Organic acids and derivatives
Filtered Search Results
n-Butylidenephthalide, (E)+(Z), 95%
CAS: 551-08-6 Molecular Formula: C12H12O2 Molecular Weight (g/mol): 188.23 MDL Number: MFCD00047319,MFCD00047319 InChI Key: WMBOCUXXNSOQHM-DHZHZOJOSA-N Synonym: ligusticum lactone,butylidene phthalide,n-butylidene phthalide,3-butylidene-1 3h-isobenzofuranone,3-butylidenephthalide,phthalide, 3-butylidene,fema no. 3333,bdph,3-butylidene phthalide,1 3h-isobenzofuranone, 3-butylidene PubChem CID: 5352899 IUPAC Name: (3E)-3-butylidene-2-benzofuran-1-one SMILES: CCC\C=C1\OC(=O)C2=CC=CC=C12
| PubChem CID | 5352899 |
|---|---|
| CAS | 551-08-6 |
| Molecular Weight (g/mol) | 188.23 |
| MDL Number | MFCD00047319,MFCD00047319 |
| SMILES | CCC\C=C1\OC(=O)C2=CC=CC=C12 |
| Synonym | ligusticum lactone,butylidene phthalide,n-butylidene phthalide,3-butylidene-1 3h-isobenzofuranone,3-butylidenephthalide,phthalide, 3-butylidene,fema no. 3333,bdph,3-butylidene phthalide,1 3h-isobenzofuranone, 3-butylidene |
| IUPAC Name | (3E)-3-butylidene-2-benzofuran-1-one |
| InChI Key | WMBOCUXXNSOQHM-DHZHZOJOSA-N |
| Molecular Formula | C12H12O2 |
Trimethyl 4-phosphonocrotonate, (E)+(Z), 90+%
CAS: 86120-40-3 Molecular Formula: C7H13O5P Molecular Weight (g/mol): 208.15 MDL Number: MFCD00051564 InChI Key: PESRINKNQQZURC-SNAWJCMRSA-N Synonym: methyl 4-dimethoxyphosphoryl but-2-enoate,trimethyl 4-phosphonocrotonate,methyl 2e-4-dimethoxyphosphoryl but-2-enoate,methyl 4-dimethoxyphosphorylbut-2-enoate,trimethyl 4-phosphonocrotonate, e + z,methyl e-4-dimethoxyphosphorylbut-2-enoate,4-dimethoxyphosphinyl crotonic acid methyl ester,e-4-dimethoxy-phosphoryl-but-2-enoic acid methyl ester PubChem CID: 5702556 IUPAC Name: methyl (E)-4-dimethoxyphosphorylbut-2-enoate SMILES: COC(=O)\C=C\CP(=O)(OC)OC
| PubChem CID | 5702556 |
|---|---|
| CAS | 86120-40-3 |
| Molecular Weight (g/mol) | 208.15 |
| MDL Number | MFCD00051564 |
| SMILES | COC(=O)\C=C\CP(=O)(OC)OC |
| Synonym | methyl 4-dimethoxyphosphoryl but-2-enoate,trimethyl 4-phosphonocrotonate,methyl 2e-4-dimethoxyphosphoryl but-2-enoate,methyl 4-dimethoxyphosphorylbut-2-enoate,trimethyl 4-phosphonocrotonate, e + z,methyl e-4-dimethoxyphosphorylbut-2-enoate,4-dimethoxyphosphinyl crotonic acid methyl ester,e-4-dimethoxy-phosphoryl-but-2-enoic acid methyl ester |
| IUPAC Name | methyl (E)-4-dimethoxyphosphorylbut-2-enoate |
| InChI Key | PESRINKNQQZURC-SNAWJCMRSA-N |
| Molecular Formula | C7H13O5P |
Ethyl (E)-2-cyano-3-ethoxycrotonate, 98%
CAS: 932750-29-3 Molecular Formula: C9H13NO3 Molecular Weight (g/mol): 183.207 MDL Number: MFCD01743485 InChI Key: YKXFOGAYPIPTKF-BQYQJAHWSA-N Synonym: ethyl 2e-2-cyano-3-ethoxybut-2-enoate,ethyl e-2-cyano-3-ethoxycrotonate,ethyl 2-cyano-3-ethoxybut-2-enoate,2-butenoic acid, 2-cyano-3-ethoxy-, ethyl ester,ethyl e-2-cyano-3-ethoxybut-2-enoate,e-ethyl 2-cyano-3-ethoxybut-2-enoate,ethyl e-2-cyano-3-ethoxy-2-butenoate,e-2-cyano-3-ethoxycrotonic acid ethyl ester,e-2-cyano-3-ethoxy-2-butenoic acid ethyl ester PubChem CID: 6387109 IUPAC Name: ethyl (E)-2-cyano-3-ethoxybut-2-enoate SMILES: CCOC(=C(C#N)C(=O)OCC)C
| PubChem CID | 6387109 |
|---|---|
| CAS | 932750-29-3 |
| Molecular Weight (g/mol) | 183.207 |
| MDL Number | MFCD01743485 |
| SMILES | CCOC(=C(C#N)C(=O)OCC)C |
| Synonym | ethyl 2e-2-cyano-3-ethoxybut-2-enoate,ethyl e-2-cyano-3-ethoxycrotonate,ethyl 2-cyano-3-ethoxybut-2-enoate,2-butenoic acid, 2-cyano-3-ethoxy-, ethyl ester,ethyl e-2-cyano-3-ethoxybut-2-enoate,e-ethyl 2-cyano-3-ethoxybut-2-enoate,ethyl e-2-cyano-3-ethoxy-2-butenoate,e-2-cyano-3-ethoxycrotonic acid ethyl ester,e-2-cyano-3-ethoxy-2-butenoic acid ethyl ester |
