Learn More
Gluconic Acid, 50 wt. % Solution in Water, ACROS Organics™
Brand: Acros Organics 119890010
Additional Details : CAS : 526-95-4 Weight : 1.28000kg
Packaging | Glass bottle |
---|---|
Quantity | 1L |
Chemical Identifiers
526-95-4 | |
196.155 | |
RGHNJXZEOKUKBD-SQOUGZDYSA-N | |
10690 | |
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
C6H12O7 | |
MFCD00004240 | |
gluconic acid, d-gluconic acid, dextronic acid, maltonic acid, glycogenic acid, glosanto, gluconate, pentahydroxycaproic acid, gluconic acid, d, d-gluconate | |
CHEBI:33198 | |
C(C(C(C(C(C(=O)O)O)O)O)O)O |
Specifications
Gluconic acid | |
C6H12O7 | |
1000ppm max. | |
15, 4492 | |
1.23g/mL | |
C(C(C(C(C(C(=O)O)O)O)O)O)O | |
196.155 | |
CHEBI:33198 | |
Crystalline Powder or Crystals | |
10ppm max. | |
3% max. | |
1.22 to 1.25 (20°C) | |
White to Yellow |
7732-18-5 | |
MFCD00004240 | |
03, 542 | |
gluconic acid, d-gluconic acid, dextronic acid, maltonic acid, glycogenic acid, glosanto, gluconate, pentahydroxycaproic acid, gluconic acid, d, d-gluconate | |
RGHNJXZEOKUKBD-SQOUGZDYSA-N | |
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid | |
10690 | |
196.16 | |
49 to 55% (Titrimetry other) | |
Glass bottle | |
3 % max. | |
1000ppm max. | |
1L |