Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Sodium Chloride, Extra Pure, SLR, Fisher Chemical™
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Sodium chloride, Puriss. p.a., ACS Reagent, Reag. ISO, Reag. Ph. Eur., ≥99.5%, Honeywell Fluka™
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Calcium chloride dihydrate, 99+%, ACS reagent
CAS: 10035-04-8 Molecular Formula: CaCl2·2H2O Molecular Weight (g/mol): 147.02 MDL Number: MFCD00149613
| CAS | 10035-04-8 |
|---|---|
| Molecular Weight (g/mol) | 147.02 |
| MDL Number | MFCD00149613 |
| Molecular Formula | CaCl2·2H2O |
Sodium Chloride, Certified AR for Analysis, meets analytical specification of Ph.Eur, Fisher Chemical™
ClNa, CAS Number-7647-14-5, saline, table salt, salt, sodium chloride, common salt, rock salt, dendritis, halite, sodium chloride nacl, purex, 1kg, 1461 deg.C, CHEBI:26710, White, 58.44g/mol, FAPWRFPIFSIZLT-UHFFFAOYSA-M, sodium;chloride, 801 deg.C, 3477, Plastic powder jar, 5.0 to 8.0, Solid, 5234 | CAS: 7647-14-5 | ClNa | 58.44 g/mol
Potassium chloride, 99%
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M Synonym: potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs PubChem CID: 4873 ChEBI: CHEBI:32588 IUPAC Name: potassium chloride SMILES: [Cl-].[K+]
| PubChem CID | 4873 |
|---|---|
| CAS | 7447-40-7 |
| Molecular Weight (g/mol) | 74.55 |
| ChEBI | CHEBI:32588 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| Synonym | potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs |
| IUPAC Name | potassium chloride |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |
Sodium phosphate, dibasic, 99+%, for analysis, anhydrous
CAS: 7558-79-4 Molecular Formula: HNa2O4P Molecular Weight (g/mol): 141.96 MDL Number: MFCD00003496 InChI Key: BNIILDVGGAEEIG-UHFFFAOYSA-L Synonym: disodium hydrogen phosphate,disodium phosphate,disodium hydrogenorthophosphate,sodium phosphate dibasic,dibasic sodium phosphate,acetest,soda phosphate,disodium orthophosphate,sodium hydrogen phosphate,phosphoric acid, disodium salt PubChem CID: 24203 ChEBI: CHEBI:34683 SMILES: [Na+].[Na+].OP([O-])([O-])=O
| PubChem CID | 24203 |
|---|---|
| CAS | 7558-79-4 |
| Molecular Weight (g/mol) | 141.96 |
| ChEBI | CHEBI:34683 |
| MDL Number | MFCD00003496 |
| SMILES | [Na+].[Na+].OP([O-])([O-])=O |
| Synonym | disodium hydrogen phosphate,disodium phosphate,disodium hydrogenorthophosphate,sodium phosphate dibasic,dibasic sodium phosphate,acetest,soda phosphate,disodium orthophosphate,sodium hydrogen phosphate,phosphoric acid, disodium salt |
| InChI Key | BNIILDVGGAEEIG-UHFFFAOYSA-L |
| Molecular Formula | HNa2O4P |
Ethylenediaminetetraacetic acid tetrasodium salt dihydrate, (EDTA), 99-101%, Ultrapure
CAS: 10378-23-1 Molecular Formula: C10H20N2Na4O10 Molecular Weight (g/mol): 420.233 MDL Number: MFCD00150026 InChI Key: DGWOWDJDIBPYOR-UHFFFAOYSA-N Synonym: ethylenediaminetetraacetic acid tetrasodium salt dihydrate,tetrasodium ethylenediaminetetraacetate dihydrate,edta-na4,edta tetrasodium salt,edta tetrasodium salt hydrate,ethylenediaminetetraacetic acid tetrasodium salt hydrate,64-02-8 anhydrous,ksc909a7h,edta tetrasodium salt dihydrate,tetrapotassium ion 4-edta dihydrate PubChem CID: 131843362 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;sodium;dihydrate SMILES: C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O.O.[Na].[Na].[Na].[Na]
