Cinnamic acids and derivatives
- (2)
- (1)
- (2)
- (4)
- (5)
- (2)
- (2)
- (1)
- (3)
- (1)
- (2)
- (3)
- (2)
- (2)
- (2)
- (2)
- (3)
- (2)
- (2)
- (2)
- (4)
- (14)
- (3)
- (12)
- (4)
- (2)
- (7)
- (15)
- (1)
- (9)
- (1)
- (11)
- (3)
- (2)
- (2)
- (11)
- (1)
- (7)
Filtered Search Results
Thermo Scientific Chemicals Curcumin (mixture of curcumin, demethoxycurcumin, and bisdemethoxycurcumin), 96%
CAS: 458-37-7 Molecular Formula: C21H20O6 Molecular Weight (g/mol): 368.39 MDL Number: MFCD00008365 InChI Key: ZIUSSTSXXLLKKK-KOBPDPAPSA-N Synonym: curcumin,diferuloylmethane,natural yellow 3,turmeric yellow,turmeric,curcuma,kacha haldi,gelbwurz,halad,curcumin i PubChem CID: 969516 ChEBI: CHEBI:3962 SMILES: COC1=CC(\C=C\C(\O)=C\C(=O)\C=C\C2=CC=C(O)C(OC)=C2)=CC=C1O
| PubChem CID | 969516 |
|---|---|
| CAS | 458-37-7 |
| Molecular Weight (g/mol) | 368.39 |
| ChEBI | CHEBI:3962 |
| MDL Number | MFCD00008365 |
| SMILES | COC1=CC(\C=C\C(\O)=C\C(=O)\C=C\C2=CC=C(O)C(OC)=C2)=CC=C1O |
| Synonym | curcumin,diferuloylmethane,natural yellow 3,turmeric yellow,turmeric,curcuma,kacha haldi,gelbwurz,halad,curcumin i |
| InChI Key | ZIUSSTSXXLLKKK-KOBPDPAPSA-N |
| Molecular Formula | C21H20O6 |
3,5-Dimethoxy-4-hydroxycinnamic acid, 98%, predominantly trans isomer
CAS: 530-59-6 Molecular Formula: C11H12O5 Molecular Weight (g/mol): 224.21 InChI Key: PCMORTLOPMLEFB-ONEGZZNKSA-N Synonym: sinapic acid,sinapinic acid,3,5-dimethoxy-4-hydroxycinnamic acid,sinapinate,sinapate,trans-sinapic acid,4-hydroxy-3,5-dimethoxycinnamic acid,synapoic acid,2e-3-4-hydroxy-3,5-dimethoxyphenyl prop-2-enoic acid,unii-p0i60993ec PubChem CID: 637775 ChEBI: CHEBI:15714 IUPAC Name: (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid SMILES: COC1=CC(=CC(=C1O)OC)C=CC(=O)O
| PubChem CID | 637775 |
|---|---|
| CAS | 530-59-6 |
| Molecular Weight (g/mol) | 224.21 |
| ChEBI | CHEBI:15714 |
| SMILES | COC1=CC(=CC(=C1O)OC)C=CC(=O)O |
| Synonym | sinapic acid,sinapinic acid,3,5-dimethoxy-4-hydroxycinnamic acid,sinapinate,sinapate,trans-sinapic acid,4-hydroxy-3,5-dimethoxycinnamic acid,synapoic acid,2e-3-4-hydroxy-3,5-dimethoxyphenyl prop-2-enoic acid,unii-p0i60993ec |
| IUPAC Name | (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid |
| InChI Key | PCMORTLOPMLEFB-ONEGZZNKSA-N |
| Molecular Formula | C11H12O5 |
p-Methoxycinnamic acid, 98%, predominantly trans
CAS: 830-09-1 Molecular Formula: C10H10O3 Molecular Weight (g/mol): 178.19 MDL Number: MFCD00004398 InChI Key: AFDXODALSZRGIH-QPJJXVBHSA-N Synonym: 4-methoxycinnamic acid,p-methoxycinnamic acid,3-4-methoxyphenyl acrylic acid,trans-4-methoxycinnamic acid,4-methoxycinnamate,para-methoxycinnamic acid,o-methyl-p-coumaric acid,cinnamic acid, p-methoxy,e-3-4-methoxyphenyl acrylic acid,e-3-4-methoxyphenyl-2-propenoic acid PubChem CID: 699414 IUPAC Name: (E)-3-(4-methoxyphenyl)prop-2-enoic acid SMILES: COC1=CC=C(C=C1)C=CC(=O)O
