Organic sulfuric acids and derivatives
- (3)
- (2)
- (2)
- (2)
- (3)
- (2)
- (1)
- (3)
- (3)
- (2)
- (3)
- (4)
- (2)
- (3)
- (2)
- (2)
- (1)
- (2)
- (3)
- (2)
- (3)
- (2)
- (2)
- (2)
- (7)
- (5)
- (5)
- (3)
- (2)
- (2)
- (9)
- (2)
- (3)
- (2)
- (8)
- (1)
- (2)
- (1)
- (10)
- (1)
- (1)
- (4)
- (2)
- (2)
- (3)
- (7)
- (2)
- (2)
- (19)
- (2)
- (13)
- (7)
- (15)
- (3)
- (6)
- (3)
- (14)
- (2)
- (9)
- (3)
- (4)
- (7)
Filtered Search Results
4-Nitrophenyl sulfate, potassium salt, 99+%
CAS: 6217-68-1 Molecular Formula: C6H4KNO6S Molecular Weight (g/mol): 257.26 MDL Number: MFCD00007466 InChI Key: BITVAZYUWRLLCN-UHFFFAOYSA-M Synonym: potassium 4-nitrophenyl sulfate,potassium 4-nitrophenyl sulphate,4-nitrophenyl sulfate potassium salt,potassium p-nitrophenyl sulfate,sulfuric acid, mono 4-nitrophenyl ester, potassium salt,sulfuric acid, mono 4-nitrophenyl ester, potassium salt 1:1,p-nitrophenyl sulfate potassium salt,potassium p-nitrophenyl sulphate,phenol, p-nitro-, hydrogen sulfate ester , potassium salt PubChem CID: 80348 IUPAC Name: potassium;(4-nitrophenyl) sulfate SMILES: [K+].[O-][N+](=O)C1=CC=C(OS([O-])(=O)=O)C=C1
| PubChem CID | 80348 |
|---|---|
| CAS | 6217-68-1 |
| Molecular Weight (g/mol) | 257.26 |
| MDL Number | MFCD00007466 |
| SMILES | [K+].[O-][N+](=O)C1=CC=C(OS([O-])(=O)=O)C=C1 |
| Synonym | potassium 4-nitrophenyl sulfate,potassium 4-nitrophenyl sulphate,4-nitrophenyl sulfate potassium salt,potassium p-nitrophenyl sulfate,sulfuric acid, mono 4-nitrophenyl ester, potassium salt,sulfuric acid, mono 4-nitrophenyl ester, potassium salt 1:1,p-nitrophenyl sulfate potassium salt,potassium p-nitrophenyl sulphate,phenol, p-nitro-, hydrogen sulfate ester , potassium salt |
| IUPAC Name | potassium;(4-nitrophenyl) sulfate |
| InChI Key | BITVAZYUWRLLCN-UHFFFAOYSA-M |
| Molecular Formula | C6H4KNO6S |
Phenazine methosulfate, 98%
CAS: 299-11-6 Molecular Formula: C13H11N2·CH3O4S Molecular Weight (g/mol): 306.33 MDL Number: MFCD00011923 InChI Key: RXGJTUSBYWCRBK-UHFFFAOYSA-M Synonym: phenazine methosulfate,5-methylphenazin-5-ium methyl sulfate,5-methylphenazinium methyl sulfate,n-methylphenazonium methosulfate,phenazine methosulphate,methylphenazonium methosulfate,5-methylphenazine methylsulfate,n-methylphenazinium methosulfate,n-methylphenazonium methosulphate,phenazinium, 5-methyl-, methyl sulfate PubChem CID: 9285 ChEBI: CHEBI:8055 IUPAC Name: 5-methylphenazin-5-ium;methyl sulfate SMILES: C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-]
| PubChem CID | 9285 |
|---|---|
| CAS | 299-11-6 |
| Molecular Weight (g/mol) | 306.33 |
| ChEBI | CHEBI:8055 |
| MDL Number | MFCD00011923 |
| SMILES | C[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.COS(=O)(=O)[O-] |
| Synonym | phenazine methosulfate,5-methylphenazin-5-ium methyl sulfate,5-methylphenazinium methyl sulfate,n-methylphenazonium methosulfate,phenazine methosulphate,methylphenazonium methosulfate,5-methylphenazine methylsulfate,n-methylphenazinium methosulfate,n-methylphenazonium methosulphate,phenazinium, 5-methyl-, methyl sulfate |
| IUPAC Name | 5-methylphenazin-5-ium;methyl sulfate |
| InChI Key | RXGJTUSBYWCRBK-UHFFFAOYSA-M |
| Molecular Formula | C13H11N2·CH3O4S |
Dodecyl sulfate, sodium salt, pure, specified according to the requirements of Ph.Eur.
