Learn More
Sodium cyclamate, 99%, ACROS Organics™
Brand: Acros Organics 389280010
Additional Details : CAS : 139-05-9 Weight : 1.05000kg
Packaging | Plastic bottle |
---|---|
Quantity | 1kg |
Chemical Identifiers
139-05-9 | |
201.22 | |
UDIPTWFVPPPURJ-UHFFFAOYSA-M | |
23665706 | |
sodium;N-cyclohexylsulfamate |
C6H12NNaO3S | |
MFCD00003827 | |
sodium cyclamate, sodium cyclohexylsulfamate, sodium n-cyclohexylsulfamate, cyclamate sodium, cyclamic acid sodium salt, assugrin, ibiosuc, suessette, suestamin, sugarin | |
CHEBI:82431 | |
C1CCC(CC1)NS(=O)(=O)[O-].[Na+] |
Specifications
Sodium cyclamate | |
Authentic | |
Plastic bottle | |
White | |
5.5 to 7.5 (10% soln.) | |
99% | |
C6H12NNaO3S | |
sodium cyclamate, sodium cyclohexylsulfamate, sodium n-cyclohexylsulfamate, cyclamate sodium, cyclamic acid sodium salt, assugrin, ibiosuc, suessette, suestamin, sugarin | |
UDIPTWFVPPPURJ-UHFFFAOYSA-M | |
sodium;N-cyclohexylsulfamate | |
23665706 | |
201.22 | |
99% |
>200°C | |
1% max. | |
0.1% max | |
1kg | |
139-05-9 | |
C6H12NNaO3S | |
MFCD00003827 | |
Solubility in water: 200g/L (20°C). Other solubilities: insoluble in ether and benzene | |
C1CCC(CC1)NS(=O)(=O)[O-].[Na+] | |
201.22 | |
CHEBI:82431 | |
Powder |
Safety and Handling
- Sodium cyclamate
Signal Word
- Warning
Hazard Category
- Acute toxicity Category 4
Hazard Statement
- H302-Harmful if swallowed.
Precautionary Statement
- P301+P312-IF SWALLOWED: Call a POISON CENTER or doctor/physician/ if you feel unwell.