Learn More
Glycerine trioleate, 99%, Thermo Scientific™
Brand: Thermo Scientific Acros 368120250
Additional Details : CAS : 122-32-7 Weight : 0.07282kg
| Quantity | 25mL |
|---|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 122-32-7 | |
| 885.45 | |
| PHYFQTYBJUILEZ-BSCDBXJPSA-N | |
| 45253964 | |
| CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC |
| C57H104O6 | |
| MFCD00137563 | |
| triolein, glycerol trioleate, glyceryl trioleate, oleic triglyceride, trioleoylglycerol, glycerol triolein, oleic acid triglyceride, trioleoylglyceride, olein, glycerin trioleate | |
| [2-[(Z)-octadec-9-enoyl]oxy-3-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate |
Specifications
| Glycerine trioleate | |
| 0.9130g/mL | |
| 235.0°C to 240.0°C (18.0mmHg) | |
| Authentic | |
| (C17H33COOCH2)2CHOCOC17H33 | |
| 02,IV,1664 | |
| 15,9904 | |
| triolein, glycerol trioleate, glyceryl trioleate, oleic triglyceride, trioleoylglycerol, glycerol triolein, oleic acid triglyceride, trioleoylglyceride, olein, glycerin trioleate | |
| Solubility in water: insoluble in water. Other solubilities: soluble in chloroform, ether, ccl4, slightly soluble in alcohol | |
| 0.913 | |
| [2-[(Z)-octadec-9-enoyl]oxy-3-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate | |
| 45253964 | |
| Liquid |
| 122-32-7 | |
| Colorless to Yellow | |
| 98.5% min. (GC) | |
| C57H104O6 | |
| MFCD00137563 | |
| Glass bottle | |
| 1.4680 to 1.4700 | |
| 25mL | |
| PHYFQTYBJUILEZ-BSCDBXJPSA-N | |
| CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
| 885.45 | |
| 885.45 | |
| 99% |
RUO – Research Use Only