CAS: 151-21-3 Molecular Formula: C12H25NaO4S Molecular Weight (g/mol): 288.38 MDL Number: MFCD00036175 InChI Key: DBMJMQXJHONAFJ-UHFFFAOYSA-M Synonym: sodium dodecyl sulfate,sodium lauryl sulfate,sodium dodecylsulfate,sodium lauryl sulphate,sodium dodecyl sulphate,dodecyl sulfate, sodium salt,anticerumen,gardinol,neutrazyme,duponal PubChem CID: 3423265 ChEBI: CHEBI:8984 IUPAC Name: sodium;dodecyl sulfate SMILES: [Na+].CCCCCCCCCCCCOS([O-])(=O)=O
| PubChem CID | 3423265 |
|---|---|
| CAS | 151-21-3 |
| Molecular Weight (g/mol) | 288.38 |
| ChEBI | CHEBI:8984 |
| MDL Number | MFCD00036175 |
| SMILES | [Na+].CCCCCCCCCCCCOS([O-])(=O)=O |
| Synonym | sodium dodecyl sulfate,sodium lauryl sulfate,sodium dodecylsulfate,sodium lauryl sulphate,sodium dodecyl sulphate,dodecyl sulfate, sodium salt,anticerumen,gardinol,neutrazyme,duponal |
| IUPAC Name | sodium;dodecyl sulfate |
| InChI Key | DBMJMQXJHONAFJ-UHFFFAOYSA-M |
| Molecular Formula | C12H25NaO4S |
Dimethyl sulfate, 99+%
CAS: 77-78-1 MDL Number: MFCD00008416 InChI Key: VAYGXNSJCAHWJZ-UHFFFAOYSA-N Synonym: dimethyl sulphate,sulfuric acid, dimethyl ester,dimethyl monosulfate,dimethylsulfate,dimethylsulfat,sulfate dimethylique,sulfuric acid dimethyl ester,dimethylsulfaat,dimetilsolfato,dms methyl sulfate PubChem CID: 6497 ChEBI: CHEBI:59050 IUPAC Name: dimethyl sulfate SMILES: COS(=O)(=O)OC
| PubChem CID | 6497 |
|---|---|
| CAS | 77-78-1 |
| ChEBI | CHEBI:59050 |
| MDL Number | MFCD00008416 |
| SMILES | COS(=O)(=O)OC |
| Synonym | dimethyl sulphate,sulfuric acid, dimethyl ester,dimethyl monosulfate,dimethylsulfate,dimethylsulfat,sulfate dimethylique,sulfuric acid dimethyl ester,dimethylsulfaat,dimetilsolfato,dms methyl sulfate |
| IUPAC Name | dimethyl sulfate |
| InChI Key | VAYGXNSJCAHWJZ-UHFFFAOYSA-N |
Sulfuric acid, for analysis, ca. 96% solution in water
CAS: 7664-93-9 Molecular Formula: H2O4S Molecular Weight (g/mol): 98.07 MDL Number: MFCD00064589 InChI Key: QAOWNCQODCNURD-UHFFFAOYSA-N Synonym: oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil PubChem CID: 1118 ChEBI: CHEBI:26836 IUPAC Name: sulfuric acid SMILES: OS(O)(=O)=O
| PubChem CID | 1118 |
|---|---|
| CAS | 7664-93-9 |
| Molecular Weight (g/mol) | 98.07 |
| ChEBI | CHEBI:26836 |
| MDL Number | MFCD00064589 |
| SMILES | OS(O)(=O)=O |
| Synonym | oil of vitriol,sulphuric acid,dihydrogen sulfate,mattling acid,battery acid,dipping acid,acide sulfurique,electrolyte acid,acidum sulfuricum,vitriol brown oil |
| IUPAC Name | sulfuric acid |
| InChI Key | QAOWNCQODCNURD-UHFFFAOYSA-N |
| Molecular Formula | H2O4S |
Hydrazine sulfate, 99+%
