Learn More
1-Chloro-2-nitrobenzene, 99+%, ACROS Organics™
Brand: Acros Organics 109621000
Additional Details : CAS : 88-73-3 Weight : 0.18480kg Transport : UN number : 1578 Chem class : 6.1 Pack group : II
| Quantity | 100mL |
|---|
Chemical Identifiers
| 88-73-3 | |
| 157.56 | |
| BFCFYVKQTRLZHA-UHFFFAOYSA-N | |
| 6945 | |
| 1-chloro-2-nitrobenzene |
| C6H4ClNO2 | |
| MFCD00007061 | |
| 2-chloronitrobenzene, o-chloronitrobenzene, 2-nitrochlorobenzene, chloronitrobenzene, o-nitrochlorobenzene, benzene, 1-chloro-2-nitro, 2-chloro-1-nitrobenzene, oncb, benzene, chloronitro, nitrochlorobenzene | |
| CHEBI:34270 | |
| C1=CC=C(C(=C1)[N+](=O)[O-])Cl |
Specifications
| 1-Chloro-2-nitrobenzene | |
| 124°C | |
| Glass bottle | |
| 246°C | |
| 32°C to 34°C | |
| 99+% | |
| 99.0 | |
| 99+% | |
| ClC6H4NO2 | |
| 05, 241 | |
| 2-chloronitrobenzene, o-chloronitrobenzene, 2-nitrochlorobenzene, chloronitrobenzene, o-nitrochlorobenzene, benzene, 1-chloro-2-nitro, 2-chloro-1-nitrobenzene, oncb, benzene, chloronitro, nitrochlorobenzene | |
| BFCFYVKQTRLZHA-UHFFFAOYSA-N | |
| 1-chloro-2-nitrobenzene | |
| 6945 | |
| 157.56 | |
| 99+% |
| 1.3480g/mL | |
| Authentic | |
| 1.348 | |
| Yellow | |
| 100mL | |
| 88-73-3 | |
| 100.0 | |
| C6H4ClNO2 | |
| MFCD00007061 | |
| 15, 2153 | |
| Solubility in water: 0.43g/L water (20°C).,soluble in alcohol,benzene,ether,acetone,carbo,toluene,pyridine | |
| C1=CC=C(C(=C1)[N+](=O)[O-])Cl | |
| 157.56 | |
| CHEBI:34270 | |
| Fused Crystalline Mass |
Safety and Handling
- 1-Chloro-2-nitrobenzene
Signal Word
- Danger
Hazard Category
- Acute toxicity Category 3
- Acute toxicity Category 4
- LONG-TERM AQUATIC HAZARD Chronic 3
Hazard Statement
- H311-Toxic in contact with skin.
- H412-Harmful to aquatic life with long lasting effects.
- H302-Harmful if swallowed.
Precautionary Statement
- P273-Avoid release to the environment.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P301+P312-IF SWALLOWED: Call a POISON CENTER or doctor/physician/ if you feel unwell.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P312-Call a POISON CENTER/doctor/if you feel unwell.