| PubChem CID | 699414 |
|---|---|
| CAS | 830-09-1 |
| Molecular Weight (g/mol) | 178.19 |
| MDL Number | MFCD00004398 |
| SMILES | COC1=CC=C(C=C1)C=CC(=O)O |
| Synonym | 4-methoxycinnamic acid,p-methoxycinnamic acid,3-4-methoxyphenyl acrylic acid,trans-4-methoxycinnamic acid,4-methoxycinnamate,para-methoxycinnamic acid,o-methyl-p-coumaric acid,cinnamic acid, p-methoxy,e-3-4-methoxyphenyl acrylic acid,e-3-4-methoxyphenyl-2-propenoic acid |
| IUPAC Name | (E)-3-(4-methoxyphenyl)prop-2-enoic acid |
| InChI Key | AFDXODALSZRGIH-QPJJXVBHSA-N |
| Molecular Formula | C10H10O3 |
2-Fluorocinnamic acid, 98%, Thermo Scientific™
CAS: 451-69-4 Molecular Formula: C9H7FO2 Molecular Weight (g/mol): 166.15 MDL Number: MFCD00004370 InChI Key: IOUDZAFBPDDAMK-AATRIKPKSA-N Synonym: 2-fluorocinnamic acid,o-fluorocinnamic acid,cinnamic acid, o-fluoro,2-propenoic acid, 3-2-fluorophenyl,2e-3-2-fluorophenyl prop-2-enoic acid,3-2-fluorophenyl acrylic acid,3-2-fluoro-phenyl-acrylic acid,2e-3-2-fluorophenyl acrylic acid,3-2-fluorophenyl-2-propenoic acid,trans-2-fluorocinnamic acid PubChem CID: 735833 IUPAC Name: (E)-3-(2-fluorophenyl)prop-2-enoic acid SMILES: OC(=O)\C=C\C1=CC=CC=C1F
| PubChem CID | 735833 |
|---|---|
| CAS | 451-69-4 |
| Molecular Weight (g/mol) | 166.15 |
| MDL Number | MFCD00004370 |
| SMILES | OC(=O)\C=C\C1=CC=CC=C1F |
| Synonym | 2-fluorocinnamic acid,o-fluorocinnamic acid,cinnamic acid, o-fluoro,2-propenoic acid, 3-2-fluorophenyl,2e-3-2-fluorophenyl prop-2-enoic acid,3-2-fluorophenyl acrylic acid,3-2-fluoro-phenyl-acrylic acid,2e-3-2-fluorophenyl acrylic acid,3-2-fluorophenyl-2-propenoic acid,trans-2-fluorocinnamic acid |
| IUPAC Name | (E)-3-(2-fluorophenyl)prop-2-enoic acid |
| InChI Key | IOUDZAFBPDDAMK-AATRIKPKSA-N |
| Molecular Formula | C9H7FO2 |
4-Fluorocinnamic acid, 99%
CAS: 459-32-5 Molecular Formula: C9H7FO2 Molecular Weight (g/mol): 166.15 MDL Number: MFCD00004395 InChI Key: ISMMYAZSUSYVQG-ZZXKWVIFSA-N Synonym: 4-fluorocinnamic acid,e-3-4-fluorophenyl acrylic acid,2e-3-4-fluorophenyl prop-2-enoic acid,p-fluorocinnamic acid,3-4-fluorophenyl acrylic acid,e-p-fluorocinnamic acid,trans-4-fluorocinnamic acid,p-fluoro cinnamic acid,3-4-fluorophenyl prop-2-enoic acid,2-propenoic acid, 3-4-fluorophenyl-, 2e PubChem CID: 1530234 IUPAC Name: (E)-3-(4-fluorophenyl)prop-2-enoic acid SMILES: C1=CC(=CC=C1C=CC(=O)O)F
| PubChem CID | 1530234 |
|---|---|
| CAS | 459-32-5 |
| Molecular Weight (g/mol) | 166.15 |
| MDL Number | MFCD00004395 |