CAS: 10034-93-2 Molecular Formula: H4N2·H2SO4 Molecular Weight (g/mol): 130.12 MDL Number: MFCD00044873 InChI Key: ZGCHATBSUIJLRL-UHFFFAOYSA-N Synonym: hydrazine sulfate,hydrazine monosulfate,hydrazine, sulfate,hydrazine sulphate,hydrazinium sulfate,hydrazonium sulfate,hydrazine sulfate 1:1,segidrin,sehydrin,diamine sulfate PubChem CID: 24842 IUPAC Name: hydrazine;sulfuric acid SMILES: NN.OS(=O)(=O)O
| PubChem CID | 24842 |
|---|---|
| CAS | 10034-93-2 |
| Molecular Weight (g/mol) | 130.12 |
| MDL Number | MFCD00044873 |
| SMILES | NN.OS(=O)(=O)O |
| Synonym | hydrazine sulfate,hydrazine monosulfate,hydrazine, sulfate,hydrazine sulphate,hydrazinium sulfate,hydrazonium sulfate,hydrazine sulfate 1:1,segidrin,sehydrin,diamine sulfate |
| IUPAC Name | hydrazine;sulfuric acid |
| InChI Key | ZGCHATBSUIJLRL-UHFFFAOYSA-N |
| Molecular Formula | H4N2·H2SO4 |
Sodium cyclamate, 99%
CAS: 139-05-9 Molecular Formula: C6H12NNaO3S Molecular Weight (g/mol): 201.22 MDL Number: MFCD00003827 InChI Key: UDIPTWFVPPPURJ-UHFFFAOYSA-M Synonym: sodium cyclamate,sodium cyclohexylsulfamate,sodium n-cyclohexylsulfamate,cyclamate sodium,cyclamic acid sodium salt,assugrin,ibiosuc,suessette,suestamin,sugarin PubChem CID: 23665706 ChEBI: CHEBI:82431 IUPAC Name: sodium;N-cyclohexylsulfamate SMILES: [Na+].[O-]S(=O)(=O)NC1CCCCC1
| PubChem CID | 23665706 |
|---|---|
| CAS | 139-05-9 |
| Molecular Weight (g/mol) | 201.22 |
| ChEBI | CHEBI:82431 |
| MDL Number | MFCD00003827 |
| SMILES | [Na+].[O-]S(=O)(=O)NC1CCCCC1 |
| Synonym | sodium cyclamate,sodium cyclohexylsulfamate,sodium n-cyclohexylsulfamate,cyclamate sodium,cyclamic acid sodium salt,assugrin,ibiosuc,suessette,suestamin,sugarin |
| IUPAC Name | sodium;N-cyclohexylsulfamate |
| InChI Key | UDIPTWFVPPPURJ-UHFFFAOYSA-M |
| Molecular Formula | C6H12NNaO3S |
Diethyl sulfate, 99%
CAS: 64-67-5 Molecular Formula: C4H10O4S Molecular Weight (g/mol): 154.18 MDL Number: MFCD00009099 InChI Key: DENRZWYUOJLTMF-UHFFFAOYSA-N Synonym: sulfuric acid, diethyl ester,diethyl sulphate,diethylsulfate,diaethylsulfat,sulfuric acid diethyl ester,diethyl tetraoxosulfate,diaethylsulfat german,unii-k0fo4vfa7i,des van,diethylester kyseliny sirove PubChem CID: 6163 ChEBI: CHEBI:34699 IUPAC Name: diethyl sulfate SMILES: CCOS(=O)(=O)OCC
| PubChem CID | 6163 |
|---|---|
| CAS | 64-67-5 |
| Molecular Weight (g/mol) | 154.18 |
| ChEBI | CHEBI:34699 |
| MDL Number | MFCD00009099 |
| SMILES | CCOS(=O)(=O)OCC |
| Synonym | sulfuric acid, diethyl ester,diethyl sulphate,diethylsulfate,diaethylsulfat,sulfuric acid diethyl ester,diethyl tetraoxosulfate,diaethylsulfat german,unii-k0fo4vfa7i,des van,diethylester kyseliny sirove |
| IUPAC Name | diethyl sulfate |
| InChI Key | DENRZWYUOJLTMF-UHFFFAOYSA-N |