| IUPAC Name | ethyl (E)-2-cyano-3-ethoxybut-2-enoate |
| InChI Key | YKXFOGAYPIPTKF-BQYQJAHWSA-N |
| Molecular Formula | C9H13NO3 |
Ethyl 3-(trifluoromethyl)crotonate, (E)+(Z), 96%
CAS: 24490-03-7 Molecular Formula: C7H9F3O2 Molecular Weight (g/mol): 182.14 MDL Number: MFCD00040846 InChI Key: OSZLARYVWBUKTG-SNAWJCMRSA-N Synonym: ethyl 4,4,4-trifluoro-3-methylbut-2-enoate,ethyl 3-trifluoromethyl crotonate,ethyl 2e-4,4,4-trifluoro-3-methylbut-2-enoate,ethyl 3-trifluoromethyl crotonate, cis + trans,ethyl e-4,4,4-trifluoro-3-methylbut-2-enoate,e-3-trifluoromethyl-2-butenoic acid ethyl ester PubChem CID: 5838607 IUPAC Name: ethyl (E)-4,4,4-trifluoro-3-methylbut-2-enoate SMILES: CCOC(=O)\C=C(/C)C(F)(F)F
| PubChem CID | 5838607 |
|---|---|
| CAS | 24490-03-7 |
| Molecular Weight (g/mol) | 182.14 |
| MDL Number | MFCD00040846 |
| SMILES | CCOC(=O)\C=C(/C)C(F)(F)F |
| Synonym | ethyl 4,4,4-trifluoro-3-methylbut-2-enoate,ethyl 3-trifluoromethyl crotonate,ethyl 2e-4,4,4-trifluoro-3-methylbut-2-enoate,ethyl 3-trifluoromethyl crotonate, cis + trans,ethyl e-4,4,4-trifluoro-3-methylbut-2-enoate,e-3-trifluoromethyl-2-butenoic acid ethyl ester |
| IUPAC Name | ethyl (E)-4,4,4-trifluoro-3-methylbut-2-enoate |
| InChI Key | OSZLARYVWBUKTG-SNAWJCMRSA-N |
| Molecular Formula | C7H9F3O2 |
(E)-1-Heptene-1,2-diboronic acid bis(pinacol) ester, 98%, Thermo Scientific Chemicals
CAS: 307531-74-4 Molecular Formula: C19H36B2O4 Molecular Weight (g/mol): 350.113 MDL Number: MFCD02683463 InChI Key: KBMWLQPDFRGVTD-PFONDFGASA-N Synonym: 1-cis-1,2-bis 4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl heptene,e-1-heptene-1,2-diboronic acid bis pinacol ester,1,2-bis 4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-yl-1-heptene,4,4,5,5-tetramethyl-2-1e-2-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl hept-1-en-1-yl-1,3,2-dioxaborolane,4,4,5,5-tetramethyl-2-e-1-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl hept-1-en-2-yl-1,3,2-dioxaborolane,4,4,5,5-tetramethyl-2-1-tetramethyl-1,3,2-dioxaborolan-2-yl hept-1-en-2-yl-1,3,2-dioxaborolane PubChem CID: 5708398 IUPAC Name: 4,4,5,5-tetramethyl-2-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-1-en-2-yl]-1,3,2-dioxaborolane SMILES: B1(OC(C(O1)(C)C)(C)C)C=C(B2OC(C(O2)(C)C)(C)C)CCCCC
| PubChem CID | 5708398 |
|---|---|
| CAS | 307531-74-4 |
| Molecular Weight (g/mol) | 350.113 |
| MDL Number | MFCD02683463 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C=C(B2OC(C(O2)(C)C)(C)C)CCCCC |
| Synonym | 1-cis-1,2-bis 4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl heptene,e-1-heptene-1,2-diboronic acid bis pinacol ester,1,2-bis 4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-yl-1-heptene,4,4,5,5-tetramethyl-2-1e-2-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl hept-1-en-1-yl-1,3,2-dioxaborolane,4,4,5,5-tetramethyl-2-e-1-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl hept-1-en-2-yl-1,3,2-dioxaborolane,4,4,5,5-tetramethyl-2-1-tetramethyl-1,3,2-dioxaborolan-2-yl hept-1-en-2-yl-1,3,2-dioxaborolane |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(E)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-1-en-2-yl]-1,3,2-dioxaborolane |
| InChI Key | KBMWLQPDFRGVTD-PFONDFGASA-N |
| Molecular Formula | C19H36B2O4 |
(E)-2-Decenoic acid, MedChemExpress
MedChemExpress (E)-2-Decenoic acid is an interesting fatty acid isolated from royal jelly secretions of honey bees.