| SMILES | C1=CC(=CC=C1C=CC(=O)O)F |
| Synonym | 4-fluorocinnamic acid,e-3-4-fluorophenyl acrylic acid,2e-3-4-fluorophenyl prop-2-enoic acid,p-fluorocinnamic acid,3-4-fluorophenyl acrylic acid,e-p-fluorocinnamic acid,trans-4-fluorocinnamic acid,p-fluoro cinnamic acid,3-4-fluorophenyl prop-2-enoic acid,2-propenoic acid, 3-4-fluorophenyl-, 2e |
| IUPAC Name | (E)-3-(4-fluorophenyl)prop-2-enoic acid |
| InChI Key | ISMMYAZSUSYVQG-ZZXKWVIFSA-N |
| Molecular Formula | C9H7FO2 |
4-Hydroxy-3-methoxycinnamic acid, 99%
CAS: 1135-24-6 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00004400 InChI Key: KSEBMYQBYZTDHS-HWKANZROSA-N Synonym: ferulic acid,trans-ferulic acid,4-hydroxy-3-methoxycinnamic acid,trans-4-hydroxy-3-methoxycinnamic acid,3-4-hydroxy-3-methoxyphenyl acrylic acid,e-ferulic acid,coniferic acid,ferulate,ferulic acid, trans,2-propenoic acid, 3-4-hydroxy-3-methoxyphenyl PubChem CID: 445858 ChEBI: CHEBI:17620 IUPAC Name: (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid SMILES: COC1=C(C=CC(=C1)C=CC(=O)O)O
| PubChem CID | 445858 |
|---|---|
| CAS | 1135-24-6 |
| Molecular Weight (g/mol) | 194.19 |
| ChEBI | CHEBI:17620 |
| MDL Number | MFCD00004400 |
| SMILES | COC1=C(C=CC(=C1)C=CC(=O)O)O |
| Synonym | ferulic acid,trans-ferulic acid,4-hydroxy-3-methoxycinnamic acid,trans-4-hydroxy-3-methoxycinnamic acid,3-4-hydroxy-3-methoxyphenyl acrylic acid,e-ferulic acid,coniferic acid,ferulate,ferulic acid, trans,2-propenoic acid, 3-4-hydroxy-3-methoxyphenyl |
| IUPAC Name | (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid |
| InChI Key | KSEBMYQBYZTDHS-HWKANZROSA-N |
| Molecular Formula | C10H10O4 |
p-Hydroxycinnamic acid, 98%, predominantly trans
CAS: 501-98-4 Molecular Formula: C9H8O3 Molecular Weight (g/mol): 164.16 MDL Number: MFCD00004399 InChI Key: NGSWKAQJJWESNS-ZZXKWVIFSA-N Synonym: p-coumaric acid,4-hydroxycinnamic acid,p-hydroxycinnamic acid,4-coumaric acid,trans-4-hydroxycinnamic acid,trans-p-coumaric acid,p-cumaric acid,3-4-hydroxyphenyl acrylic acid,para-coumaric acid,hydroxycinnamic acid PubChem CID: 637542 ChEBI: CHEBI:32374 IUPAC Name: (E)-3-(4-hydroxyphenyl)prop-2-enoic acid SMILES: C1=CC(=CC=C1C=CC(=O)O)O
| PubChem CID | 637542 |
|---|---|
| CAS | 501-98-4 |
| Molecular Weight (g/mol) | 164.16 |
| ChEBI | CHEBI:32374 |
| MDL Number | MFCD00004399 |
| SMILES | C1=CC(=CC=C1C=CC(=O)O)O |
| Synonym | p-coumaric acid,4-hydroxycinnamic acid,p-hydroxycinnamic acid,4-coumaric acid,trans-4-hydroxycinnamic acid,trans-p-coumaric acid,p-cumaric acid,3-4-hydroxyphenyl acrylic acid,para-coumaric acid,hydroxycinnamic acid |
| IUPAC Name | (E)-3-(4-hydroxyphenyl)prop-2-enoic acid |
| InChI Key | NGSWKAQJJWESNS-ZZXKWVIFSA-N |
