CAS: 134-81-6 Molecular Formula: C14H10O2 Molecular Weight (g/mol): 210.23 MDL Number: MFCD00003080 InChI Key: WURBFLDFSFBTLW-UHFFFAOYSA-N Synonym: benzil,diphenylethanedione,dibenzoyl,diphenylglyoxal,bibenzoyl,ethanedione, diphenyl,1,2-diphenylethanedione,diphenylethane-1,2-dione,glyoxal, diphenyl,diphenyldiketon PubChem CID: 8651 ChEBI: CHEBI:51507 IUPAC Name: 1,2-diphenylethane-1,2-dione SMILES: O=C(C(=O)C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 8651 |
|---|---|
| CAS | 134-81-6 |
| Molecular Weight (g/mol) | 210.23 |
| ChEBI | CHEBI:51507 |
| MDL Number | MFCD00003080 |
| SMILES | O=C(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | benzil,diphenylethanedione,dibenzoyl,diphenylglyoxal,bibenzoyl,ethanedione, diphenyl,1,2-diphenylethanedione,diphenylethane-1,2-dione,glyoxal, diphenyl,diphenyldiketon |
| IUPAC Name | 1,2-diphenylethane-1,2-dione |
| InChI Key | WURBFLDFSFBTLW-UHFFFAOYSA-N |
| Molecular Formula | C14H10O2 |
Acetophenone, 98%, pure
CAS: 98-86-2 MDL Number: MFCD00008724 InChI Key: KWOLFJPFCHCOCG-UHFFFAOYSA-N Synonym: acetophenone,methyl phenyl ketone,acetylbenzene,phenyl methyl ketone,ethanone, 1-phenyl,hypnone,benzoyl methide,acetophenon,1-phenylethan-1-one,acetylbenzol PubChem CID: 7410 ChEBI: CHEBI:27632 IUPAC Name: 1-phenylethanone SMILES: CC(=O)C1=CC=CC=C1
| PubChem CID | 7410 |
|---|---|
| CAS | 98-86-2 |
| ChEBI | CHEBI:27632 |
| MDL Number | MFCD00008724 |
| SMILES | CC(=O)C1=CC=CC=C1 |
| Synonym | acetophenone,methyl phenyl ketone,acetylbenzene,phenyl methyl ketone,ethanone, 1-phenyl,hypnone,benzoyl methide,acetophenon,1-phenylethan-1-one,acetylbenzol |
| IUPAC Name | 1-phenylethanone |
| InChI Key | KWOLFJPFCHCOCG-UHFFFAOYSA-N |
2(2-Ethoxyethoxy)ethanol, 98+%
CAS: 111-90-0 MDL Number: MFCD00002872 InChI Key: XXJWXESWEXIICW-UHFFFAOYSA-N Synonym: diethylene glycol monoethyl ether,2-2-ethoxyethoxy ethanol,carbitol,transcutol,ethoxy diglycol,dioxitol,ethyl carbitol,ethyl digol,carbitol solvent,ethanol, 2-2-ethoxyethoxy PubChem CID: 8146 ChEBI: CHEBI:40572 IUPAC Name: 2-(2-ethoxyethoxy)ethanol SMILES: CCOCCOCCO
| PubChem CID | 8146 |
|---|---|
| CAS | 111-90-0 |
| ChEBI | CHEBI:40572 |
| MDL Number | MFCD00002872 |
| SMILES | CCOCCOCCO |
| Synonym | diethylene glycol monoethyl ether,2-2-ethoxyethoxy ethanol,carbitol,transcutol,ethoxy diglycol,dioxitol,ethyl carbitol,ethyl digol,carbitol solvent,ethanol, 2-2-ethoxyethoxy |
| IUPAC Name | 2-(2-ethoxyethoxy)ethanol |
| InChI Key | XXJWXESWEXIICW-UHFFFAOYSA-N |
Tris(dibenzylideneacetone)dipalladium(0), 97%
CAS: 51364-51-3 Molecular Formula: C51H42O3Pd2 Molecular Weight (g/mol): 915.73 MDL Number: MFCD00013310 InChI Key: CYPYTURSJDMMMP-UHFFFAOYSA-N Synonym: tris dibenzylideneacetone dipalladium 0,tris dibenzylideneacetone dipalladium,pd2 dba 3,tris dibezylideneacetone dipalladium,tris dibenzylideneacetone dipalladium o,tris dibenzylideneacetonyl bis-palladium,tris dba,tris 1e,4e-1,5-diphenylpenta-1,4-dien-3-one dipalladium PubChem CID: 9811564 IUPAC Name: (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium SMILES: [Pd].[Pd].O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1
| PubChem CID | 9811564 |
|---|---|
| CAS | 51364-51-3 |