Non-distribution item offered as a customer accommodation; additional freight charges may apply.
Learn More
Dimethyl fumarate, 99%
CAS: 624-49-7 Molecular Formula: C6H8O4 Molecular Weight (g/mol): 144.13 MDL Number: MFCD00064438 InChI Key: LDCRTTXIJACKKU-ONEGZZNKSA-N Synonym: dimethyl fumarate,tecfidera,e-dimethyl fumarate,fumaderm,dimethyl e-but-2-enedioate,fumaric acid, dimethyl ester,boletic acid dimethyl ester,fumaric acid dimethyl ester,methyl fumarate,dimethyl trans-ethylenedicarboxylate PubChem CID: 637568 ChEBI: CHEBI:76004 IUPAC Name: dimethyl (E)-but-2-enedioate SMILES: COC(=O)C=CC(=O)OC
| PubChem CID | 637568 |
|---|---|
| CAS | 624-49-7 |
| Molecular Weight (g/mol) | 144.13 |
| ChEBI | CHEBI:76004 |
| MDL Number | MFCD00064438 |
| SMILES | COC(=O)C=CC(=O)OC |
| Synonym | dimethyl fumarate,tecfidera,e-dimethyl fumarate,fumaderm,dimethyl e-but-2-enedioate,fumaric acid, dimethyl ester,boletic acid dimethyl ester,fumaric acid dimethyl ester,methyl fumarate,dimethyl trans-ethylenedicarboxylate |
| IUPAC Name | dimethyl (E)-but-2-enedioate |
| InChI Key | LDCRTTXIJACKKU-ONEGZZNKSA-N |
| Molecular Formula | C6H8O4 |
Ethyl cinnamate, 98+%
CAS: 103-36-6 Molecular Formula: C11H12O2 Molecular Weight (g/mol): 176.215 MDL Number: MFCD00009189 InChI Key: KBEBGUQPQBELIU-CMDGGOBGSA-N Synonym: ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate PubChem CID: 637758 ChEBI: CHEBI:4895 IUPAC Name: ethyl (E)-3-phenylprop-2-enoate SMILES: CCOC(=O)C=CC1=CC=CC=C1
| PubChem CID | 637758 |
|---|---|
| CAS | 103-36-6 |
| Molecular Weight (g/mol) | 176.215 |
| ChEBI | CHEBI:4895 |
| MDL Number | MFCD00009189 |
| SMILES | CCOC(=O)C=CC1=CC=CC=C1 |
| Synonym | ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate |
| IUPAC Name | ethyl (E)-3-phenylprop-2-enoate |
| InChI Key | KBEBGUQPQBELIU-CMDGGOBGSA-N |
| Molecular Formula | C11H12O2 |
Methyl tiglate, 98%
CAS: 6622-76-0 Molecular Formula: C6H10O2 Molecular Weight (g/mol): 114.14 MDL Number: MFCD00016654 InChI Key: YYJWBYNQJLBIGS-PLNGDYQASA-N Synonym: methyl tiglate,tiglic acid methyl ester,methyl 2-methylbut-2-enoate,methyl 2-methyl-2-butenoate,methyl e-2-methylcrotonate,methyl 2-methylcrotonate,methyl alpha-methylcrotonate,methyl trans-2-methylcrotonate,2-butenoic acid, 2-methyl-, methyl ester, e,crotonic acid, 2-methyl-, methyl ester, e PubChem CID: 5323652 IUPAC Name: methyl (E)-2-methylbut-2-enoate SMILES: COC(=O)C(\C)=C/C
| PubChem CID | 5323652 |
|---|---|
| CAS | 6622-76-0 |
| Molecular Weight (g/mol) | 114.14 |
| MDL Number | MFCD00016654 |
| SMILES | COC(=O)C(\C)=C/C |
| Synonym | methyl tiglate,tiglic acid methyl ester,methyl 2-methylbut-2-enoate,methyl 2-methyl-2-butenoate,methyl e-2-methylcrotonate,methyl 2-methylcrotonate,methyl alpha-methylcrotonate,methyl trans-2-methylcrotonate,2-butenoic acid, 2-methyl-, methyl ester, e,crotonic acid, 2-methyl-, methyl ester, e |
| IUPAC Name | methyl (E)-2-methylbut-2-enoate |