| Molecular Formula | C9H8O3 |
Cinnamamide, 97%, predominantly trans
CAS: 621-79-4 Molecular Formula: C9H9NO Molecular Weight (g/mol): 147.18 MDL Number: MFCD00008033 InChI Key: APEJMQOBVMLION-VOTSOKGWSA-N Synonym: cinnamamide,trans-cinnamamide,3-phenylacrylamide,cinnamic amide,2-propenamide, 3-phenyl,3-phenylpropenamide,2-benzylideneacetamide,e-cinnamamide,ginnamic acid amide,trans-cinnamoylamine PubChem CID: 5273472 ChEBI: CHEBI:76320 IUPAC Name: (E)-3-phenylprop-2-enamide SMILES: C1=CC=C(C=C1)C=CC(=O)N
| PubChem CID | 5273472 |
|---|---|
| CAS | 621-79-4 |
| Molecular Weight (g/mol) | 147.18 |
| ChEBI | CHEBI:76320 |
| MDL Number | MFCD00008033 |
| SMILES | C1=CC=C(C=C1)C=CC(=O)N |
| Synonym | cinnamamide,trans-cinnamamide,3-phenylacrylamide,cinnamic amide,2-propenamide, 3-phenyl,3-phenylpropenamide,2-benzylideneacetamide,e-cinnamamide,ginnamic acid amide,trans-cinnamoylamine |
| IUPAC Name | (E)-3-phenylprop-2-enamide |
| InChI Key | APEJMQOBVMLION-VOTSOKGWSA-N |
| Molecular Formula | C9H9NO |
3,4-Dichlorocinnamic acid, 97%, Thermo Scientific™
CAS: 1202-39-7 Molecular Formula: C9H6Cl2O2 Molecular Weight (g/mol): 217.05 InChI Key: RRLUFPHCTSFKNR-DUXPYHPUSA-N Synonym: 3,4-dichlorocinnamic acid,e-3-3,4-dichlorophenyl acrylic acid,3',4'-dichlorocinnamic acid,2-propenoic acid, 3-3,4-dichlorophenyl,cinnamic acid, 3,4-dichloro,3-3,4-dichlorophenyl acrylic acid,2e-3-3,4-dichlorophenyl prop-2-enoic acid,3-3,4-dichlorophenyl-2-propenoic acid,e-3-3,4-dichlorophenyl prop-2-enoic acid,2e-3-3,4-dichlorophenyl acrylic acid PubChem CID: 688027 IUPAC Name: (E)-3-(3,4-dichlorophenyl)prop-2-enoic acid SMILES: C1=CC(=C(C=C1C=CC(=O)O)Cl)Cl
| PubChem CID | 688027 |
|---|---|
| CAS | 1202-39-7 |
| Molecular Weight (g/mol) | 217.05 |
| SMILES | C1=CC(=C(C=C1C=CC(=O)O)Cl)Cl |
| Synonym | 3,4-dichlorocinnamic acid,e-3-3,4-dichlorophenyl acrylic acid,3',4'-dichlorocinnamic acid,2-propenoic acid, 3-3,4-dichlorophenyl,cinnamic acid, 3,4-dichloro,3-3,4-dichlorophenyl acrylic acid,2e-3-3,4-dichlorophenyl prop-2-enoic acid,3-3,4-dichlorophenyl-2-propenoic acid,e-3-3,4-dichlorophenyl prop-2-enoic acid,2e-3-3,4-dichlorophenyl acrylic acid |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)prop-2-enoic acid |
| InChI Key | RRLUFPHCTSFKNR-DUXPYHPUSA-N |
| Molecular Formula | C9H6Cl2O2 |
3,4-Dimethoxycinnamic acid, 99%, predominantly trans isomer
CAS: 2316-26-9 Molecular Formula: C11H12O4 Molecular Weight (g/mol): 208.21 MDL Number: MFCD00004387 InChI Key: HJBWJAPEBGSQPR-GQCTYLIASA-N Synonym: 3,4-dimethoxycinnamic acid,dimethylcaffeic acid,caffeic acid dimethyl ether,2e-3-3,4-dimethoxyphenyl prop-2-enoic acid,dimethyl caffeic acid,e-3-3,4-dimethoxyphenyl acrylic acid,e-3,4-dimethoxycinnamic acid,unii-bvz841pvjl,2e-3-3,4-dimethoxyphenyl acrylic acid,3-3,4-dimethoxyphenyl acrylic acid PubChem CID: 717531 ChEBI: CHEBI:86549 IUPAC Name: (E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid SMILES: COC1=C(C=C(C=C1)C=CC(=O)O)OC
