Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Sodium Chloride, Extra Pure, SLR, Fisher Chemical™
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Potassium chloride, 99%
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M Synonym: potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs PubChem CID: 4873 ChEBI: CHEBI:32588 IUPAC Name: potassium chloride SMILES: [Cl-].[K+]
| PubChem CID | 4873 |
|---|---|
| CAS | 7447-40-7 |
| Molecular Weight (g/mol) | 74.55 |
| ChEBI | CHEBI:32588 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| Synonym | potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs |
| IUPAC Name | potassium chloride |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |
Sodium Hydrogen Carbonate, Certified AR for Analysis, meets analytical specification of Ph.Eur, Fisher Chemical™
CHNaO3, CAS Number-144-55-8, acidosan, baking soda, bicarbonate of soda, carbonic acid monosodium salt, meylon, neut, sodium acid carbonate, sodium bicarbonate, sodium hydrogencarbonate, sodium hydrogen carbonate, 1kg, CHEBI:32139, White, 84.01g/mol, UIIMBOGNXHQVGW-UHFFFAOYSA-M | CAS: 144-55-8 | CHNaO3 | 84.01 g/mol
Sodium Thiosulfate Solution 0.1M (0.1N), NIST Standard Solution Ready To Use, for Volumetric Analysis, Fisher Chemical™
CAS: 7772-98-7 Molecular Formula: Na2O3S2 Molecular Weight (g/mol): 158.10 MDL Number: MFCD00003499 InChI Key: AKHNMLFCWUSKQB-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium sulfanidesulfonate SMILES: [Na+].[Na+].[O-]S([S-])(=O)=O
| PubChem CID | 61475 |
|---|---|
| CAS | 7772-98-7 |
| Molecular Weight (g/mol) | 158.10 |
| ChEBI | CHEBI:32150 |
| MDL Number | MFCD00003499 |
| SMILES | [Na+].[Na+].[O-]S([S-])(=O)=O |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium sulfanidesulfonate |
| InChI Key | AKHNMLFCWUSKQB-UHFFFAOYSA-L |
| Molecular Formula | Na2O3S2 |
Sodium Chloride, Certified AR for Analysis, meets analytical specification of Ph.Eur, Fisher Chemical™
ClNa, CAS Number-7647-14-5, saline, table salt, salt, sodium chloride, common salt, rock salt, dendritis, halite, sodium chloride nacl, purex, 1kg, 1461 deg.C, CHEBI:26710, White, 58.44g/mol, FAPWRFPIFSIZLT-UHFFFAOYSA-M, sodium;chloride, 801 deg.C, 3477, Plastic powder jar, 5.0 to 8.0, Solid, 5234 | CAS: 7647-14-5 | ClNa | 58.44 g/mol
Calcium chloride dihydrate, 99+%, ACS reagent
CAS: 10035-04-8 Molecular Formula: CaCl2·2H2O Molecular Weight (g/mol): 147.02 MDL Number: MFCD00149613
| CAS | 10035-04-8 |
|---|---|
| Molecular Weight (g/mol) | 147.02 |
| MDL Number | MFCD00149613 |
| Molecular Formula | CaCl2·2H2O |
Sand, pure, 40-100 mesh
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 14808-60-7 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Aluminum nitrate nonahydrate, 99+%, for analysis
CAS: 7784-27-2 InChI Key: SWCIQHXIXUMHKA-UHFFFAOYSA-N Synonym: aluminum nitrate nonahydrate,aluminum trinitrate nonahydrate,unii-8mc6621v1h,aluminum iii nitrate, nonahydrate 1:3:9,nitric acid aluminum salt,nitric acid, aluminum salt, nonahydrate 8ci,9ci,aluminum nitrate, acs,aluminum 3+ nonahydrate trinitronate,aluminum nitrate nonahydrate, low mercury, puratronic PubChem CID: 24567 IUPAC Name: aluminum;trinitrate;nonahydrate SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.O.O.O.O.O.O.[Al+3]
| PubChem CID | 24567 |
|---|---|
| CAS | 7784-27-2 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.O.O.O.O.O.O.[Al+3] |
| Synonym | aluminum nitrate nonahydrate,aluminum trinitrate nonahydrate,unii-8mc6621v1h,aluminum iii nitrate, nonahydrate 1:3:9,nitric acid aluminum salt,nitric acid, aluminum salt, nonahydrate 8ci,9ci,aluminum nitrate, acs,aluminum 3+ nonahydrate trinitronate,aluminum nitrate nonahydrate, low mercury, puratronic |