| InChI Key | YYJWBYNQJLBIGS-PLNGDYQASA-N |
| Molecular Formula | C6H10O2 |
3-Acetoxy-1-propenylboronic acid pinacol ester, 97%
CAS: 161395-97-7 Molecular Formula: C11H19BO4 Molecular Weight (g/mol): 226.08 MDL Number: MFCD03788751 InChI Key: ZXBRLGZFCXGTBA-UHFFFAOYSA-N Synonym: 3-acetoxy-1-propenylboronic acid pinacol ester,e-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl allyl acetate,2-3-acetoxy-1-propenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2e-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-2-propen-1-yl acetate,2e-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl prop-2-en-1-yl acetate,e-3-acetoxy-1-propenylboronic acid 2,3-dimethylbutane-2,3-diyl ester PubChem CID: 11264613 IUPAC Name: [(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] acetate SMILES: CC(=O)OCC=CB1OC(C)(C)C(C)(C)O1
| PubChem CID | 11264613 |
|---|---|
| CAS | 161395-97-7 |
| Molecular Weight (g/mol) | 226.08 |
| MDL Number | MFCD03788751 |
| SMILES | CC(=O)OCC=CB1OC(C)(C)C(C)(C)O1 |
| Synonym | 3-acetoxy-1-propenylboronic acid pinacol ester,e-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl allyl acetate,2-3-acetoxy-1-propenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane,2e-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl-2-propen-1-yl acetate,2e-3-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl prop-2-en-1-yl acetate,e-3-acetoxy-1-propenylboronic acid 2,3-dimethylbutane-2,3-diyl ester |
| IUPAC Name | [(E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] acetate |
| InChI Key | ZXBRLGZFCXGTBA-UHFFFAOYSA-N |
| Molecular Formula | C11H19BO4 |
Ethyl trans-4-decenoate, 97%
CAS: 76649-16-6 Molecular Formula: C12H22O2 Molecular Weight (g/mol): 198.31 MDL Number: MFCD00015574 InChI Key: AWNIQMQADACLCJ-CMDGGOBGSA-N Synonym: ethyl trans-4-decenoate,ethyl e-4-decenoate,ethyl 4-decenoate,4-decenoic acid, ethyl ester, e,ethyl 4e-decenoate,fema no. 3642,ethyl 4e-dec-4-enoate,ethyl trans-dec-4-enoate,ethyl e-dec-4-enoate,ethyl 4e-4-decenoate PubChem CID: 5362583 IUPAC Name: ethyl (E)-dec-4-enoate SMILES: CCCCC\C=C\CCC(=O)OCC
| PubChem CID | 5362583 |
|---|---|
| CAS | 76649-16-6 |
| Molecular Weight (g/mol) | 198.31 |
| MDL Number | MFCD00015574 |
| SMILES | CCCCC\C=C\CCC(=O)OCC |
| Synonym | ethyl trans-4-decenoate,ethyl e-4-decenoate,ethyl 4-decenoate,4-decenoic acid, ethyl ester, e,ethyl 4e-decenoate,fema no. 3642,ethyl 4e-dec-4-enoate,ethyl trans-dec-4-enoate,ethyl e-dec-4-enoate,ethyl 4e-4-decenoate |
| IUPAC Name | ethyl (E)-dec-4-enoate |
| InChI Key | AWNIQMQADACLCJ-CMDGGOBGSA-N |
| Molecular Formula | C12H22O2 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, disodium salt dihydrate, 99+%, for analysis
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Ethyl 3-hexenoate, 98%