| PubChem CID | 717531 |
|---|---|
| CAS | 2316-26-9 |
| Molecular Weight (g/mol) | 208.21 |
| ChEBI | CHEBI:86549 |
| MDL Number | MFCD00004387 |
| SMILES | COC1=C(C=C(C=C1)C=CC(=O)O)OC |
| Synonym | 3,4-dimethoxycinnamic acid,dimethylcaffeic acid,caffeic acid dimethyl ether,2e-3-3,4-dimethoxyphenyl prop-2-enoic acid,dimethyl caffeic acid,e-3-3,4-dimethoxyphenyl acrylic acid,e-3,4-dimethoxycinnamic acid,unii-bvz841pvjl,2e-3-3,4-dimethoxyphenyl acrylic acid,3-3,4-dimethoxyphenyl acrylic acid |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid |
| InChI Key | HJBWJAPEBGSQPR-GQCTYLIASA-N |
| Molecular Formula | C11H12O4 |
4-Chlorocinnamic acid, 99%, predominantly trans
CAS: 1615-02-7 Molecular Formula: C9H7ClO2 Molecular Weight (g/mol): 182.60 MDL Number: MFCD00004396 InChI Key: GXLIFJYFGMHYDY-ZZXKWVIFSA-N Synonym: 4-chlorocinnamic acid,p-chlorocinnamic acid,3-4-chlorophenyl acrylic acid,trans-4-chlorocinnamic acid,2e-3-4-chlorophenyl prop-2-enoic acid,e-p-chlorocinnamic acid,cinnamic acid, p-chloro,trans-p-chlorocinnamic acid,2-propenoic acid, 3-4-chlorophenyl,3-p-chlorophenyl acrylic acid PubChem CID: 637797 ChEBI: CHEBI:61116 IUPAC Name: (E)-3-(4-chlorophenyl)prop-2-enoic acid SMILES: OC(=O)\C=C\C1=CC=C(Cl)C=C1
| PubChem CID | 637797 |
|---|---|
| CAS | 1615-02-7 |
| Molecular Weight (g/mol) | 182.60 |
| ChEBI | CHEBI:61116 |
| MDL Number | MFCD00004396 |
| SMILES | OC(=O)\C=C\C1=CC=C(Cl)C=C1 |
| Synonym | 4-chlorocinnamic acid,p-chlorocinnamic acid,3-4-chlorophenyl acrylic acid,trans-4-chlorocinnamic acid,2e-3-4-chlorophenyl prop-2-enoic acid,e-p-chlorocinnamic acid,cinnamic acid, p-chloro,trans-p-chlorocinnamic acid,2-propenoic acid, 3-4-chlorophenyl,3-p-chlorophenyl acrylic acid |
| IUPAC Name | (E)-3-(4-chlorophenyl)prop-2-enoic acid |
| InChI Key | GXLIFJYFGMHYDY-ZZXKWVIFSA-N |
| Molecular Formula | C9H7ClO2 |
2-Carboxycinnamic acid, 98%, ACROS Organics™
CAS: 612-40-8 Molecular Formula: C10H8O4 Molecular Weight (g/mol): 192.17 MDL Number: MFCD00004380 InChI Key: SCWPNMHQRGNQHH-AATRIKPKSA-N Synonym: 2-carboxycinnamic acid,2-2-carboxyvinyl benzoic acid,2-2-carboxyethenyl benzoic acid,e-2-2-carboxyvinyl benzoic acid,2-e-3-hydroxy-3-oxoprop-1-enyl benzoic acid,2-1e-2-carboxyvinyl benzoic acid,2-e-2-carboxyethenyl benzoic acid,2-1e-2-carboxyeth-1-en-1-yl benzoic acid,2-e-2-carboxyvinyl benzoicacid,2-carboxy cinnamic acid PubChem CID: 904938 IUPAC Name: 2-[(1E)-2-carboxyeth-1-en-1-yl]benzoic acid SMILES: OC(=O)\C=C\C1=CC=CC=C1C(O)=O