| IUPAC Name | aluminum;trinitrate;nonahydrate |
| InChI Key | SWCIQHXIXUMHKA-UHFFFAOYSA-N |
Sodium chloride, Puriss. p.a., ACS Reagent, Reag. ISO, Reag. Ph. Eur., ≥99.5%, Honeywell Fluka™
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Sand, Extra Pure, SLR, Fisher Chemical™
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: dioxosilane SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 14808-60-7 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | dioxosilane |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Sodium phosphate, dibasic, 99+%, for analysis, anhydrous
CAS: 7558-79-4 Molecular Formula: HNa2O4P Molecular Weight (g/mol): 141.96 MDL Number: MFCD00003496 InChI Key: BNIILDVGGAEEIG-UHFFFAOYSA-L Synonym: disodium hydrogen phosphate,disodium phosphate,disodium hydrogenorthophosphate,sodium phosphate dibasic,dibasic sodium phosphate,acetest,soda phosphate,disodium orthophosphate,sodium hydrogen phosphate,phosphoric acid, disodium salt PubChem CID: 24203 ChEBI: CHEBI:34683 SMILES: [Na+].[Na+].OP([O-])([O-])=O
| PubChem CID | 24203 |
|---|---|
| CAS | 7558-79-4 |
| Molecular Weight (g/mol) | 141.96 |
| ChEBI | CHEBI:34683 |
| MDL Number | MFCD00003496 |
| SMILES | [Na+].[Na+].OP([O-])([O-])=O |
| Synonym | disodium hydrogen phosphate,disodium phosphate,disodium hydrogenorthophosphate,sodium phosphate dibasic,dibasic sodium phosphate,acetest,soda phosphate,disodium orthophosphate,sodium hydrogen phosphate,phosphoric acid, disodium salt |
| InChI Key | BNIILDVGGAEEIG-UHFFFAOYSA-L |
| Molecular Formula | HNa2O4P |
Sodium Hexametaphosphate, SLR, Powder, Mainly (NaPO3)6, Fisher Chemical™
CAS: 10124-56-8 Molecular Formula: Na6O18P6 MDL Number: 136045
| CAS | 10124-56-8 |
|---|---|
| MDL Number | 136045 |
| Molecular Formula | Na6O18P6 |
Cesium carbonate, 99.5%, for analysis
CAS: 534-17-8 Molecular Formula: CCs2O3 Molecular Weight (g/mol): 325.82 MDL Number: MFCD00010957 InChI Key: FJDQFPXHSGXQBY-UHFFFAOYSA-L Synonym: cesium carbonate,dicesium carbonate,caesium carbonate,cesiumcarbonate,carbonic acid, dicesium salt,cs2co3,unii-qqi20a14p4,cesium carbonate cs2co3,carbonic acid, cesium salt 1:2,dicaesium 1+ ion carbonate PubChem CID: 10796 SMILES: [Cs+].[Cs+].[O-]C([O-])=O
| PubChem CID | 10796 |
|---|---|
| CAS | 534-17-8 |
| Molecular Weight (g/mol) | 325.82 |
| MDL Number | MFCD00010957 |
| SMILES | [Cs+].[Cs+].[O-]C([O-])=O |
| Synonym | cesium carbonate,dicesium carbonate,caesium carbonate,cesiumcarbonate,carbonic acid, dicesium salt,cs2co3,unii-qqi20a14p4,cesium carbonate cs2co3,carbonic acid, cesium salt 1:2,dicaesium 1+ ion carbonate |
| InChI Key | FJDQFPXHSGXQBY-UHFFFAOYSA-L |
| Molecular Formula | CCs2O3 |
Sodium bicarbonate, 99.5%, for analysis
CAS: 144-55-8 Molecular Formula: CHNaO3 Molecular Weight (g/mol): 84.01 MDL Number: MFCD00003528 InChI Key: UIIMBOGNXHQVGW-UHFFFAOYSA-M Synonym: sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut PubChem CID: 516892 ChEBI: CHEBI:32139 SMILES: [Na+].OC([O-])=O
| PubChem CID | 516892 |
|---|---|
| CAS | 144-55-8 |
| Molecular Weight (g/mol) | 84.01 |
| ChEBI | CHEBI:32139 |
| MDL Number | MFCD00003528 |
| SMILES | [Na+].OC([O-])=O |
| Synonym | sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut |
| InChI Key | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| Molecular Formula | CHNaO3 |
Sand, Extra Pure, SLR, Low Iron, 40-100 Mesh, Fisher Chemical™
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: dioxosilane SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 14808-60-7 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | dioxosilane |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |