Filtered Search Results
| Concentration or Composition (by Analyte or Components) | 3, 7-Bis(dimethylamino)phenothiazin-5-ium chloride hydrate: 1.0%; Water: 99% |
|---|---|
| CAS | 7732-18-5 |
| MDL Number | MFCD00012111 |
| Physical Form | Liquid |
| Solubility Information | Miscible with ethanol,chloroform,glacial acetic acid and glycerol. Slightly miscible with pyridine. Immiscible with ethyl ether,xylene,oleic acid,ethanol and acetone. |
| Chemical Name or Material | Methylene Blue |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Molecular Formula | C16H18ClN3S |
| Formula Weight | 319.86 |
| Vapor Pressure | 23 hPa (17mm Hg) at 20°C |
| Assay Percent Range | 1% w/v aqueous solution |
Thermo Scientific Chemicals Eriochrome Black T
CAS: 1787-61-7 Molecular Formula: C20H12N3NaO7S Molecular Weight (g/mol): 461.38 MDL Number: MFCD00003935 InChI Key: JHUJLRKQZAPSDP-GXTSIBQPSA-M Synonym: C.I. 14645; Mordant Black 11 PubChem CID: 87355429 SMILES: [Na+].OC1=C2C=CC=CC2=CC=C1N\N=C1/C(=O)C=C(C2=CC(=CC=C12)[N+]([O-])=O)S([O-])(=O)=O
| PubChem CID | 87355429 |
|---|---|
| CAS | 1787-61-7 |
| Molecular Weight (g/mol) | 461.38 |
| MDL Number | MFCD00003935 |
| SMILES | [Na+].OC1=C2C=CC=CC2=CC=C1N\N=C1/C(=O)C=C(C2=CC(=CC=C12)[N+]([O-])=O)S([O-])(=O)=O |
| Synonym | C.I. 14645; Mordant Black 11 |
| InChI Key | JHUJLRKQZAPSDP-GXTSIBQPSA-M |
| Molecular Formula | C20H12N3NaO7S |
Thermo Scientific Chemicals Indigo carmine
CAS: 860-22-0 Molecular Formula: C16H8N2Na2O8S2 Molecular Weight (g/mol): 466.35 MDL Number: MFCD00005723 InChI Key: KHLVKKOJDHCJMG-QDBORUFSSA-L Synonym: indigo carmine,indigocarmine,acid blue 74,indigocarmin,indigotindisulfonate sodium,c.i. acid blue 74,food blue no. 2,amacid brilliant blue,c.i. food blue 1,fd&c blue no. 2 PubChem CID: 5284351 SMILES: [Na+].[Na+].[O-]S(=O)(=O)C1=CC=C2N\C(C(=O)C2=C1)=C1\NC2=CC=C(C=C2C1=O)S([O-])(=O)=O
| PubChem CID | 5284351 |
|---|---|
| CAS | 860-22-0 |
| Molecular Weight (g/mol) | 466.35 |
| MDL Number | MFCD00005723 |
| SMILES | [Na+].[Na+].[O-]S(=O)(=O)C1=CC=C2N\C(C(=O)C2=C1)=C1\NC2=CC=C(C=C2C1=O)S([O-])(=O)=O |
| Synonym | indigo carmine,indigocarmine,acid blue 74,indigocarmin,indigotindisulfonate sodium,c.i. acid blue 74,food blue no. 2,amacid brilliant blue,c.i. food blue 1,fd&c blue no. 2 |
| InChI Key | KHLVKKOJDHCJMG-QDBORUFSSA-L |
| Molecular Formula | C16H8N2Na2O8S2 |
Thermo Scientific Chemicals Phenolphthalein, 98%
CAS: 77-09-8 Molecular Formula: C20H14O4 Molecular Weight (g/mol): 318.33 MDL Number: MFCD00005913 InChI Key: KJFMBFZCATUALV-UHFFFAOYSA-N Synonym: phenolphthalein,phthalimetten,euchessina,phthalin,espotabs,phenolax,purgophen,koprol,laxogen,trilax PubChem CID: 4764 ChEBI: CHEBI:34914 SMILES: OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1
| PubChem CID | 4764 |
|---|---|
| CAS | 77-09-8 |
| Molecular Weight (g/mol) | 318.33 |
| ChEBI | CHEBI:34914 |
| MDL Number | MFCD00005913 |
| SMILES | OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 |
| Synonym | phenolphthalein,phthalimetten,euchessina,phthalin,espotabs,phenolax,purgophen,koprol,laxogen,trilax |
| InChI Key | KJFMBFZCATUALV-UHFFFAOYSA-N |
| Molecular Formula | C20H14O4 |
Thermo Scientific Chemicals Bromophenol Blue
CAS: 115-39-9 Molecular Formula: C19H10Br4O5S Molecular Weight (g/mol): 669.96 MDL Number: MFCD00005875 InChI Key: UDSAIICHUKSCKT-UHFFFAOYSA-N Synonym: Bromphenol Blue PubChem CID: 8272 ChEBI: CHEBI:59424 IUPAC Name: 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol SMILES: C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br
| PubChem CID | 8272 |
|---|---|
| CAS | 115-39-9 |
| Molecular Weight (g/mol) | 669.96 |
| ChEBI | CHEBI:59424 |
| MDL Number | MFCD00005875 |
| SMILES | C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br |
| Synonym | Bromphenol Blue |
| IUPAC Name | 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol |
| InChI Key | UDSAIICHUKSCKT-UHFFFAOYSA-N |
| Molecular Formula | C19H10Br4O5S |
Thermo Scientific Chemicals Basic Fuchsin
CAS: 632-99-5 Molecular Formula: C20H20ClN3 Molecular Weight (g/mol): 337.85 MDL Number: MFCD00012569 InChI Key: AXDJCCTWPBKUKL-UHFFFAOYSA-N Synonym: basic violet 14,fuchsin,fuchsin basic,magenta,rosaniline,fuchsine,basic fuchsine,basic magenta,rose aniline,fuchsin, basic PubChem CID: 12447 IUPAC Name: 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydrochloride SMILES: [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1
| PubChem CID | 12447 |
|---|---|
| CAS | 632-99-5 |
| Molecular Weight (g/mol) | 337.85 |
| MDL Number | MFCD00012569 |
| SMILES | [H+].[Cl-].CC1=CC(C=CC1=N)=C(C1=CC=C(N)C=C1)C1=CC=C(N)C=C1 |
| Synonym | basic violet 14,fuchsin,fuchsin basic,magenta,rosaniline,fuchsine,basic fuchsine,basic magenta,rose aniline,fuchsin, basic |
| IUPAC Name | 4-[(4-aminophenyl)-(4-imino-3-methylcyclohexa-2,5-dien-1-ylidene)methyl]aniline;hydrochloride |
| InChI Key | AXDJCCTWPBKUKL-UHFFFAOYSA-N |
| Molecular Formula | C20H20ClN3 |
Thermo Scientific Chemicals Rose Bengal
CAS: 632-69-9 Molecular Formula: C20H4Cl4I4Na2O5 Molecular Weight (g/mol): 1019.644 MDL Number: MFCD00151169 InChI Key: DPBQSRZQYAYDGY-UHFFFAOYSA-N Synonym: rose bengal disodium salt,r105 sodium,rose bengal sodium,rose-bengal 131 i natrium,food red no. 105, sodium salt,food red color no. 105, sodium salt,rosa bengala sodica 131 i inn-spanish,rose bengale 131 i sodique inn-french,sel disodique de rose bengale iodee 131 i,roseum bengalense 131 i natricum inn-latin PubChem CID: 87244310 IUPAC Name: sodium;4,5,6,7-tetrachloro-3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one SMILES: C1=C2C(=C(C(=C1I)O)I)OC3=C(C(=C(C=C3C24C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)O4)I)O)I.[Na].[Na]
| PubChem CID | 87244310 |
|---|---|
| CAS | 632-69-9 |
| Molecular Weight (g/mol) | 1019.644 |
| MDL Number | MFCD00151169 |
| SMILES | C1=C2C(=C(C(=C1I)O)I)OC3=C(C(=C(C=C3C24C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)O4)I)O)I.[Na].[Na] |
| Synonym | rose bengal disodium salt,r105 sodium,rose bengal sodium,rose-bengal 131 i natrium,food red no. 105, sodium salt,food red color no. 105, sodium salt,rosa bengala sodica 131 i inn-spanish,rose bengale 131 i sodique inn-french,sel disodique de rose bengale iodee 131 i,roseum bengalense 131 i natricum inn-latin |
| IUPAC Name | sodium;4,5,6,7-tetrachloro-3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChI Key | DPBQSRZQYAYDGY-UHFFFAOYSA-N |
| Molecular Formula | C20H4Cl4I4Na2O5 |
Thermo Scientific Chemicals Bromocresol Green
CAS: 76-60-8 Molecular Formula: C21H14Br4O5S Molecular Weight (g/mol): 698.014 MDL Number: MFCD00005874 InChI Key: FRPHFZCDPYBUAU-UHFFFAOYSA-N Synonym: Bromcresol Green PubChem CID: 6451 IUPAC Name: 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxy-2-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-3-methylphenol SMILES: CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)O)Br)Br)O)Br
| PubChem CID | 6451 |
|---|---|
| CAS | 76-60-8 |
| Molecular Weight (g/mol) | 698.014 |
| MDL Number | MFCD00005874 |
| SMILES | CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)O)Br)Br)O)Br |
| Synonym | Bromcresol Green |
| IUPAC Name | 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxy-2-methylphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]-3-methylphenol |
| InChI Key | FRPHFZCDPYBUAU-UHFFFAOYSA-N |
| Molecular Formula | C21H14Br4O5S |
Sulforhodamine B sodium salt
CAS: 3520-42-1 Molecular Formula: C29H33N2NaO7S2 Molecular Weight (g/mol): 608.70 MDL Number: MFCD00010180 InChI Key: XJENLUNLXRJLEZ-UHFFFAOYSA-M Synonym: C.I. 45100; Kiton Red S PubChem CID: 131852807 IUPAC Name: 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-sulfobenzenesulfonate;sodium SMILES: [Na+].CCN(CC)C1=CC2=[O+]C3=CC(N(CC)CC)=C(C)C=C3C(C3=CC=C(C=C3S([O-])(=O)=O)S([O-])(=O)=O)=C2C=C1C
| PubChem CID | 131852807 |
|---|---|
| CAS | 3520-42-1 |
| Molecular Weight (g/mol) | 608.70 |
| MDL Number | MFCD00010180 |
| SMILES | [Na+].CCN(CC)C1=CC2=[O+]C3=CC(N(CC)CC)=C(C)C=C3C(C3=CC=C(C=C3S([O-])(=O)=O)S([O-])(=O)=O)=C2C=C1C |
| Synonym | C.I. 45100; Kiton Red S |
| IUPAC Name | 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-sulfobenzenesulfonate;sodium |
| InChI Key | XJENLUNLXRJLEZ-UHFFFAOYSA-M |
| Molecular Formula | C29H33N2NaO7S2 |
Tartrazine
CAS: 1934-21-0 Molecular Formula: C16H9N4Na3O9S2 Molecular Weight (g/mol): 534.356 MDL Number: MFCD00148908 InChI Key: UJMBCXLDXJUMFB-UHFFFAOYSA-K Synonym: tartrazine,yellow 5,aizen tartrazine,trisodium salt,food yellow 4,tartrazine FD&C yellow #5,c.i. acid yellow 23,atul tartrazine,erio tartrazine,kako tartrazine PubChem CID: 164825 IUPAC Name: trisodium;5-oxo-1-(4-sulfonatophenyl)-4-[(4-sulfonatophenyl)diazenyl]-4H-pyrazole-3-carboxylate SMILES: C1=CC(=CC=C1N=NC2C(=NN(C2=O)C3=CC=C(C=C3)S(=O)(=O)[O-])C(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+].[Na+]
| PubChem CID | 164825 |
|---|---|
| CAS | 1934-21-0 |
| Molecular Weight (g/mol) | 534.356 |
| MDL Number | MFCD00148908 |
| SMILES | C1=CC(=CC=C1N=NC2C(=NN(C2=O)C3=CC=C(C=C3)S(=O)(=O)[O-])C(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+].[Na+] |
| Synonym | tartrazine,yellow 5,aizen tartrazine,trisodium salt,food yellow 4,tartrazine FD&C yellow #5,c.i. acid yellow 23,atul tartrazine,erio tartrazine,kako tartrazine |
| IUPAC Name | trisodium;5-oxo-1-(4-sulfonatophenyl)-4-[(4-sulfonatophenyl)diazenyl]-4H-pyrazole-3-carboxylate |
| InChI Key | UJMBCXLDXJUMFB-UHFFFAOYSA-K |
| Molecular Formula | C16H9N4Na3O9S2 |
Thermo Scientific Chemicals Direct Red 80
CAS: 2610-10-8 MDL Number: MFCD00054389 Synonym: C.I. 35780; Sirius Red
| CAS | 2610-10-8 |
|---|---|
| MDL Number | MFCD00054389 |
| Synonym | C.I. 35780; Sirius Red |
Bromothymol Blue sodium salt, 0.04% w/v aq. soln.