| Molecular Weight (g/mol) | 915.73 |
| MDL Number | MFCD00013310 |
| SMILES | [Pd].[Pd].O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1 |
| Synonym | tris dibenzylideneacetone dipalladium 0,tris dibenzylideneacetone dipalladium,pd2 dba 3,tris dibezylideneacetone dipalladium,tris dibenzylideneacetone dipalladium o,tris dibenzylideneacetonyl bis-palladium,tris dba,tris 1e,4e-1,5-diphenylpenta-1,4-dien-3-one dipalladium |
| IUPAC Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium |
| InChI Key | CYPYTURSJDMMMP-UHFFFAOYSA-N |
| Molecular Formula | C51H42O3Pd2 |
D(-)-Fructose, specified according the requirements of USP
CAS: 57-48-7 Molecular Formula: C6H12O6 Molecular Weight (g/mol): 180.16 InChI Key: BJHIKXHVCXFQLS-UYFOZJQFSA-N Synonym: d---fructose,d--fructose,3s,4r,5r-1,3,4,5,6-pentahydroxyhexan-2-one,furucton,arabino-hexulose,keto-d-fructose,d-levulose,sugar, fruit,fructose, d,krystar 300 PubChem CID: 5984 ChEBI: CHEBI:48095 IUPAC Name: (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one SMILES: C(C(C(C(C(=O)CO)O)O)O)O
| PubChem CID | 5984 |
|---|---|
| CAS | 57-48-7 |
| Molecular Weight (g/mol) | 180.16 |
| ChEBI | CHEBI:48095 |
| SMILES | C(C(C(C(C(=O)CO)O)O)O)O |
| Synonym | d---fructose,d--fructose,3s,4r,5r-1,3,4,5,6-pentahydroxyhexan-2-one,furucton,arabino-hexulose,keto-d-fructose,d-levulose,sugar, fruit,fructose, d,krystar 300 |
| IUPAC Name | (3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
| InChI Key | BJHIKXHVCXFQLS-UYFOZJQFSA-N |
| Molecular Formula | C6H12O6 |
1,3-Propanediol, 98%
CAS: 504-63-2 Molecular Formula: C3H8O2 Molecular Weight (g/mol): 76.10 MDL Number: MFCD00002949 InChI Key: YPFDHNVEDLHUCE-UHFFFAOYSA-N Synonym: 1,3-propanediol,trimethylene glycol,1,3-dihydroxypropane,2-deoxyglycerol,1,3-propylene glycol,1,3-propylenediol,1,3-propandiol,2-hydroxymethyl ethanol,omega-propanediol,beta-propylene glycol PubChem CID: 10442 ChEBI: CHEBI:16109 IUPAC Name: propane-1,3-diol SMILES: OCCCO
| PubChem CID | 10442 |
|---|---|
| CAS | 504-63-2 |
| Molecular Weight (g/mol) | 76.10 |
| ChEBI | CHEBI:16109 |
| MDL Number | MFCD00002949 |
| SMILES | OCCCO |
| Synonym | 1,3-propanediol,trimethylene glycol,1,3-dihydroxypropane,2-deoxyglycerol,1,3-propylene glycol,1,3-propylenediol,1,3-propandiol,2-hydroxymethyl ethanol,omega-propanediol,beta-propylene glycol |
| IUPAC Name | propane-1,3-diol |
| InChI Key | YPFDHNVEDLHUCE-UHFFFAOYSA-N |
| Molecular Formula | C3H8O2 |
3',5'-Dimethoxy-4'-hydroxyacetophenone, 97%
CAS: 2478-38-8 Molecular Formula: C10H12O4 Molecular Weight (g/mol): 196.20 MDL Number: MFCD00008748 InChI Key: OJOBTAOGJIWAGB-UHFFFAOYSA-N Synonym: acetosyringone,3',5'-dimethoxy-4'-hydroxyacetophenone,1-4-hydroxy-3,5-dimethoxyphenyl ethanone,4'-hydroxy-3',5'-dimethoxyacetophenone,3,5-dimethoxy-4-hydroxyacetophenone,acetosyringon,ethanone, 1-4-hydroxy-3,5-dimethoxyphenyl,1-4-hydroxy-3,5-dimethoxyphenyl ethan-1-one,acetosyringenin,acetophenone, 4'-hydroxy-3',5'-dimethoxy PubChem CID: 17198 ChEBI: CHEBI:2404 IUPAC Name: 1-(4-hydroxy-3,5-dimethoxyphenyl)ethanone SMILES: COC1=CC(=CC(OC)=C1O)C(C)=O
| PubChem CID | 17198 |
|---|---|
| CAS | 2478-38-8 |
| Molecular Weight (g/mol) | 196.20 |
| ChEBI | CHEBI:2404 |
| MDL Number | MFCD00008748 |