| PubChem CID | 904938 |
|---|---|
| CAS | 612-40-8 |
| Molecular Weight (g/mol) | 192.17 |
| MDL Number | MFCD00004380 |
| SMILES | OC(=O)\C=C\C1=CC=CC=C1C(O)=O |
| Synonym | 2-carboxycinnamic acid,2-2-carboxyvinyl benzoic acid,2-2-carboxyethenyl benzoic acid,e-2-2-carboxyvinyl benzoic acid,2-e-3-hydroxy-3-oxoprop-1-enyl benzoic acid,2-1e-2-carboxyvinyl benzoic acid,2-e-2-carboxyethenyl benzoic acid,2-1e-2-carboxyeth-1-en-1-yl benzoic acid,2-e-2-carboxyvinyl benzoicacid,2-carboxy cinnamic acid |
| IUPAC Name | 2-[(1E)-2-carboxyeth-1-en-1-yl]benzoic acid |
| InChI Key | SCWPNMHQRGNQHH-AATRIKPKSA-N |
| Molecular Formula | C10H8O4 |
m-Hydroxycinnamic acid, 99%, predominantly trans, Thermo Scientific Chemicals
CAS: 14755-02-3 Molecular Formula: C9H8O3 Molecular Weight (g/mol): 164.16 MDL Number: MFCD00004390 InChI Key: KKSDGJDHHZEWEP-SNAWJCMRSA-N Synonym: 3-hydroxycinnamic acid,3-coumaric acid,m-coumaric acid,m-hydroxycinnamic acid,3-3-hydroxyphenyl acrylic acid,e-3-3-hydroxyphenyl acrylic acid,trans-3-hydroxycinnamic acid,trans-3-hydroxycinnamate,cinnamic acid, m-hydroxy,2e-3-3-hydroxyphenyl prop-2-enoic acid PubChem CID: 637541 ChEBI: CHEBI:32357 IUPAC Name: (E)-3-(3-hydroxyphenyl)prop-2-enoic acid SMILES: C1=CC(=CC(=C1)O)C=CC(=O)O
| PubChem CID | 637541 |
|---|---|
| CAS | 14755-02-3 |
| Molecular Weight (g/mol) | 164.16 |
| ChEBI | CHEBI:32357 |
| MDL Number | MFCD00004390 |
| SMILES | C1=CC(=CC(=C1)O)C=CC(=O)O |
| Synonym | 3-hydroxycinnamic acid,3-coumaric acid,m-coumaric acid,m-hydroxycinnamic acid,3-3-hydroxyphenyl acrylic acid,e-3-3-hydroxyphenyl acrylic acid,trans-3-hydroxycinnamic acid,trans-3-hydroxycinnamate,cinnamic acid, m-hydroxy,2e-3-3-hydroxyphenyl prop-2-enoic acid |
| IUPAC Name | (E)-3-(3-hydroxyphenyl)prop-2-enoic acid |
| InChI Key | KKSDGJDHHZEWEP-SNAWJCMRSA-N |
| Molecular Formula | C9H8O3 |
alpha-Cyano-3-hydroxycinnamic acid, 98%
CAS: 54673-07-3 Molecular Formula: C10H7NO3 Molecular Weight (g/mol): 189.17 MDL Number: MFCD00004203 InChI Key: HPLNTJVXWMJLNJ-YWEYNIOJSA-N Synonym: 2z-2-cyano-3-3-hydroxyphenyl prop-2-enoic acid PubChem CID: 21338270 IUPAC Name: (Z)-2-cyano-3-(3-hydroxyphenyl)prop-2-enoic acid SMILES: C1=CC(=CC(=C1)O)C=C(C#N)C(=O)O
| PubChem CID | 21338270 |
|---|---|
| CAS | 54673-07-3 |
| Molecular Weight (g/mol) | 189.17 |
| MDL Number | MFCD00004203 |
| SMILES | C1=CC(=CC(=C1)O)C=C(C#N)C(=O)O |
| Synonym | 2z-2-cyano-3-3-hydroxyphenyl prop-2-enoic acid |
| IUPAC Name | (Z)-2-cyano-3-(3-hydroxyphenyl)prop-2-enoic acid |
| InChI Key | HPLNTJVXWMJLNJ-YWEYNIOJSA-N |
| Molecular Formula | C10H7NO3 |