Learn More
Dimethyl terephthalate, 99%, ACROS Organics™
Brand: Acros Organics 180580010
Additional Details : CAS : 120-61-6 Weight : 1.05000kg
Packaging | Plastic bottle |
---|---|
Quantity | 1kg |
Chemical Identifiers
120-61-6 | |
194.19 | |
WOZVHXUHUFLZGK-UHFFFAOYSA-N | |
8441 | |
COC(=O)C1=CC=C(C=C1)C(=O)OC |
C10H10O4 | |
MFCD00008440 | |
dimethyl terephthalate, dimethyl p-phthalate, 1,4-benzenedicarboxylic acid, dimethyl ester, dimethyl p-benzenedicarboxylate, di-me terephthalate, dimethyl 4-phthalate, terephthalic acid, dimethyl ester, dimethyl 1,4-benzenedicarboxylate, terephthalic acid dimethyl ester, methyl p-methoxycarbonyl benzoate | |
dimethyl benzene-1,4-dicarboxylate |
Specifications
0.03mg KOH/g max. | |
154°C | |
Plastic bottle | |
288°C | |
140°C to 143°C | |
99% | |
98.5% min. (GC) | |
MFCD00008440 | |
15, 9305 | |
Solubility in water: 0.036g/L (20°C). Other solubilities: soluble in ether and hot alcohol | |
COC(=O)C1=CC=C(C=C1)C(=O)OC | |
194.19 | |
194.19 | |
99% |
Dimethyl terephthalate | |
Authentic | |
285.0 °C | |
White | |
1kg | |
120-61-6 | |
C10H10O4 | |
09, 843 | |
dimethyl terephthalate, dimethyl p-phthalate, 1,4-benzenedicarboxylic acid, dimethyl ester, dimethyl p-benzenedicarboxylate, di-me terephthalate, dimethyl 4-phthalate, terephthalic acid, dimethyl ester, dimethyl 1,4-benzenedicarboxylate, terephthalic acid dimethyl ester, methyl p-methoxycarbonyl benzoate | |
WOZVHXUHUFLZGK-UHFFFAOYSA-N | |
dimethyl benzene-1,4-dicarboxylate | |
8441 | |
Flakes or Pellets |