| SMILES | COC1=CC(=CC(OC)=C1O)C(C)=O |
| Synonym | acetosyringone,3',5'-dimethoxy-4'-hydroxyacetophenone,1-4-hydroxy-3,5-dimethoxyphenyl ethanone,4'-hydroxy-3',5'-dimethoxyacetophenone,3,5-dimethoxy-4-hydroxyacetophenone,acetosyringon,ethanone, 1-4-hydroxy-3,5-dimethoxyphenyl,1-4-hydroxy-3,5-dimethoxyphenyl ethan-1-one,acetosyringenin,acetophenone, 4'-hydroxy-3',5'-dimethoxy |
| IUPAC Name | 1-(4-hydroxy-3,5-dimethoxyphenyl)ethanone |
| InChI Key | OJOBTAOGJIWAGB-UHFFFAOYSA-N |
| Molecular Formula | C10H12O4 |
Platinum(II) acetylacetonate, 98%
CAS: 15170-57-7 Molecular Formula: C10H14O4Pt Molecular Weight (g/mol): 393.30 MDL Number: MFCD00000028 InChI Key: KLFRPGNCEJNEKU-FDGPNNRMSA-L Synonym: platinum ii acetylacetonate,pt acac 2,platinum bis acetylacetonate,acetylacetone platinum ii salt,platinum 2,4-pentanedionate,2,4-pentanedione platinum ii derivative,bis acetylacetonato platinum,bis acetylacetonato platinum ii,2,4-pentanedione, platinum ii PubChem CID: 10960186 IUPAC Name: (Z)-4-hydroxypent-3-en-2-one;platinum SMILES: [Pt++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| PubChem CID | 10960186 |
|---|---|
| CAS | 15170-57-7 |
| Molecular Weight (g/mol) | 393.30 |
| MDL Number | MFCD00000028 |
| SMILES | [Pt++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | platinum ii acetylacetonate,pt acac 2,platinum bis acetylacetonate,acetylacetone platinum ii salt,platinum 2,4-pentanedionate,2,4-pentanedione platinum ii derivative,bis acetylacetonato platinum,bis acetylacetonato platinum ii,2,4-pentanedione, platinum ii |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;platinum |
| InChI Key | KLFRPGNCEJNEKU-FDGPNNRMSA-L |
| Molecular Formula | C10H14O4Pt |
5-Methylfurfural, 98+%
CAS: 620-02-0 Molecular Formula: C6H6O2 Molecular Weight (g/mol): 110.11 MDL Number: MFCD00003232 InChI Key: OUDFNZMQXZILJD-UHFFFAOYSA-N Synonym: 5-methylfurfural,5-methyl-2-furaldehyde,5-methyl furfural,5-methyl-2-furfural,2-furancarboxaldehyde, 5-methyl,5-methylfuran-2-al,5-methyl-2-furancarboxaldehyde,5-methylfurfuraldehyde,2-furaldehyde, 5-methyl,2-formyl-5-methylfuran PubChem CID: 12097 ChEBI: CHEBI:2091 IUPAC Name: 5-methylfuran-2-carbaldehyde SMILES: CC1=CC=C(O1)C=O
| PubChem CID | 12097 |
|---|---|
| CAS | 620-02-0 |
| Molecular Weight (g/mol) | 110.11 |
| ChEBI | CHEBI:2091 |
| MDL Number | MFCD00003232 |
| SMILES | CC1=CC=C(O1)C=O |
| Synonym | 5-methylfurfural,5-methyl-2-furaldehyde,5-methyl furfural,5-methyl-2-furfural,2-furancarboxaldehyde, 5-methyl,5-methylfuran-2-al,5-methyl-2-furancarboxaldehyde,5-methylfurfuraldehyde,2-furaldehyde, 5-methyl,2-formyl-5-methylfuran |
| IUPAC Name | 5-methylfuran-2-carbaldehyde |
| InChI Key | OUDFNZMQXZILJD-UHFFFAOYSA-N |
| Molecular Formula | C6H6O2 |
2-(2-Butoxyethoxy)ethanol, 99+%
CAS: 112-34-5 Molecular Formula: C8H18O3 Molecular Weight (g/mol): 162.23 InChI Key: OAYXUHPQHDHDDZ-UHFFFAOYSA-N Synonym: 2-2-butoxyethoxy ethanol,diethylene glycol monobutyl ether,butyldiglycol,butyl carbitol,diethylene glycol butyl ether,butyl diglycol,butyl digol,ethanol, 2-2-butoxyethoxy,butoxyethoxyethanol,butoxydiglycol PubChem CID: 8177 IUPAC Name: 2-(2-butoxyethoxy)ethanol SMILES: CCCCOCCOCCO
| PubChem CID | 8177 |