| Molecular Formula | C4H10O4S |
kappa-Carrageenan
CAS: 11114-20-8 Molecular Formula: C24H36O25S2-2 Molecular Weight (g/mol): 788.647 MDL Number: MFCD00081480 InChI Key: ZNOZWUKQPJXOIG-XSBHQQIPSA-L Synonym: kappa-carrageenan,kappa-carrageenans,1->4-3,6-anhydro-alpha-d-galactopyranosyl-1->3-4-o-sulfonato-beta-d-galactopyranan PubChem CID: 11966249 IUPAC Name: [(2R,3S,4R,5R,6S)-6-[[(1R,3S,4R,5R,8S)-3,4-dihydroxy-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-4-[[(1R,3R,4R,5R,8S)-8-[(2S,3R,4R,5R,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-sulfonatooxyoxan-2-yl]oxy-4-hydroxy-2,6-dioxabicyclo[3.2.1]octan-3-yl]oxy]-5-hydroxy-2-( SMILES: C1C2C(C(O1)C(C(O2)O)O)OC3C(C(C(C(O3)CO)OS(=O)(=O)[O-])OC4C(C5C(C(O4)CO5)OC6C(C(C(C(O6)CO)OS(=O)(=O)[O-])O)O)O)O
| PubChem CID | 11966249 |
|---|---|
| CAS | 11114-20-8 |
| Molecular Weight (g/mol) | 788.647 |
| MDL Number | MFCD00081480 |
| SMILES | C1C2C(C(O1)C(C(O2)O)O)OC3C(C(C(C(O3)CO)OS(=O)(=O)[O-])OC4C(C5C(C(O4)CO5)OC6C(C(C(C(O6)CO)OS(=O)(=O)[O-])O)O)O)O |
| Synonym | kappa-carrageenan,kappa-carrageenans,1->4-3,6-anhydro-alpha-d-galactopyranosyl-1->3-4-o-sulfonato-beta-d-galactopyranan |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-[[(1R,3S,4R,5R,8S)-3,4-dihydroxy-2,6-dioxabicyclo[3.2.1]octan-8-yl]oxy]-4-[[(1R,3R,4R,5R,8S)-8-[(2S,3R,4R,5R,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-sulfonatooxyoxan-2-yl]oxy-4-hydroxy-2,6-dioxabicyclo[3.2.1]octan-3-yl]oxy]-5-hydroxy-2-( |
| InChI Key | ZNOZWUKQPJXOIG-XSBHQQIPSA-L |
| Molecular Formula | C24H36O25S2-2 |
Tetradecyl sodium sulfate, 95%
CAS: 1191-50-0 Molecular Formula: C14H29NaO4S Molecular Weight (g/mol): 316.43 MDL Number: MFCD00007468 InChI Key: UPUIQOIQVMNQAP-UHFFFAOYSA-M Synonym: sodium tetradecyl sulfate,sodium myristyl sulfate,niaproof 4,sodium tetradecyl sulphate,tesapon k 14,texapon k 14,trombavar,natri tetradecylsulfas,sotradecol sodium,tetradecyl sodium sulfate PubChem CID: 23665770 IUPAC Name: sodium;tetradecyl sulfate SMILES: [Na+].CCCCCCCCCCCCCCOS([O-])(=O)=O
| PubChem CID | 23665770 |
|---|---|
| CAS | 1191-50-0 |
| Molecular Weight (g/mol) | 316.43 |
| MDL Number | MFCD00007468 |
| SMILES | [Na+].CCCCCCCCCCCCCCOS([O-])(=O)=O |
| Synonym | sodium tetradecyl sulfate,sodium myristyl sulfate,niaproof 4,sodium tetradecyl sulphate,tesapon k 14,texapon k 14,trombavar,natri tetradecylsulfas,sotradecol sodium,tetradecyl sodium sulfate |
| IUPAC Name | sodium;tetradecyl sulfate |
| InChI Key | UPUIQOIQVMNQAP-UHFFFAOYSA-M |
| Molecular Formula | C14H29NaO4S |
n-Octadecyl sulfate, sodium salt, 98%