CAS: 2396-83-0 Molecular Formula: C8H14O2 Molecular Weight (g/mol): 142.20 MDL Number: MFCD00036524 InChI Key: VTSFIPHRNAESED-AATRIKPKSA-N Synonym: ethyl 3-hexenoate,3-hexenoic acid, ethyl ester,ethyl hex-3-enoate,ethyl e-hex-3-enoate,3-hexenoic acid, ethyl ester, e,ethyl trans-3-hexenoate,ethyl e-3-hexenoate,e-3-hexenoic acid ethyl ester,ethyl hydrosorbate,3-hexenoic acid, ethyl ester, 3e PubChem CID: 5362622 IUPAC Name: ethyl (E)-hex-3-enoate SMILES: CCOC(=O)C\C=C\CC
| PubChem CID | 5362622 |
|---|---|
| CAS | 2396-83-0 |
| Molecular Weight (g/mol) | 142.20 |
| MDL Number | MFCD00036524 |
| SMILES | CCOC(=O)C\C=C\CC |
| Synonym | ethyl 3-hexenoate,3-hexenoic acid, ethyl ester,ethyl hex-3-enoate,ethyl e-hex-3-enoate,3-hexenoic acid, ethyl ester, e,ethyl trans-3-hexenoate,ethyl e-3-hexenoate,e-3-hexenoic acid ethyl ester,ethyl hydrosorbate,3-hexenoic acid, ethyl ester, 3e |
| IUPAC Name | ethyl (E)-hex-3-enoate |
| InChI Key | VTSFIPHRNAESED-AATRIKPKSA-N |
| Molecular Formula | C8H14O2 |
trans-Ethyl crotonate, 96%
CAS: 623-70-1 Molecular Formula: C6H10O2 Molecular Weight (g/mol): 114.14 MDL Number: MFCD00009289 InChI Key: ZFDIRQKJPRINOQ-HWKANZROSA-N Synonym: ethyl crotonate,ethyl trans-crotonate,ethyl e-but-2-enoate,ethyl trans-2-butenoate,crotonic acid, ethyl ester,2-butenoic acid, ethyl ester, 2e,ethyl e-2-butenoate,2-butenoic acid, ethyl ester,ethyl 2e-but-2-enoate,crotonic acid, ethyl ester, e PubChem CID: 429065 IUPAC Name: ethyl (E)-but-2-enoate SMILES: CCOC(=O)\C=C\C
| PubChem CID | 429065 |
|---|---|
| CAS | 623-70-1 |
| Molecular Weight (g/mol) | 114.14 |
| MDL Number | MFCD00009289 |
| SMILES | CCOC(=O)\C=C\C |
| Synonym | ethyl crotonate,ethyl trans-crotonate,ethyl e-but-2-enoate,ethyl trans-2-butenoate,crotonic acid, ethyl ester,2-butenoic acid, ethyl ester, 2e,ethyl e-2-butenoate,2-butenoic acid, ethyl ester,ethyl 2e-but-2-enoate,crotonic acid, ethyl ester, e |
| IUPAC Name | ethyl (E)-but-2-enoate |
| InChI Key | ZFDIRQKJPRINOQ-HWKANZROSA-N |
| Molecular Formula | C6H10O2 |
Ethyl crotonate, 98%
CAS: 623-70-1 Molecular Formula: C6H10O2 Molecular Weight (g/mol): 114.14 MDL Number: MFCD00009289 InChI Key: ZFDIRQKJPRINOQ-HWKANZROSA-N Synonym: ethyl crotonate,ethyl trans-crotonate,ethyl e-but-2-enoate,ethyl trans-2-butenoate,crotonic acid, ethyl ester,2-butenoic acid, ethyl ester, 2e,ethyl e-2-butenoate,2-butenoic acid, ethyl ester,ethyl 2e-but-2-enoate,crotonic acid, ethyl ester, e PubChem CID: 429065 IUPAC Name: ethyl (E)-but-2-enoate SMILES: CCOC(=O)\C=C\C
| PubChem CID | 429065 |
|---|---|
| CAS | 623-70-1 |
| Molecular Weight (g/mol) | 114.14 |
| MDL Number | MFCD00009289 |
| SMILES | CCOC(=O)\C=C\C |
| Synonym | ethyl crotonate,ethyl trans-crotonate,ethyl e-but-2-enoate,ethyl trans-2-butenoate,crotonic acid, ethyl ester,2-butenoic acid, ethyl ester, 2e,ethyl e-2-butenoate,2-butenoic acid, ethyl ester,ethyl 2e-but-2-enoate,crotonic acid, ethyl ester, e |
| IUPAC Name | ethyl (E)-but-2-enoate |
| InChI Key | ZFDIRQKJPRINOQ-HWKANZROSA-N |
| Molecular Formula | C6H10O2 |