CAS: 34722-90-2 Molecular Formula: C27H27Br2NaO5S Molecular Weight (g/mol): 646.37 MDL Number: MFCD00077263,MFCD00077263,MFCD00077263 InChI Key: NMKFVGALBGZKGW-FKWCIMQXSA-M PubChem CID: 102183223 SMILES: [Na+].CC(C)C1=CC(\C(C2=CC=CC=C2S([O-])(=O)=O)=C2/C=C(C(C)C)C(=O)C(Br)=C2C)=C(C)C(Br)=C1O
| PubChem CID | 102183223 |
|---|---|
| CAS | 34722-90-2 |
| Molecular Weight (g/mol) | 646.37 |
| MDL Number | MFCD00077263,MFCD00077263,MFCD00077263 |
| SMILES | [Na+].CC(C)C1=CC(\C(C2=CC=CC=C2S([O-])(=O)=O)=C2/C=C(C(C)C)C(=O)C(Br)=C2C)=C(C)C(Br)=C1O |
| InChI Key | NMKFVGALBGZKGW-FKWCIMQXSA-M |
| Molecular Formula | C27H27Br2NaO5S |
Thermo Scientific Chemicals Safranine O
CAS: 477-73-6 Molecular Formula: C20H19ClN4 Molecular Weight (g/mol): 350.85 MDL Number: MFCD00011759 InChI Key: QRYAEWIQIBAZOJ-UHFFFAOYSA-N Synonym: basic red 2,safranine o,gossypimine,safranin,safranine t,safranin o,safranin t,safranine,tolusafranine,hidaco safranine PubChem CID: 2723800 IUPAC Name: 3,7-dimethyl-10-phenylphenazin-10-ium-2,8-diamine;chloride SMILES: [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1
| PubChem CID | 2723800 |
|---|---|
| CAS | 477-73-6 |
| Molecular Weight (g/mol) | 350.85 |
| MDL Number | MFCD00011759 |
| SMILES | [Cl-].CC1=C(N)C=C2C(=C1)N=C1C(C)=C(N)C=CC1=[N+]2C1=CC=CC=C1 |
| Synonym | basic red 2,safranine o,gossypimine,safranin,safranine t,safranin o,safranin t,safranine,tolusafranine,hidaco safranine |
| IUPAC Name | 3,7-dimethyl-10-phenylphenazin-10-ium-2,8-diamine;chloride |
| InChI Key | QRYAEWIQIBAZOJ-UHFFFAOYSA-N |
| Molecular Formula | C20H19ClN4 |
Thermo Scientific Chemicals Fluorescein
CAS: 2321-07-5 Molecular Formula: C20H12O5 Molecular Weight (g/mol): 332.31 MDL Number: MFCD00005050 InChI Key: GNBHRKFJIUUOQI-UHFFFAOYSA-N Synonym: fluorescein,solvent yellow 94,resorcinolphthalein,yellow fluorescein,3,6-fluorandiol,d and c yellow no. 7,fluoresceine,japan yellow 201,c.i. solvent yellow 94,d&c yellow no. 7 PubChem CID: 16850 ChEBI: CHEBI:31624 IUPAC Name: 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one SMILES: C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O
| PubChem CID | 16850 |
|---|---|
| CAS | 2321-07-5 |
| Molecular Weight (g/mol) | 332.31 |
| ChEBI | CHEBI:31624 |
| MDL Number | MFCD00005050 |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
| Synonym | fluorescein,solvent yellow 94,resorcinolphthalein,yellow fluorescein,3,6-fluorandiol,d and c yellow no. 7,fluoresceine,japan yellow 201,c.i. solvent yellow 94,d&c yellow no. 7 |
| IUPAC Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChI Key | GNBHRKFJIUUOQI-UHFFFAOYSA-N |
| Molecular Formula | C20H12O5 |
o-Cresolphthalein
CAS: 596-27-0 Molecular Formula: C22H18O4 Molecular Weight (g/mol): 346.38 MDL Number: MFCD00005912 InChI Key: CPBJMKMKNCRKQB-UHFFFAOYSA-N Synonym: o-cresolphthalein,cresolphthalein,3,3'-dimethylphenolphthalein,1 3h-isobenzofuranone, 3,3-bis 4-hydroxy-3-methylphenyl,3',3-dimethylphenolphthalein,o-cresolphalein,3,3-bis 4-hydroxy-3-methylphenyl isobenzofuran-1 3h-one,unii-xou2d9049g,phenolphthalein, 3',3-dimethyl,3,3-bis 4-hydroxy-m-tolyl phthalide PubChem CID: 68995 SMILES: CC1=CC(=CC=C1O)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C(C)=C1
| PubChem CID | 68995 |
|---|---|
| CAS | 596-27-0 |
| Molecular Weight (g/mol) | 346.38 |
| MDL Number | MFCD00005912 |
| SMILES | CC1=CC(=CC=C1O)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C(C)=C1 |
| Synonym | o-cresolphthalein,cresolphthalein,3,3'-dimethylphenolphthalein,1 3h-isobenzofuranone, 3,3-bis 4-hydroxy-3-methylphenyl,3',3-dimethylphenolphthalein,o-cresolphalein,3,3-bis 4-hydroxy-3-methylphenyl isobenzofuran-1 3h-one,unii-xou2d9049g,phenolphthalein, 3',3-dimethyl,3,3-bis 4-hydroxy-m-tolyl phthalide |
| InChI Key | CPBJMKMKNCRKQB-UHFFFAOYSA-N |
| Molecular Formula | C22H18O4 |