CAS: 1120-04-3 Molecular Formula: C18H37NaO4S Molecular Weight (g/mol): 372.55 MDL Number: MFCD00007469 InChI Key: NWZBFJYXRGSRGD-UHFFFAOYSA-M Synonym: sodium stearyl sulfate,octadecyl sulfate sodium salt,sodium octadecyl sulfate,octadecyl sodium sulfate,sulfuric acid, monooctadecyl ester, sodium salt,sodium octadecyl sulphate,sodium monostearyl sulfate,unii-t4eww0y4ej,sodium n-octadecyl sulfate,sodium monooctadecyl sulfate PubChem CID: 23673604 IUPAC Name: sodium;octadecyl sulfate SMILES: CCCCCCCCCCCCCCCCCCOS(=O)(=O)[O-].[Na+]
| PubChem CID | 23673604 |
|---|---|
| CAS | 1120-04-3 |
| Molecular Weight (g/mol) | 372.55 |
| MDL Number | MFCD00007469 |
| SMILES | CCCCCCCCCCCCCCCCCCOS(=O)(=O)[O-].[Na+] |
| Synonym | sodium stearyl sulfate,octadecyl sulfate sodium salt,sodium octadecyl sulfate,octadecyl sodium sulfate,sulfuric acid, monooctadecyl ester, sodium salt,sodium octadecyl sulphate,sodium monostearyl sulfate,unii-t4eww0y4ej,sodium n-octadecyl sulfate,sodium monooctadecyl sulfate |
| IUPAC Name | sodium;octadecyl sulfate |
| InChI Key | NWZBFJYXRGSRGD-UHFFFAOYSA-M |
| Molecular Formula | C18H37NaO4S |
2-Methyl-2-thiopseudourea hemisulfate, 98%
CAS: 867-44-7 MDL Number: MFCD00013055 InChI Key: BZZXQZOBAUXLHZ-UHFFFAOYSA-N Synonym: s-methylisothiourea hemisulfate,2-methyl-2-thiopseudourea hemisulfate,carbamimidothioic acid, methyl ester, sulfate 2:1,s-methylisothiourea sulfate 2:1,s-methylthiouronium sulfate 2:1,bis 2-methylisothiouronium sulphate,methyl carbamimidothioate sulfate 2:1,methylcarbamimidothioate sulfate 2:1,s-methylisothiourea, sulfate,2-methyl-2-thiopseudourea sulfate 2:1 PubChem CID: 13347 IUPAC Name: methyl carbamimidothioate;sulfuric acid SMILES: CSC(=N)N.CSC(=N)N.OS(=O)(=O)O
| PubChem CID | 13347 |
|---|---|
| CAS | 867-44-7 |
| MDL Number | MFCD00013055 |
| SMILES | CSC(=N)N.CSC(=N)N.OS(=O)(=O)O |
| Synonym | s-methylisothiourea hemisulfate,2-methyl-2-thiopseudourea hemisulfate,carbamimidothioic acid, methyl ester, sulfate 2:1,s-methylisothiourea sulfate 2:1,s-methylthiouronium sulfate 2:1,bis 2-methylisothiouronium sulphate,methyl carbamimidothioate sulfate 2:1,methylcarbamimidothioate sulfate 2:1,s-methylisothiourea, sulfate,2-methyl-2-thiopseudourea sulfate 2:1 |
| IUPAC Name | methyl carbamimidothioate;sulfuric acid |
| InChI Key | BZZXQZOBAUXLHZ-UHFFFAOYSA-N |
Sulfamide, 98+%
CAS: 7803-58-9 Molecular Formula: H4N2O2S Molecular Weight (g/mol): 96.10 MDL Number: MFCD00011606 InChI Key: NVBFHJWHLNUMCV-UHFFFAOYSA-N Synonym: sulfuric diamide,sulfamamide,sulfuryl amide,sulfonyl diamide,sulfuryl diamide,sulfamoylamine,sulphamide,sulphuric diamide,unii-vs7tzw634v,imidosulfamic acid PubChem CID: 82267 ChEBI: CHEBI:29368 IUPAC Name: sulfamoylamine SMILES: NS(N)(=O)=O