| PubChem CID | 131843362 |
|---|---|
| CAS | 10378-23-1 |
| Molecular Weight (g/mol) | 420.233 |
| MDL Number | MFCD00150026 |
| SMILES | C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O.O.O.[Na].[Na].[Na].[Na] |
| Synonym | ethylenediaminetetraacetic acid tetrasodium salt dihydrate,tetrasodium ethylenediaminetetraacetate dihydrate,edta-na4,edta tetrasodium salt,edta tetrasodium salt hydrate,ethylenediaminetetraacetic acid tetrasodium salt hydrate,64-02-8 anhydrous,ksc909a7h,edta tetrasodium salt dihydrate,tetrapotassium ion 4-edta dihydrate |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;sodium;dihydrate |
| InChI Key | DGWOWDJDIBPYOR-UHFFFAOYSA-N |
| Molecular Formula | C10H20N2Na4O10 |
Sodium bisulfite, ACS reagent, powder
CAS: 7631-90-5 Molecular Formula: NaO3S Molecular Weight (g/mol): 103.05 MDL Number: MFCD00003530 InChI Key: DWAQJAXMDSEUJJ-UHFFFAOYSA-L Synonym: sodium bisulfite,sodium hydrogen sulfite,sodium bisulphite,sodium hydrogensulfite,sodium sulfhydrate,monosodium sulfite,uantax sbs,sulfurous acid, monosodium salt,caswell no. 750,hydrogen sodium sulfite PubChem CID: 23665763 ChEBI: CHEBI:26709 IUPAC Name: sodium sulfite SMILES: [Na+].[O-]S([O-])=O
| PubChem CID | 23665763 |
|---|---|
| CAS | 7631-90-5 |
| Molecular Weight (g/mol) | 103.05 |
| ChEBI | CHEBI:26709 |
| MDL Number | MFCD00003530 |
| SMILES | [Na+].[O-]S([O-])=O |
| Synonym | sodium bisulfite,sodium hydrogen sulfite,sodium bisulphite,sodium hydrogensulfite,sodium sulfhydrate,monosodium sulfite,uantax sbs,sulfurous acid, monosodium salt,caswell no. 750,hydrogen sodium sulfite |
| IUPAC Name | sodium sulfite |
| InChI Key | DWAQJAXMDSEUJJ-UHFFFAOYSA-L |
| Molecular Formula | NaO3S |
Aluminum nitrate nonahydrate, 99+%, for analysis
CAS: 7784-27-2 InChI Key: SWCIQHXIXUMHKA-UHFFFAOYSA-N Synonym: aluminum nitrate nonahydrate,aluminum trinitrate nonahydrate,unii-8mc6621v1h,aluminum iii nitrate, nonahydrate 1:3:9,nitric acid aluminum salt,nitric acid, aluminum salt, nonahydrate 8ci,9ci,aluminum nitrate, acs,aluminum 3+ nonahydrate trinitronate,aluminum nitrate nonahydrate, low mercury, puratronic PubChem CID: 24567 IUPAC Name: aluminum;trinitrate;nonahydrate SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.O.O.O.O.O.O.[Al+3]
| PubChem CID | 24567 |
|---|---|
| CAS | 7784-27-2 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.O.O.O.O.O.O.[Al+3] |
| Synonym | aluminum nitrate nonahydrate,aluminum trinitrate nonahydrate,unii-8mc6621v1h,aluminum iii nitrate, nonahydrate 1:3:9,nitric acid aluminum salt,nitric acid, aluminum salt, nonahydrate 8ci,9ci,aluminum nitrate, acs,aluminum 3+ nonahydrate trinitronate,aluminum nitrate nonahydrate, low mercury, puratronic |
| IUPAC Name | aluminum;trinitrate;nonahydrate |
| InChI Key | SWCIQHXIXUMHKA-UHFFFAOYSA-N |
