Learn More
Dimethyl terephthalate, 99%, ACROS Organics™
Brand: Acros Organics 180580010
Additional Details : CAS : 120-61-6 Weight : 1.05000kg
| Packaging | Plastic bottle |
|---|---|
| Quantity | 1kg |
Chemical Identifiers
| 120-61-6 | |
| 194.19 | |
| WOZVHXUHUFLZGK-UHFFFAOYSA-N | |
| 8441 | |
| COC(=O)C1=CC=C(C=C1)C(=O)OC |
| C10H10O4 | |
| MFCD00008440 | |
| dimethyl terephthalate, dimethyl p-phthalate, 1,4-benzenedicarboxylic acid, dimethyl ester, dimethyl p-benzenedicarboxylate, di-me terephthalate, dimethyl 4-phthalate, terephthalic acid, dimethyl ester, dimethyl 1,4-benzenedicarboxylate, terephthalic acid dimethyl ester, methyl p-methoxycarbonyl benzoate | |
| 1,4-dimethyl benzene-1,4-dicarboxylate |
Specifications
| 0.03mg KOH/g max. | |
| 154°C | |
| Plastic bottle | |
| 288°C | |
| 140°C to 143°C | |
| 99% | |
| 98.5% min. (GC) | |
| MFCD00008440 | |
| 15, 9305 | |
| Solubility in water: 0.036g/L (20°C). Other solubilities: soluble in ether and hot alcohol | |
| COC(=O)C1=CC=C(C=C1)C(=O)OC | |
| 194.19 | |
| 194.19 | |
| 99% |
| Dimethyl terephthalate | |
| Authentic | |
| 285.0 °C | |
| White | |
| 1kg | |
| 120-61-6 | |
| C10H10O4 | |
| 09, 843 | |
| dimethyl terephthalate, dimethyl p-phthalate, 1,4-benzenedicarboxylic acid, dimethyl ester, dimethyl p-benzenedicarboxylate, di-me terephthalate, dimethyl 4-phthalate, terephthalic acid, dimethyl ester, dimethyl 1,4-benzenedicarboxylate, terephthalic acid dimethyl ester, methyl p-methoxycarbonyl benzoate | |
| WOZVHXUHUFLZGK-UHFFFAOYSA-N | |
| 1,4-dimethyl benzene-1,4-dicarboxylate | |
| 8441 | |
| Flakes or Pellets |