Learn More
Bis(2-diphenylphosphinoethyl)phenylphosphine, 97%, ACROS Organics™
Brand: Acros Organics 316820010
Additional Details : CAS : 23582-02-7 Weight : 0.05100kg
Packaging | Glass bottle |
---|---|
Quantity | 1g |
Chemical Identifiers
23582-02-7 | |
534.56 | |
AXVOAMVQOCBPQT-UHFFFAOYSA-N | |
90192 | |
C1=CC=C(C=C1)P(CCP(C2=CC=CC=C2)C3=CC=CC=C3)CCP(C4=CC=CC=C4)C5=CC=CC=C5 |
C34H33P3 | |
MFCD00003048 | |
bis 2-diphenylphosphinoethyl phenylphosphine, phenylphosphinediyl bis ethane-2,1-diyl bis diphenylphosphine, bis 2-diphenylphosphino ethyl phenylphosphine, phosphine, bis 2-diphenylphosphino ethyl phenyl, phenylbis diphenylphosphinoethyl phosphine, pubchem6540, acmc-20alo6, chembl69711, bis 2-biphenylphosphinoethyl phenylphosphine | |
bis(2-diphenylphosphanylethyl)-phenylphosphane |
Specifications
Bis(2-diphenylphosphinoethyl)phenylphosphine | |
Authentic | |
White | |
1g | |
96.0 | |
97% | |
MFCD00003048 | |
Solubility in water: insoluble | |
C1=CC=C(C=C1)P(CCP(C2=CC=CC=C2)C3=CC=CC=C3)CCP(C4=CC=CC=C4)C5=CC=CC=C5 | |
534.56 | |
534.56 | |
97% |
74.1 to 78.7% (C) | |
Glass bottle | |
121.0°C to 126.0°C | |
23582-02-7 | |
100.0 | |
C34H33P3 | |
bis 2-diphenylphosphinoethyl phenylphosphine, phenylphosphinediyl bis ethane-2,1-diyl bis diphenylphosphine, bis 2-diphenylphosphino ethyl phenylphosphine, phosphine, bis 2-diphenylphosphino ethyl phenyl, phenylbis diphenylphosphinoethyl phosphine, pubchem6540, acmc-20alo6, chembl69711, bis 2-biphenylphosphinoethyl phenylphosphine | |
AXVOAMVQOCBPQT-UHFFFAOYSA-N | |
bis(2-diphenylphosphanylethyl)-phenylphosphane | |
90192 | |
Powder and/or Chunks |