|---|---|
| CAS | 112-34-5 |
| Molecular Weight (g/mol) | 162.23 |
| SMILES | CCCCOCCOCCO |
| Synonym | 2-2-butoxyethoxy ethanol,diethylene glycol monobutyl ether,butyldiglycol,butyl carbitol,diethylene glycol butyl ether,butyl diglycol,butyl digol,ethanol, 2-2-butoxyethoxy,butoxyethoxyethanol,butoxydiglycol |
| IUPAC Name | 2-(2-butoxyethoxy)ethanol |
| InChI Key | OAYXUHPQHDHDDZ-UHFFFAOYSA-N |
| Molecular Formula | C8H18O3 |
Pinacol, 99%
CAS: 76-09-5 Molecular Formula: C6H14O2 Molecular Weight (g/mol): 118.18 MDL Number: MFCD00004462 InChI Key: IVDFJHOHABJVEH-UHFFFAOYSA-N Synonym: pinacol,2,3-dimethyl-2,3-butanediol,pinacone,2,3-butanediol, 2,3-dimethyl,tetramethylethylene glycol,1,1,2,2-tetramethylethylene glycol,unii-527qe7i5co,2,3-dimethyl-butane-2,3-diol,2,3-dihydroxy-2,3-dimethylbutane,2,3-dimethyl-2,3-dihydroxybutane PubChem CID: 6425 IUPAC Name: 2,3-dimethylbutane-2,3-diol SMILES: CC(C)(C(C)(C)O)O
| PubChem CID | 6425 |
|---|---|
| CAS | 76-09-5 |
| Molecular Weight (g/mol) | 118.18 |
| MDL Number | MFCD00004462 |
| SMILES | CC(C)(C(C)(C)O)O |
| Synonym | pinacol,2,3-dimethyl-2,3-butanediol,pinacone,2,3-butanediol, 2,3-dimethyl,tetramethylethylene glycol,1,1,2,2-tetramethylethylene glycol,unii-527qe7i5co,2,3-dimethyl-butane-2,3-diol,2,3-dihydroxy-2,3-dimethylbutane,2,3-dimethyl-2,3-dihydroxybutane |
| IUPAC Name | 2,3-dimethylbutane-2,3-diol |
| InChI Key | IVDFJHOHABJVEH-UHFFFAOYSA-N |
| Molecular Formula | C6H14O2 |
Nickel acetylacetonate, 96%
CAS: 3264-82-2 Molecular Formula: C10H14NiO4 Molecular Weight (g/mol): 256.91 MDL Number: MFCD00000024 InChI Key: BMGNSKKZFQMGDH-FDGPNNRMSA-L Synonym: nickel ii acetylacetonate,bis 2,4-pentanedionato nickel ii hydrate,acetylacetone nickel ii salt,bis 2,4-pentanedionato nickel ii PubChem CID: 53384569 IUPAC Name: nickel(2+);(E)-4-oxopent-2-en-2-olate SMILES: [Ni++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| PubChem CID | 53384569 |
|---|---|
| CAS | 3264-82-2 |
| Molecular Weight (g/mol) | 256.91 |
| MDL Number | MFCD00000024 |
| SMILES | [Ni++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | nickel ii acetylacetonate,bis 2,4-pentanedionato nickel ii hydrate,acetylacetone nickel ii salt,bis 2,4-pentanedionato nickel ii |
| IUPAC Name | nickel(2+);(E)-4-oxopent-2-en-2-olate |
| InChI Key | BMGNSKKZFQMGDH-FDGPNNRMSA-L |
| Molecular Formula | C10H14NiO4 |
L(+)-Ascorbic Acid, 99%
CAS: 50-81-7 Molecular Formula: C6H8O6 Molecular Weight (g/mol): 176.12 MDL Number: MFCD00064328 InChI Key: CIWBSHSKHKDKBQ-DOMZIZNONA-N Synonym: l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin PubChem CID: 54670067 ChEBI: CHEBI:29073 IUPAC Name: (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one SMILES: OC[C@H](O)[C@H]1OC(=O)C(O)=C1O
| PubChem CID | 54670067 |
|---|---|
| CAS | 50-81-7 |
| Molecular Weight (g/mol) | 176.12 |
| ChEBI | CHEBI:29073 |
| MDL Number | MFCD00064328 |
| SMILES | OC[C@H](O)[C@H]1OC(=O)C(O)=C1O |
| Synonym | l-ascorbic acid,ascorbic acid,vitamin c,l-ascorbate,ascorbate,ascorbicap,l +-ascorbic acid,cevitamic acid,ascoltin,hybrin |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one |
| InChI Key | CIWBSHSKHKDKBQ-DOMZIZNONA-N |
| Molecular Formula | C6H8O6 |