| PubChem CID | 82267 |
|---|---|
| CAS | 7803-58-9 |
| Molecular Weight (g/mol) | 96.10 |
| ChEBI | CHEBI:29368 |
| MDL Number | MFCD00011606 |
| SMILES | NS(N)(=O)=O |
| Synonym | sulfuric diamide,sulfamamide,sulfuryl amide,sulfonyl diamide,sulfuryl diamide,sulfamoylamine,sulphamide,sulphuric diamide,unii-vs7tzw634v,imidosulfamic acid |
| IUPAC Name | sulfamoylamine |
| InChI Key | NVBFHJWHLNUMCV-UHFFFAOYSA-N |
| Molecular Formula | H4N2O2S |
Hydroxychloroquine sulfate, 98%
CAS: 747-36-4 Molecular Formula: C18H26ClN3O·H2SO4 Molecular Weight (g/mol): 433.96 MDL Number: MFCD00078203 InChI Key: JCBIVZZPXRZKTI-UHFFFAOYSA-N Synonym: hydroxychloroquine sulfate,hydroxychloroquine sulphate,ercoquin,plaquinol,toremonil,2-4-7-chloroquinolin-4-yl amino pentyl ethyl amino ethanol sulfate,hydroxychloroquine sulfate usp,plaquenil tn,hydroxychloroquine; sulfuric acid,dsstox_cid_27788 PubChem CID: 12947 IUPAC Name: 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid SMILES: CCN(CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)CCO.OS(=O)(=O)O
| PubChem CID | 12947 |
|---|---|
| CAS | 747-36-4 |
| Molecular Weight (g/mol) | 433.96 |
| MDL Number | MFCD00078203 |
| SMILES | CCN(CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)CCO.OS(=O)(=O)O |
| Synonym | hydroxychloroquine sulfate,hydroxychloroquine sulphate,ercoquin,plaquinol,toremonil,2-4-7-chloroquinolin-4-yl amino pentyl ethyl amino ethanol sulfate,hydroxychloroquine sulfate usp,plaquenil tn,hydroxychloroquine; sulfuric acid,dsstox_cid_27788 |
| IUPAC Name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid |
| InChI Key | JCBIVZZPXRZKTI-UHFFFAOYSA-N |
| Molecular Formula | C18H26ClN3O·H2SO4 |
Dimethyl sulfate, 99+%, AcroSeal™
CAS: 77-78-1 Molecular Formula: C2H6O4S Molecular Weight (g/mol): 126.13 MDL Number: MFCD00008416 InChI Key: VAYGXNSJCAHWJZ-UHFFFAOYSA-N Synonym: dimethyl sulphate,sulfuric acid, dimethyl ester,dimethyl monosulfate,dimethylsulfate,dimethylsulfat,sulfate dimethylique,sulfuric acid dimethyl ester,dimethylsulfaat,dimetilsolfato,dms methyl sulfate PubChem CID: 6497 ChEBI: CHEBI:59050 IUPAC Name: dimethyl sulfate SMILES: COS(=O)(=O)OC
| PubChem CID | 6497 |
|---|---|
| CAS | 77-78-1 |
| Molecular Weight (g/mol) | 126.13 |
| ChEBI | CHEBI:59050 |
| MDL Number | MFCD00008416 |
| SMILES | COS(=O)(=O)OC |
| Synonym | dimethyl sulphate,sulfuric acid, dimethyl ester,dimethyl monosulfate,dimethylsulfate,dimethylsulfat,sulfate dimethylique,sulfuric acid dimethyl ester,dimethylsulfaat,dimetilsolfato,dms methyl sulfate |
| IUPAC Name | dimethyl sulfate |
| InChI Key | VAYGXNSJCAHWJZ-UHFFFAOYSA-N |
| Molecular Formula | C2H6O4S |