Learn More
α,α,α-Trifluoroacetophenone, 99%, ACROS Organics™
Brand: Acros Organics 148350050
Additional Details : CAS : 434-45-7 Weight : 0.05500kg Transport : UN number : 1993 Chem class : 3 Pack group : III
| Packaging | Glass bottle |
|---|---|
| Quantity | 5g |
Chemical Identifiers
| 434-45-7 | |
| 174.12 | |
| KZJRKRQSDZGHEC-UHFFFAOYSA-N | |
| 9905 | |
| C1=CC=C(C=C1)C(=O)C(F)(F)F |
| C8H5F3O | |
| MFCD00000420 | |
| trifluoroacetophenone, 2,2,2-trifluoroacetophenone, 2,2,2-trifluoro-1-phenylethan-1-one, phenyl trifluoromethyl ketone, trifluoromethyl phenyl ketone, alpha,alpha,alpha-trifluoroacetophenone, ethanone, 2,2,2-trifluoro-1-phenyl, 2,2,2-trifluoro-1-phenyl-ethanone, trifluoroacetylbenzene, unii-6t7l1upy09 | |
| 2,2,2-trifluoro-1-phenylethanone |
Specifications
| α, α, α-Trifluoroacetophenone | |
| 41°C | |
| Glass bottle | |
| 1.24 | |
| Colorless to Yellow | |
| 5g | |
| 98.5 | |
| 98.5% min. (GC) | |
| C6H5COCF3 | |
| 01,1226; 03,308 | |
| Solubility in water: insoluble | |
| C1=CC=C(C=C1)C(=O)C(F)(F)F | |
| 174.12 | |
| 174.12 | |
| 99% |
| 1.2400g/mL | |
| Authentic | |
| 1.4580 to 1.4600 | |
| 165.0°C to 166.0°C | |
| -40.0°C | |
| 434-45-7 | |
| 100.0 | |
| C8H5F3O | |
| MFCD00000420 | |
| trifluoroacetophenone, 2,2,2-trifluoroacetophenone, 2,2,2-trifluoro-1-phenylethan-1-one, phenyl trifluoromethyl ketone, trifluoromethyl phenyl ketone, alpha,alpha,alpha-trifluoroacetophenone, ethanone, 2,2,2-trifluoro-1-phenyl, 2,2,2-trifluoro-1-phenyl-ethanone, trifluoroacetylbenzene, unii-6t7l1upy09 | |
| KZJRKRQSDZGHEC-UHFFFAOYSA-N | |
| 2,2,2-trifluoro-1-phenylethanone | |
| 9905 | |
| Liquid |