Potassium ferricyanide, 99+%, for analysis
CAS: 13746-66-2 Molecular Formula: C6FeK3N6 Molecular Weight (g/mol): 329.25 MDL Number: MFCD00011392 InChI Key: QMTKJUMXUDIUAQ-UHFFFAOYSA-N Synonym: potassium ferricyanide,red prussiate,potassium ferricyanate,tripotassium hexacyanoferrate,potassium cyanoferrate,iron potassium cyanide,tripotassium ferricyanide,tripotassium iron hexacyanide,tripotassium ferric hexacyanide,ccris 5559 PubChem CID: 26250 SMILES: [K+].[K+].[K+].N#C[Fe+3](C#N)(C#N)(C#N)(C#N)C#N
| PubChem CID | 26250 |
|---|---|
| CAS | 13746-66-2 |
| Molecular Weight (g/mol) | 329.25 |
| MDL Number | MFCD00011392 |
| SMILES | [K+].[K+].[K+].N#C[Fe+3](C#N)(C#N)(C#N)(C#N)C#N |
| Synonym | potassium ferricyanide,red prussiate,potassium ferricyanate,tripotassium hexacyanoferrate,potassium cyanoferrate,iron potassium cyanide,tripotassium ferricyanide,tripotassium iron hexacyanide,tripotassium ferric hexacyanide,ccris 5559 |
| InChI Key | QMTKJUMXUDIUAQ-UHFFFAOYSA-N |
| Molecular Formula | C6FeK3N6 |
Cobalt powder, -22 mesh, Puratronic™, 99.998% (metals basis)
CAS: 7440-48-4 Molecular Formula: Co Molecular Weight (g/mol): 58.93 MDL Number: MFCD00010935 InChI Key: GUTLYIVDDKVIGB-UHFFFAOYSA-N Synonym: kobalt,cobalto,moncation,co1+,cobaltum,powder,cobalt, ion co1+,hydrido,atom,hydride PubChem CID: 104730 ChEBI: CHEBI:27638 IUPAC Name: cobalt SMILES: [Co]
| PubChem CID | 104730 |
|---|---|
| CAS | 7440-48-4 |
| Molecular Weight (g/mol) | 58.93 |
| ChEBI | CHEBI:27638 |
| MDL Number | MFCD00010935 |
| SMILES | [Co] |
| Synonym | kobalt,cobalto,moncation,co1+,cobaltum,powder,cobalt, ion co1+,hydrido,atom,hydride |
| IUPAC Name | cobalt |
| InChI Key | GUTLYIVDDKVIGB-UHFFFAOYSA-N |
| Molecular Formula | Co |
Sodium Hydrogen Carbonate, Certified AR for Analysis, meets analytical specification of Ph.Eur, Fisher Chemical™
CHNaO3, CAS Number-144-55-8, acidosan, baking soda, bicarbonate of soda, carbonic acid monosodium salt, meylon, neut, sodium acid carbonate, sodium bicarbonate, sodium hydrogencarbonate, sodium hydrogen carbonate, 1kg, CHEBI:32139, White, 84.01g/mol, UIIMBOGNXHQVGW-UHFFFAOYSA-M | CAS: 144-55-8 | CHNaO3 | 84.01 g/mol
Kaolin, pure
CAS: 1332-58-7 Molecular Formula: Al2H4O9Si2 Molecular Weight (g/mol): 258.16 MDL Number: MFCD00062311 InChI Key: NLYAJNPCOHFWQQ-UHFFFAOYSA-N Synonym: kaolin,china clay,argilla,glomax,porcelain clay,bolus alba,white bole,hydrated aluminum silicate,kaolin clay slurry,alphagloss PubChem CID: 56841936 IUPAC Name: oxo-oxoalumanyloxy-[oxo(oxoalumanyloxy)silyl]oxysilane;dihydrate SMILES: O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O
| PubChem CID | 56841936 |
|---|---|
| CAS | 1332-58-7 |
| Molecular Weight (g/mol) | 258.16 |
| MDL Number | MFCD00062311 |
| SMILES | O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O |
| Synonym | kaolin,china clay,argilla,glomax,porcelain clay,bolus alba,white bole,hydrated aluminum silicate,kaolin clay slurry,alphagloss |
| IUPAC Name | oxo-oxoalumanyloxy-[oxo(oxoalumanyloxy)silyl]oxysilane;dihydrate |
| InChI Key | NLYAJNPCOHFWQQ-UHFFFAOYSA-N |
| Molecular Formula | Al2H4O9Si2 |